![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 007 James Bond Complete Set (1962-2015) 720p/ | 2020-10-25 10:43 | - | |
| 2 Lava 2 Lantula! (2016) 1080p BluRay/ | 2020-10-25 10:45 | - | |
| 10 Cloverfield Lane (2016) 1080p/ | 2020-10-01 16:57 | - | |
| 13 Hours (2016) 1080p/ | 2020-10-01 20:24 | - | |
| 20th Century Women (2016) 1080p/ | 2020-10-01 16:54 | - | |
| 31 (2016) 1080p/ | 2020-10-01 16:47 | - | |
| 37 (2016)1080p/ | 2020-10-01 20:24 | - | |
| 48 Hours To Live (2016) BluRay 1080p/ | 2020-10-01 18:05 | - | |
| 100 Bullets (2016) WEBRip 1080p/ | 2020-10-01 20:01 | - | |
| 100 Streets (2016) 1080p/ | 2020-10-01 16:43 | - | |
| A Beautiful Planet (2016) BluRay 1080p/ | 2020-10-01 20:25 | - | |
| A Cure For Wellness (2016) 1080p/ | 2020-10-01 16:52 | - | |
| A Dark Song (2016) 1080p/ | 2020-10-01 17:41 | - | |
| A Date For Mad Mary (2016) WEBRip 1080p/ | 2020-10-01 16:59 | - | |
| A Family Man (2016) 1080p/ | 2020-10-01 19:20 | - | |
| A Heavenly Christmas (2016) 1080p/ | 2020-10-01 19:04 | - | |
| A Hologram for the King (2016) 1080p/ | 2020-10-01 19:38 | - | |
| A Kind Of Murder (2016) 1080p/ | 2020-10-01 16:49 | - | |
| A Monster Calls (2016) 1080p/ | 2020-10-01 19:48 | - | |
| APEX The Story of the Hypercar (2016) 720p/ | 2020-10-01 17:59 | - | |
| A Plastic Ocean (2016) 1080p/ | 2020-10-01 16:59 | - | |
| A Quiet Passion (2016) 720p/ | 2020-10-01 19:30 | - | |
| ARQ (2016) WEBRip 1080p/ | 2020-10-01 20:26 | - | |
| A Stand Up Guy (2016) 1080p/ | 2020-10-01 19:26 | - | |
| A Street Cat Named Bob (2016) 1080p/ | 2020-10-01 19:35 | - | |
| A Sunday Horse (2015) 1080p/ | 2020-10-01 20:16 | - | |
| A Time To Dance (2016) 1080p/ | 2020-10-01 20:13 | - | |
| A United Kingdom (2016) 1080p/ | 2020-10-01 20:05 | - | |
| A Violent Prosecutor (2016) 720p/ | 2020-10-01 19:36 | - | |
| A Year In Space (2016) 1080p/ | 2020-10-01 16:44 | - | |
| Aap Wong 2 (2016) 1080p/ | 2020-10-01 19:51 | - | |
| Abattoir (2016) 1080p/ | 2020-10-01 18:00 | - | |
| Absolutely Fabulous The Movie (2016) 1080p/ | 2020-10-01 19:52 | - | |
| Accidentally Engaged (2016) 1080p/ | 2020-10-01 19:55 | - | |
| Adult Life Skills (2016) 1080p/ | 2020-10-01 16:51 | - | |
| Adventures in Babysitting (2016) 720p/ | 2020-10-01 16:45 | - | |
| After The Reality (2016) BluRay 1080p/ | 2020-10-01 16:45 | - | |
| After The Storm (2016) 1080p BluRay/ | 2020-10-01 16:55 | - | |
| Albion The Enchanted Stallion (2016) 1080p/ | 2020-10-01 19:56 | - | |
| Ali And Nino (2016) 1080p/ | 2020-10-01 20:21 | - | |
| Alice Through The Looking Glass (2016) [1080p]/ | 2020-10-01 19:56 | - | |
| All Girls Weekend (2016) 1080p/ | 2020-10-01 19:47 | - | |
| All I See Is You (2016) 1080p/ | 2020-10-01 16:51 | - | |
| All The Way (2016) 1080p BluRay/ | 2020-10-01 19:35 | - | |
| All Yours (2016) 720p/ | 2020-10-01 19:29 | - | |
| Allegiant (2016) 1080p BluRay/ | 2020-10-01 19:47 | - | |
| Alleycats (2016) 1080p/ | 2020-10-01 20:23 | - | |
| Allied (2016) 1080p/ | 2020-10-01 20:26 | - | |
| Almost Adults (2016) 1080p/ | 2020-10-01 19:12 | - | |
| Almost Christmas (2016) 1080p/ | 2020-10-01 19:36 | - | |
| Alone In Berlin (2016) 1080p/ | 2020-10-01 20:28 | - | |
| Along For The Ride (2016) 1080p/ | 2020-10-01 16:57 | - | |
| Altamira (2016) 720p/ | 2020-10-01 19:57 | - | |
| Altered Hours (2016) 1080p/ | 2020-10-01 19:03 | - | |
| Always Shine (2016) 1080p/ | 2020-10-01 16:58 | - | |
| Amateur Night (2016) WEBRip 1080p/ | 2020-10-01 19:48 | - | |
| AmeriGeddon (2016) 1080p/ | 2020-10-01 16:55 | - | |
| American Conjuring (2016) 1080p/ | 2020-10-01 17:55 | - | |
| American Honey (2016) 1080p/ | 2020-10-01 20:19 | - | |
| American Pastoral (2016) 1080p/ | 2020-10-01 20:27 | - | |
| American Pie - Complete set- 720px/ | 2020-10-01 16:43 | - | |
| American Romance (2016) BluRay 720p/ | 2020-10-01 19:19 | - | |
| Angry Birds (2016) 1080p BluRay/ | 2020-10-01 19:48 | - | |
| Anne of Green Gables 2016 720p BRRip 650 MB - iExTV/ | 2020-10-01 19:01 | - | |
| Anthropoid (2016) 1080p/ | 2020-10-25 10:41 | - | |
| Anti Matter (2016) 1080p WEB-DL/ | 2020-10-01 19:35 | - | |
| Antiporno (2016) BluRay 1080p/ | 2020-10-01 20:28 | - | |
| Approaching the Unknown (2016) 1080p/ | 2020-10-01 19:37 | - | |
| Arbor Demon (2016) BluRay 1080p/ | 2020-10-01 16:44 | - | |
| Army Of One (2016) 1080p/ | 2020-10-01 19:58 | - | |
| Arq (2016)1080p/ | 2018-04-24 05:35 | - | |
| Arrival (2016) 1080p/ | 2020-10-01 19:00 | - | |
| As Far As The Eye Can See (2016) 1080p/ | 2020-10-01 20:01 | - | |
| Assassin's Creed (2016) BluRay 720p/ | 2020-10-01 20:19 | - | |
| Attack Of The Killer Donuts (2016) 1080p/ | 2020-10-01 17:51 | - | |
| Attack of the Lederhosen Zombies (2016) 1080p/ | 2020-10-01 20:22 | - | |
| Autumn Lights (2016) 1080p/ | 2020-10-01 20:32 | - | |
| Baby's Day Out - 1080p/ | 2020-10-25 10:42 | - | |
| Back in the Day (2016) HDRip/ | 2020-10-01 20:31 | - | |
| Backstabbed (2016) 1080p/ | 2020-10-01 19:45 | - | |
| Bad Black (2016) BluRay 1080p/ | 2020-10-01 20:18 | - | |
| Bad Moms (2016) 1080p/ | 2020-10-01 16:55 | - | |
| Bad Santa 2 (2016) 1080p/ | 2020-10-01 19:53 | - | |
| Baked In Brooklyn (2016) 1080p/ | 2020-10-01 18:05 | - | |
| Barbershop The Next Cut (2016) 1080p/ | 2020-10-01 19:33 | - | |
| Barbie Spy Squad (2016) 1080p/ | 2020-10-01 16:46 | - | |
| Barbie Star Light Adventure (2016) 720p/ | 2020-10-01 19:01 | - | |
| Barry (2016) 1080p/ | 2020-10-01 17:59 | - | |
| Bastille Day (2016) 1080p/ | 2020-10-01 16:49 | - | |
| Batman Bad Blood (2016) 1080p/ | 2020-10-01 19:31 | - | |
| Batman The Killing Joke (2016) 1080p/ | 2020-10-01 16:50 | - | |
| Batman Unlimited Mech vs Mutants (2016) 720p/ | 2020-10-01 20:17 | - | |
| Batman V Superman Dawn Of Justice (2016) BluRay 1080p/ | 2020-11-25 13:56 | - | |
| Be Somebody (2016) 1080p/ | 2020-10-01 19:51 | - | |
| Beautiful Prison (2016) 1080p/ | 2020-10-01 16:54 | - | |
| Before I Wake (2016) 1080p/ | 2020-10-23 08:06 | - | |
| Being 17 (2016) 1080p BluRay/ | 2020-10-01 19:51 | - | |
| Below Her Mouth (2016) 1080p/ | 2018-07-30 10:37 | - | |
| Below The Surface (2016) 1080p/ | 2020-10-01 20:18 | - | |
| Ben Hur (2016) 720p/ | 2020-10-01 16:54 | - | |
| Berserk Golden Age Arc I-II-III - 1080p/ | 2020-10-01 19:33 | - | |
| Beta Test (2016) 720p/ | 2020-10-01 16:42 | - | |
| Better Criminal (2016) 720p/ | 2020-10-01 16:56 | - | |
| Beyond The Call To Duty (2016) 1080p/ | 2020-10-01 16:54 | - | |
| Beyond Valkyrie Dawn of the Fourth Reich (2016) 1080p/ | 2020-10-23 07:12 | - | |
| Billionaire Ransom (2016) 1080p/ | 2020-10-01 17:55 | - | |
| Billy Lynn's Long Halftime Walk (2016) 1080p/ | 2020-10-01 16:55 | - | |
| Birth Of The Dragon (2016) 1080p/ | 2020-10-01 20:15 | - | |
| Bite (2016) 720p/ | 2020-10-01 19:20 | - | |
| Black Code (2016) 1080p/ | 2020-10-01 19:38 | - | |
| Black Tar Road (2016) 720p/ | 2020-10-25 10:49 | - | |
| Bleed for This( 2016) 1080p BluRay/ | 2020-10-01 20:11 | - | |
| Bling (2016) 720p/ | 2020-10-01 18:01 | - | |
| Blood Father (2016) 1080p BluRay/ | 2020-10-01 19:49 | - | |
| Blood Feast (2016) BluRay 1080p/ | 2020-10-01 19:48 | - | |
| Blood In The Water (2016) WEBRip 1080p/ | 2020-10-01 19:48 | - | |
| Blood Is Blood (2016) 1080p/ | 2020-10-01 19:06 | - | |
| Blood Lust (2016) 1080p/ | 2020-10-01 16:58 | - | |
| Blood Orange (2016) 1080p/ | 2020-10-01 20:31 | - | |
| Bloody Chainsaw Girl (2016) 720p/ | 2020-10-01 19:57 | - | |
| Blue Jay (2016) 1080p/ | 2020-10-01 19:53 | - | |
| Blue Mountain State (2016) 720p/ | 2020-10-01 19:48 | - | |
| Bodies (2016) BluRay 1080p/ | 2020-10-01 19:10 | - | |
| Boko Haram Terror In Africa (2016) 1080p/ | 2020-10-25 10:43 | - | |
| Boo! A Madea Halloween (2016) 1080p/ | 2020-10-01 18:02 | - | |
| Boyka Undisputed IV (2016) 1080p Bluray/ | 2020-10-01 19:06 | - | |
| Brain On Fire (2016) BluRay 1080p/ | 2020-10-01 17:51 | - | |
| Bridget Joness Baby (2016) 720p/ | 2020-10-01 17:45 | - | |
| Bright Lights Starring Carrie Fisher And Debbie Reynolds (2016) 1080p/ | 2020-10-01 19:02 | - | |
| Brimstone (2016) 1080p BluRay/ | 2020-12-30 11:48 | - | |
| Brother Nature (2016) 1080p/ | 2020-10-01 20:25 | - | |
| Brotherhood (2016) 720p/ | 2020-10-01 19:12 | - | |
| Buddy Cops (2016) 720p/ | 2020-10-01 19:07 | - | |
| Buddymoon (2016) 720p/ | 2020-10-01 20:31 | - | |
| Burn Your Maps (2016) WEBRip 1080p/ | 2020-10-01 19:53 | - | |
| Buster's Mal Heart (2016) 1080p/ | 2020-10-01 20:04 | - | |
| Cabin Fever (2016) 1080p BluRay/ | 2020-10-01 16:46 | - | |
| Cafe Society (2016) 1080p BluRay/ | 2020-10-01 16:59 | - | |
| California Typewriter (2016) 1080p/ | 2020-10-01 19:44 | - | |
| Captain America- Civil War (2016) 1080p BluRay/ | 2026-08-02 15:23 | - | |
| Captain Fantastic (2016) 1080p/ | 2020-10-01 16:55 | - | |
| Cardboard Boxer (2016) 1080p/ | 2020-10-01 19:42 | - | |
| Carnage Park (2016) 1080p/ | 2020-10-01 16:59 | - | |
| Casual Encounters (2016) 1080p/ | 2020-10-01 19:17 | - | |
| Cave (2016) 720p/ | 2020-10-01 19:43 | - | |
| Cell (2016) 720p/ | 2020-10-01 20:31 | - | |
| Central Intelligence (2016) BluRay 1080p/ | 2020-10-01 16:56 | - | |
| Centre Of My World (2016) 1080p/ | 2020-10-01 16:43 | - | |
| Changeover (2016) 1080p/ | 2020-10-25 10:41 | - | |
| Charlie Charlie (2016) 1080p/ | 2020-10-01 17:59 | - | |
| ChickLit (2016) 1080p/ | 2020-10-25 10:45 | - | |
| Child Eater (2016) BluRay 1080p/ | 2020-10-01 16:58 | - | |
| Chokeslam (2016) 1080p BluRay/ | 2020-10-01 17:42 | - | |
| Chongqing Hot Pot (2016) 1080p/ | 2020-10-01 17:49 | - | |
| Chosen (2016) 720p/ | 2020-10-01 19:04 | - | |
| Christine (2016) 1080p/ | 2020-10-01 20:11 | - | |
| Citizen Soldier (2016) 720p/ | 2020-10-01 20:31 | - | |
| City Of Joy (2016) 1080p/ | 2020-10-01 19:57 | - | |
| Clash (2016) BluRay 1080p/ | 2020-10-01 20:13 | - | |
| Clinton Cash (2016) 720p/ | 2020-10-01 17:00 | - | |
| Code Of Honor (2016) 1080p/ | 2020-10-01 19:15 | - | |
| Cold Moon (2016) 1080p/ | 2020-10-01 19:58 | - | |
| Collateral Beauty (2016) 1080p BluRay/ | 2020-10-01 19:50 | - | |
| Collide (2016) 1080p/ | 2020-10-01 19:11 | - | |
| Come And Find Me (2016) 1080p/ | 2020-10-01 19:14 | - | |
| Complete Unknown (2016) 1080p/ | 2020-10-01 16:53 | - | |
| Consumption (2016) 1080p/ | 2020-10-01 19:53 | - | |
| Contract To Kill (2016) 1080p/ | 2020-10-01 16:55 | - | |
| Cowboy Zombies (2016) 1080p/ | 2020-10-01 19:54 | - | |
| Criminal (2016) 1080p/ | 2020-10-01 20:11 | - | |
| Crossing Point (2016) 1080p/ | 2020-10-25 10:46 | - | |
| Crouching Tiger Hidden Dragon Sword of Destiny (2016) 1080p/ | 2020-10-01 20:20 | - | |
| Cup of Love (2016) 1080p/ | 2020-10-01 20:30 | - | |
| Cyborg X (2016) 1080p BluRay/ | 2020-10-01 20:00 | - | |
| Dad s Army (2016) 1080p/ | 2020-10-25 10:41 | - | |
| Dark Crimes (2016) 1080p/ | 2020-10-01 16:52 | - | |
| Dark Harvest (2016) WEBRip 1080p/ | 2020-10-01 19:57 | - | |
| David And Goliath (2016) 1080p/ | 2020-10-01 19:54 | - | |
| David Brent Life on the Road (2016) 720p/ | 2020-10-25 10:41 | - | |
| Dawson City Frozen Time (2016) 1080p/ | 2020-10-01 16:55 | - | |
| Day Of Reckoning (2016) 1080p/ | 2020-10-01 19:08 | - | |
| Daylight s End (2016) 1080p/ | 2020-10-01 16:47 | - | |
| Dead Awake (2016) 1080p WEB-DL/ | 2020-10-25 10:41 | - | |
| Dead Rising Endgame (2016) 1080p/ | 2020-10-01 20:14 | - | |
| Deadly Signal (2016) 1080p/ | 2020-10-01 19:40 | - | |
| Deadpool (2016) 1080p/ | 2020-10-01 19:48 | - | |
| Dear Diary I Died (2016) 1080p/ | 2020-10-01 19:00 | - | |
| Deepwater Horizon (2016)1080p/ | 2020-10-01 18:07 | - | |
| Demain Tous Commence (2016) 1080p/ | 2020-10-01 16:42 | - | |
| Denial (2016) 1080p/ | 2020-10-01 19:58 | - | |
| Den of Darkness (2016) 1080p/ | 2020-10-01 16:56 | - | |
| Despite The Falling Snow (2016) 1080p/ | 2020-10-01 16:54 | - | |
| Detour (2016) 1080p/ | 2018-05-04 11:10 | - | |
| Detour (2016) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| Diablo (2016) 720p/ | 2020-10-01 20:22 | - | |
| Die Hard 1, 2, 3, 4, 5/ | 2020-10-01 20:29 | - | |
| Dirty 30 (2016) WEBRip 1080p/ | 2020-10-01 16:57 | - | |
| Dirty Grandpa (2016) 1080p/ | 2020-10-01 16:57 | - | |
| Ditch Day Massacre (2016) 1080p/ | 2020-10-01 19:39 | - | |
| Doctor Strange (2016) 1080p/ | 2026-08-06 13:54 | - | |
| Dog Eat Dog (2016) 720p/ | 2020-10-01 20:16 | - | |
| Don't Breathe (2016) 1080p BluRay/ | 2020-10-01 20:19 | - | |
| Don't Kill It (2016) 1080p/ | 2020-10-01 20:26 | - | |
| Dont Knock Twice (2016) 1080p/ | 2024-01-03 17:55 | - | |
| Dwelling (2016) BluRay 720p/ | 2020-10-01 20:11 | - | |
| Ear Buds The Podcasting Documentary (2016) 1080p/ | 2020-10-01 19:48 | - | |
| Earthquake (2016) 720p BluRay/ | 2021-08-09 10:47 | - | |
| Eddie The Eagle (2016) 720p/ | 2020-10-01 20:25 | - | |
| Edge of Winter (2016) 1080p/ | 2020-10-01 19:08 | - | |
| Electra Woman and Dyna Girl (2016) 1080p/ | 2018-10-14 10:50 | - | |
| Eliminators (2016) 1080p/ | 2020-10-01 19:52 | - | |
| Elvis Lives! (2016) 1080p/ | 2020-10-25 10:44 | - | |
| Emmas Chance (2016) 720p/ | 2020-10-01 20:32 | - | |
| End Of A Gun (2016) 1080p/ | 2020-10-01 20:31 | - | |
| Essex Vendetta (2016) 1080p/ | 2020-10-01 16:46 | - | |
| Everybody Wants Some (2016) 720p/ | 2020-10-01 19:32 | - | |
| Exposed (2016) 1080p/ | 2020-10-01 18:02 | - | |
| Fade Away (2016) 1080p/ | 2020-10-25 10:49 | - | |
| Fallen (2016) 1080p/ | 2020-10-01 20:06 | - | |
| Falsely Accused (2016) 1080p/ | 2020-10-01 18:05 | - | |
| Fantastic Beasts And Where To Find Them (2016) 1080p/ | 2020-10-01 19:41 | - | |
| Farewell Ferris Wheel (2016) 1080p/ | 2020-10-01 19:55 | - | |
| Fastball (2016) 720p/ | 2020-10-01 19:49 | - | |
| Female Fight Squad (2016) 1080p BluRay/ | 2020-10-01 20:25 | - | |
| Fences (2016) 1080p BluRay/ | 2020-10-01 20:28 | - | |
| Fender Bender (2016) 1080p/ | 2020-10-01 18:04 | - | |
| Fifty Shades Of Black (2016) 1080p/ | 2020-10-01 19:03 | - | |
| Fight Valley (2016) 1080p/ | 2020-10-01 20:14 | - | |
| Final Destination - Full Serise/ | 2020-10-25 10:42 | - | |
| Finding Altamira (2016) 1080p/ | 2020-10-01 19:15 | - | |
| Finding Dory (2016) 720p/ | 2020-10-01 17:59 | - | |
| Finding Mr Right 2 (2016) 720p/ | 2020-10-01 16:50 | - | |
| Finding Sofia (2016) 1080p/ | 2020-10-01 16:51 | - | |
| Fireman Sam Alien Alert The Movie (2016) 720p/ | 2020-10-01 20:15 | - | |
| Flight Crew (2016) 720p BluRay x264 Eng Subs/ | 2020-10-01 20:15 | - | |
| Florence Foster Jenkins (2016) 720p/ | 2020-10-01 16:57 | - | |
| Food Choices (2016) 1080p/ | 2020-10-01 19:09 | - | |
| For The Love Of Spock (2016) 1080p/ | 2020-10-01 17:50 | - | |
| Forsaken (2016) 1080p/ | 2020-10-01 20:23 | - | |
| Frantz (2016) 1080p BluRay/ | 2020-10-01 19:07 | - | |
| Free State Of Jones (2016) 1080p/ | 2020-10-01 20:29 | - | |
| Freshwater (2016) 1080p/ | 2020-10-01 20:23 | - | |
| Friend Request (2016) 1080p/ | 2020-10-01 18:04 | - | |
| From Vegas To Macau III (2016) 1080p/ | 2020-10-01 17:52 | - | |
| Genius (2016) 1080p/ | 2020-10-01 20:04 | - | |
| Gernika (2016) 1080p/ | 2020-10-01 20:26 | - | |
| Get A Job (2016) 720p/ | 2020-10-01 16:53 | - | |
| Ghost Team (2016) 720p/ | 2020-10-01 19:03 | - | |
| Ghostbusters (2016) 1080p/ | 2020-10-01 16:54 | - | |
| Girl in Woods (2016)1080p/ | 2020-10-01 16:43 | - | |
| Girls Guns And G-Strings/ | 2020-10-01 20:03 | - | |
| Girls for Sale (2016) 720p/ | 2020-10-01 18:07 | - | |
| Goat (2016) WEBRip 1080p/ | 2020-10-01 19:53 | - | |
| Gods of Egypt (2016) 1080p/ | 2020-10-01 20:04 | - | |
| Good Kids (2016) 1080p/ | 2020-10-25 10:41 | - | |
| Graduation (2016) 1080p BluRay/ | 2020-10-01 17:58 | - | |
| Grease Live (2016) 720p/ | 2020-10-01 19:54 | - | |
| Greater (2016) 1080p/ | 2020-10-01 19:36 | - | |
| Green Room (2016) 720p/ | 2020-10-01 20:18 | - | |
| Gringo The Dangerous Life Of John McAfee (2016) 1080p/ | 2020-10-01 19:57 | - | |
| Hacker (2016) 1080p/ | 2020-10-01 17:44 | - | |
| Hacksaw Ridge (2016) 1080p/ | 2020-10-01 20:13 | - | |
| Hail Caesar (2016) 1080p/ | 2020-10-01 16:55 | - | |
| Hands Of Stone (2016) 1080p/ | 2020-10-01 17:56 | - | |
| Happy Birthday (2016) 1080p/ | 2020-10-01 16:43 | - | |
| Happy Log (2016) 1080p/ | 2020-10-01 17:40 | - | |
| Hard Target 2 (2016) 1080p/ | 2020-10-01 16:50 | - | |
| Harry Potter Octalogy 720p/ | 2020-10-25 10:41 | - | |
| Headshot (2016) 1080p/ | 2020-10-01 19:07 | - | |
| Hell or High Water (2016) 1080p BluRay/ | 2020-10-01 19:47 | - | |
| Help I Shrunk the Family (2016) 1080p/ | 2020-10-01 19:41 | - | |
| Here Alone (2016) 720p/ | 2020-10-01 20:17 | - | |
| Hidden Figures (2016) 1080p/ | 2020-10-01 19:49 | - | |
| High Strung (2016) 1080p/ | 2020-10-01 19:33 | - | |
| His Secret Past (2016) 1080p/ | 2020-10-01 19:49 | - | |
| Holiday Breakup (2016) 1080p/ | 2020-10-01 19:28 | - | |
| Holidays (2016) 1080p/ | 2020-10-01 20:25 | - | |
| Holy Hell (2016) 1080p/ | 2020-10-01 19:43 | - | |
| Home Invasion (2016) 1080p/ | 2020-10-01 18:01 | - | |
| Honey-3 (2016) 1080p/ | 2019-06-13 15:00 | - | |
| Honey 3 Dare To Dance (2016) 1080p/ | 2020-10-01 19:20 | - | |
| House Of Flying Arrows (2016) 1080p/ | 2020-10-01 16:44 | - | |
| House Of Purgatory (2016) BluRay 1080p/ | 2020-10-01 19:52 | - | |
| Howard Lovecraft & The Frozen Kingdom (2016) 1080p/ | 2020-10-01 19:15 | - | |
| How to Be Single (2016) 720p/ | 2020-10-01 19:00 | - | |
| Hunt for the Wilderpeople (2016) 720p/ | 2020-10-01 20:26 | - | |
| Hush (2016) 1080p/ | 2020-10-01 19:12 | - | |
| I, Daniel Blake (2016) 1080p/ | 2020-10-01 19:48 | - | |
| I.T. (2016) 1080p/ | 2020-10-01 19:14 | - | |
| I Am Bolt (2016) 1080p/ | 2020-10-01 17:55 | - | |
| I Am Not Your Negro (2016) 1080p/ | 2020-10-01 19:13 | - | |
| I Am Not a Serial Killer (2016) 1080p/ | 2020-10-01 19:37 | - | |
| I Am The Pretty Thing That Lives In The House (2016) WEBRip 1080p/ | 2020-10-01 19:49 | - | |
| I Am Wrath (2016) 1080p/ | 2020-10-01 17:45 | - | |
| ICE AGE 1-2-3-4 720p/ | 2020-10-01 16:55 | - | |
| ID2 Shadwell Army (2016) 1080p/ | 2020-10-01 20:25 | - | |
| I Had A Bloody Good Time At House Harker (2016) BluRay 1080p/ | 2020-10-01 20:25 | - | |
| INDIANA JONES Quadrilogy/ | 2020-10-01 16:58 | - | |
| ISRA 88 (2016) 1080p/ | 2020-10-01 19:55 | - | |
| I Saw the Light (2016)/ | 2020-10-01 19:51 | - | |
| I T (2016) 1080p/ | 2020-10-01 16:47 | - | |
| Ignatius Of Loyola (2016) BluRay 1080p/ | 2020-10-01 19:57 | - | |
| Imperium (2016) 1080p/ | 2020-10-01 17:58 | - | |
| In A Valley Of Violence (2016) 1080p/ | 2020-10-01 17:56 | - | |
| In Critical Condition (2016) 1080p/ | 2020-10-01 16:54 | - | |
| In Dubious Battle (2016) BluRay 1080p/ | 2020-10-01 18:00 | - | |
| In Search Of Balance (2016) 1080p/ | 2020-10-01 17:56 | - | |
| In This Corner Of The World (2016) 1080p BluRay/ | 2020-10-01 19:01 | - | |
| Incarnate (2016) 1080p/ | 2020-10-01 20:17 | - | |
| Independence Day Resurgence (2016) 1080p/ | 2020-10-01 20:02 | - | |
| Indignation (2016) 1080p/ | 2020-10-01 20:04 | - | |
| Inferno (2016) 1080p/ | 2020-10-01 16:53 | - | |
| Infinity Chamber (2016) WEBRip 1080p/ | 2020-10-01 19:48 | - | |
| Inside Men The Original (2015) 720p/ | 2020-10-01 18:04 | - | |
| Internet Famous (2016) 720p/ | 2020-10-01 19:56 | - | |
| In the Name of Ben Hur (2016) 1080p BluRay/ | 2020-10-01 19:35 | - | |
| Jack Goes Home (2016) 720p/ | 2020-10-01 16:57 | - | |
| Jack Reacher Never Go Back (2016) 1080p/ | 2020-10-01 20:26 | - | |
| Jackie (2016) 1080p/ | 2020-10-01 19:51 | - | |
| James Bond Collection/ | 2020-10-01 16:57 | - | |
| Jarhead 3 The Siege (2016) 1080p/ | 2020-10-01 16:59 | - | |
| Jason Bourne (2016) 720p/ | 2020-10-01 19:28 | - | |
| Jean-Claude Van Johnson (2016) 720p/ | 2020-10-01 17:57 | - | |
| Joshy (2016) 1080p/ | 2020-10-25 10:45 | - | |
| KILD TV (2016) BluRay 1080p/ | 2020-10-01 19:37 | - | |
| Kaleidoscope (2016) 1080p/ | 2020-10-01 17:57 | - | |
| Kaleidoscope (2016) BluRay 1080p/ | 2020-10-01 20:00 | - | |
| Kalinka (2016) BluRay 1080p/ | 2020-10-01 19:38 | - | |
| Katie Says Goodbye (2016)/ | 2020-10-01 19:42 | - | |
| Keanu (2016) 1080p/ | 2020-10-01 16:50 | - | |
| Kedi (2016) 1080p/ | 2020-10-01 19:41 | - | |
| Keeping Up with the Joneses (2016) 1080p/ | 2020-10-01 20:19 | - | |
| Kevin Hart What Now (2016) 1080p/ | 2020-10-01 16:50 | - | |
| Kickboxer Vengeance (2016) 720p/ | 2020-10-01 20:15 | - | |
| Kicks (2016) 720p/ | 2020-10-01 20:22 | - | |
| Kids In Love (2016) BluRay 1080p/ | 2020-10-01 16:55 | - | |
| Kill Command (2016) 1080p/ | 2020-10-01 17:58 | - | |
| Kill Kane 2016 720p/ | 2020-10-01 17:59 | - | |
| Killing Ground (2016) 1080p/ | 2020-10-01 19:04 | - | |
| Killing Salazar (2016) 1080p Blu-ray/ | 2020-10-01 16:47 | - | |
| Kindergarten Cop 2 (2016) 1080p/ | 2020-10-01 17:44 | - | |
| King Cobra (2016) 1080p/ | 2020-10-01 19:04 | - | |
| Kingsglaive Final Fantasy XV (2016) 1080p BluRay/ | 2020-10-01 20:23 | - | |
| Knucklebones (2016) 1080p/ | 2020-10-01 19:57 | - | |
| Krampus The Devil Returns (2016) 1080p/ | 2020-10-01 19:19 | - | |
| Kubo And The Two Strings (2016) 1080p/ | 2020-10-25 10:50 | - | |
| Kung Fu Panda 3 (2016) 1080p/ | 2017-06-13 11:01 | - | |
| LBJ (2016) 1080p/ | 2020-10-01 19:00 | - | |
| La La Land (2016) 1080p/ | 2017-04-21 10:31 | - | |
| Lady Macbeth (2016) 1080p/ | 2020-10-01 17:00 | - | |
| Laid In America (2016) 1080p/ | 2020-10-01 20:15 | - | |
| Lake Eerie (2016) 720p/ | 2020-10-01 19:49 | - | |
| Lavender (2016) 1080p/ | 2020-10-01 16:56 | - | |
| Leap! (2016) 1080p/ | 2020-10-01 19:41 | - | |
| Lego Friends Girlz 4 Life (2016) 1080p BluRay/ | 2020-10-01 19:09 | - | |
| Let's Be Evil (2016) 1080p/ | 2020-10-01 19:18 | - | |
| Level Up (2016) 720p/ | 2020-10-01 16:54 | - | |
| Life, Animated (2016) BluRay 1080p/ | 2020-10-25 10:42 | - | |
| Lights Out (2016) 1080p BluRay/ | 2021-11-06 04:34 | - | |
| Lion (2016) 1080p/ | 2020-10-01 19:25 | - | |
| Little Dead Rotting Hood (2016) 1080p/ | 2020-10-25 10:46 | - | |
| Little Men (2016) BluRay 1080p/ | 2020-10-01 19:56 | - | |
| Little Savages (2016)/ | 2020-10-25 10:40 | - | |
| Little Sister (2016) 1080p/ | 2020-10-01 19:57 | - | |
| Live By Night (2016) 1080p/ | 2020-10-01 20:18 | - | |
| Lo And Behold Reveries Of The Connected World (2016) 1080p/ | 2020-10-01 19:52 | - | |
| London Has Fallen (2016) 720p/ | 2024-07-30 09:50 | - | |
| Long Forgotten Fields (2016) 1080p/ | 2020-10-01 19:18 | - | |
| Looking The Movie (2016) 720p/ | 2020-10-01 20:18 | - | |
| Lord of the Ring - Trilogy/ | 2020-10-01 19:53 | - | |
| Lost Solace (2016) 1080p/ | 2020-10-01 17:44 | - | |
| Love & Friendship (2016) 1080p/ | 2020-10-01 20:25 | - | |
| Love Finds You In Valentine (2016) 1080p/ | 2020-10-01 16:45 | - | |
| Loving (2016) BluRay 1080p/ | 2020-10-01 20:04 | - | |
| Lowriders (2016) 1080p/ | 2020-10-01 19:06 | - | |
| Magicians Life in the Impossible (2016) 720p/ | 2020-10-01 19:28 | - | |
| Maigret's Dead Man (2016) 1080p/ | 2020-10-01 19:46 | - | |
| Manchester By The Sea (2016) 1080p/ | 2024-07-26 20:44 | - | |
| Marauders (2016) 720p/ | 2020-10-01 19:03 | - | |
| Masterminds (2016) 1080p/ | 2020-10-01 17:46 | - | |
| Max Steel (2016) 1080p/ | 2020-10-01 19:36 | - | |
| Maximum Ride (2016) 720p WEB-DL/ | 2020-10-01 19:57 | - | |
| Me Before You (2016) 1080p/ | 2020-10-01 16:57 | - | |
| Mechanic Resurrection (2016) 1080p/ | 2020-10-01 17:42 | - | |
| Meester Kikker (2016) 1080p BluRay/ | 2020-10-01 19:23 | - | |
| Meet the Blacks (2016) 720p/ | 2020-10-01 17:58 | - | |
| Mercy (2016) 1080p/ | 2018-04-28 09:13 | - | |
| Message From The King (2016) 720p/ | 2020-10-01 19:56 | - | |
| Message From The King (2016) BluRay 1080p/ | 2020-10-01 19:54 | - | |
| Middle School The Worst Years Of My Life (2016) 1080p/ | 2020-10-01 19:30 | - | |
| Midnight Special (2016) 720p/ | 2020-10-01 20:11 | - | |
| Mike and Dave Need Wedding Dates (2016) 1080p BluRay/ | 2020-10-01 18:07 | - | |
| Mimosas - 2016 - BluRay 1080p/ | 2020-10-01 19:49 | - | |
| Miracles From Heaven (2016) 1080p/ | 2020-10-01 19:05 | - | |
| Misconduct (2016) 1080p BluRay/ | 2020-10-01 16:43 | - | |
| Miss Peregrines Home for Peculiar Children (2016) 1080p BluRay/ | 2020-10-01 19:04 | - | |
| Miss Sloane (2016) 1080p/ | 2020-10-01 19:54 | - | |
| Miss Stevens (2016) 1080p/ | 2020-10-01 16:43 | - | |
| Mission Impossible 1, 2, 3, 4 - Quadrilogy/ | 2020-10-01 20:03 | - | |
| Mobile Suit Gundam Thunderbolt December Sky (2016) 1080p/ | 2020-10-01 20:18 | - | |
| Money Monster (2016) 1080p/ | 2020-10-01 19:50 | - | |
| Monster Trucks (2016) BluRay 1080p/ | 2020-10-01 20:03 | - | |
| Moonlight (2016) 1080p/ | 2020-10-01 19:41 | - | |
| Morgan (2016) 1080p BluRay/ | 2020-10-01 20:30 | - | |
| Morris From America (2016) 720p/ | 2020-10-01 19:34 | - | |
| Mothers Day (2016) 720p/ | 2020-10-01 20:04 | - | |
| Mothers and Daughters (2016) 720p/ | 2020-10-01 20:04 | - | |
| Mr Church (2016) 1080p/ | 2020-10-01 19:47 | - | |
| Mum's List (2016) WEBRip 1080p/ | 2020-10-25 10:41 | - | |
| My Big Fat Greek Wedding 2 (2016) 1080p/ | 2020-10-01 19:28 | - | |
| My Christmas Love (2016) BluRay 1080p/ | 2020-10-01 20:22 | - | |
| My Father Die (2016) WEBRip 1080p/ | 2020-10-01 19:11 | - | |
| My Wife Is a Superstar (2016) 720p/ | 2020-10-01 20:31 | - | |
| Mythica The Godslayer (2016) 1080p/ | 2020-10-01 20:30 | - | |
| Mythica The Iron Crown (2016) 720p/ | 2020-10-01 19:56 | - | |
| Neighbors 2 Sorority Rising (2016) 1080p/ | 2020-10-01 20:13 | - | |
| Nerdland (2016) 1080p BluRay/ | 2020-10-01 19:48 | - | |
| Nerve (2016) 1080p/ | 2020-10-01 19:27 | - | |
| Never Back Down No Surrender (2016) 1080p/ | 2020-10-01 20:01 | - | |
| New Year's Gift (2016) 720p NF WEB-DL/ | 2021-10-06 14:37 | - | |
| Night Of Something Strange (2016) 1080p/ | 2020-10-01 16:42 | - | |
| Nine Lives (2016) 1080p/ | 2020-10-01 17:43 | - | |
| No Beast So Fierce (2016) 1080p/ | 2020-10-01 19:23 | - | |
| No Panic, With A Hint Of Hysteria (2016) 1080p/ | 2020-10-01 17:49 | - | |
| Nocturnal Animals (2016) 1080p/ | 2024-10-20 03:39 | - | |
| Norm Of The North (2016) 1080p/ | 2020-10-01 20:28 | - | |
| Norman (2016) BluRay 1080p/ | 2020-10-01 20:19 | - | |
| Now You See Me 2 (2016) 1080p/ | 2020-10-01 18:06 | - | |
| Oasis Supersonic (2016) 1080p/ | 2020-10-01 20:13 | - | |
| Ocean's Trilogy - 1080p/ | 2017-03-11 10:24 | - | |
| Office Christmas Party (2016) 1080p/ | 2021-02-21 15:41 | - | |
| Officer Downe (2016) 1080p/ | 2020-10-01 19:01 | - | |
| Once Upon A Sesame Street Christmas (2016) [1080p] [WEBRip] [YTS.MX]/ | 2020-10-25 10:44 | - | |
| Operation Avalanche (2016) 1080p/ | 2020-10-01 19:55 | - | |
| Operation Chromite (2016) 1080p/ | 2020-10-01 19:08 | - | |
| Ordinary World (2016) 1080p/ | 2020-10-01 16:52 | - | |
| Other People (2016) 1080p/ | 2020-10-01 19:54 | - | |
| Ouija Origin Of Evil (2016) 1080p/ | 2020-10-01 19:52 | - | |
| Our Kind Of Traitor (2016) 1080p/ | 2020-10-01 17:58 | - | |
| Outlaws And Angels (2016) 1080p/ | 2020-10-01 16:56 | - | |
| Owaranai Hito Miyazaki Hayao (2016) BluRay 1080p/ | 2020-10-01 19:57 | - | |
| Paint It Black (2016) 1080p/ | 2020-10-25 10:41 | - | |
| Pandemic (2016) 1080p/ | 2020-10-01 16:57 | - | |
| Paramedics (2016) 720p BluRay/ | 2020-10-25 10:44 | - | |
| Passengers (2016) 1080p BluRay/ | 2020-10-01 20:21 | - | |
| Paterson (2016) 1080p/ | 2020-10-01 18:02 | - | |
| Patient Seven (2016) BluRay 1080p/ | 2020-10-01 19:26 | - | |
| Patients (2016) BluRay 1080p/ | 2020-10-01 20:26 | - | |
| Patriots Day (2016) 1080p/ | 2020-10-01 20:12 | - | |
| Pattaya (2016) [ESUBS] 720p HDRip/ | 2020-10-01 19:23 | - | |
| Paziente 64 (2018) BluRay 1080p/ | 2021-10-04 07:03 | - | |
| Pee Wees Big Holiday V2 (2016)HDRip/ | 2020-10-25 10:46 | - | |
| Pele Birth of a Legend (2016) HDRip/ | 2020-10-01 19:33 | - | |
| Pet (2016) 1080p/ | 2020-10-01 20:11 | - | |
| Petes Dragon (2016) 720p/ | 2020-10-01 20:26 | - | |
| Playing with Dolls Bloodlust 2016 720p/ | 2020-10-01 16:44 | - | |
| Polina (2016) 1080p BluRay/ | 2020-10-01 16:54 | - | |
| Popstar Never Stop Never Stopping (2016) HDRip/ | 2020-10-01 19:54 | - | |
| Porto (2016) BluRay 1080p/ | 2020-10-01 16:47 | - | |
| Poveri Ma Ricchi (2016) BluRay 1080p/ | 2020-10-01 20:30 | - | |
| Precious Cargo (2016)720p/ | 2020-10-25 10:45 | - | |
| Prey, In Cold Blood (2016) 1080p/ | 2020-10-01 20:22 | - | |
| Pride And Prejudice And Zombies (2016) 720p/ | 2020-10-01 19:48 | - | |
| Punching Henry (2016) 1080p/ | 2020-10-01 19:30 | - | |
| Pup 2 No Good (2016)HDRip/ | 2020-10-01 20:15 | - | |
| Quackerz (2016) BluRay 720p/ | 2020-10-01 19:35 | - | |
| Quarries (2016) BluRay 1080p/ | 2020-10-01 20:25 | - | |
| Race (2016) 720p/ | 2020-10-01 20:31 | - | |
| Rainbow Time (2016) 1080p/ | 2020-10-01 17:54 | - | |
| Rampage President Down (2016) BRRip/ | 2020-10-01 17:50 | - | |
| Range 15 (2016) HDRip/ | 2020-10-01 19:53 | - | |
| Ratchet & Clank (2016) 1080p/ | 2020-10-01 20:01 | - | |
| Raw (2016) 1080p BluRay/ | 2020-10-01 17:52 | - | |
| Re Born (2016) 720p/ | 2020-10-01 20:14 | - | |
| Rebirth (2016) HDRip/ | 2020-10-01 17:55 | - | |
| Reclusion (2016) 720p/ | 2020-10-01 19:29 | - | |
| Red Billabong (2016) 1080p/ | 2020-10-01 16:50 | - | |
| Red Dog True Blue (2016) 1080p/ | 2020-10-01 16:48 | - | |
| Reign Over Me/ | 2020-10-01 17:49 | - | |
| Reparation (2016) HDRip/ | 2020-10-01 20:32 | - | |
| Resident Evil The Final Chapter (2016) 1080p/ | 2021-12-27 04:14 | - | |
| Ride Along 2 (2016) 720p/ | 2020-10-01 17:43 | - | |
| Risen (2016) 1080p/ | 2020-10-01 19:32 | - | |
| River (2016) HDRip/ | 2020-10-01 19:09 | - | |
| Riverhead (2016) 1080p/ | 2020-10-01 19:07 | - | |
| Robinson.Crusoe.2016.BRRip.XviD.AC3-EVO/ | 2020-10-01 20:04 | - | |
| Roboshark (2016)HDRip/ | 2020-10-01 20:20 | - | |
| Robot World (2016) HDRip/ | 2020-10-01 16:48 | - | |
| Rocco (2016) WEBRip 1080p/ | 2020-10-01 19:46 | - | |
| Rocky Collection_(1976-2006) - 720p/ | 2020-10-25 10:44 | - | |
| Rogue One A Star Wars Story (2016) 720p Bluray/ | 2021-12-02 12:26 | - | |
| Rough Cut (2016)HDRip/ | 2020-10-01 20:16 | - | |
| Rupture (2016)/ | 2020-10-01 20:14 | - | |
| Sacrament (2016) HDRip/ | 2020-10-01 19:49 | - | |
| Sacrifice (2016) 1080p/ | 2020-10-01 19:00 | - | |
| Sad Vacation (2016) 1080p/ | 2020-10-01 19:57 | - | |
| Sam (2016) HDRip/ | 2020-10-01 16:49 | - | |
| Sam Was Here (2016) BRRip/ | 2020-10-01 19:12 | - | |
| Saved By Grace (2016) DVDRip/ | 2020-10-01 19:53 | - | |
| Saw-The Complete Collection - 1080p/ | 2017-03-11 10:24 | - | |
| Scare.Campaign.2016.HDRip.XviD.AC3-EVO/ | 2020-10-01 19:47 | - | |
| Scarred (2016) WEBRip 1080p/ | 2020-10-01 19:56 | - | |
| Scooby Doo! And WWE Curse Of The Speed Demon (2016) 1080p/ | 2020-10-01 17:51 | - | |
| Search Engines (2016) HDRip/ | 2020-10-01 20:26 | - | |
| Seattle Road (2016) HDRip/ | 2020-10-01 16:55 | - | |
| Sharkansas Womens Prison Massacre (2016)BRRip/ | 2020-10-01 20:15 | - | |
| Sharkenstein (2016) 1080p/ | 2020-10-01 16:56 | - | |
| Sharknado.4.The.4th.Awakens.2016.HDRip.XviD-ETRG/ | 2020-10-01 20:20 | - | |
| Shelley (2016) BluRay 1080p/ | 2020-10-01 19:54 | - | |
| Shepherds And Butchers (2016) WEBRip 1080p/ | 2020-10-01 18:06 | - | |
| Sherlock The Abominable Bride 2016 (1080p) BluRay/ | 2020-10-01 16:58 | - | |
| Shin Godzilla (2016) 1080p/ | 2020-10-01 16:58 | - | |
| Shortwave (2016) BluRay 1080p/ | 2020-10-01 16:47 | - | |
| Showdown In Manila (2016) 1080p BluRay/ | 2020-10-01 16:52 | - | |
| Shut In (2016) 1080p/ | 2020-10-01 19:53 | - | |
| Silence (2016) 1080p/ | 2020-10-01 19:20 | - | |
| Sinbad and the War of the Furies (2016) 1080p BluRay/ | 2020-10-01 19:41 | - | |
| Sing (2016) 1080p/ | 2020-10-01 16:48 | - | |
| Sing Street (2016) 720p/ | 2020-10-01 16:46 | - | |
| Sinister Squad (2016) 720p/ | 2020-10-01 16:49 | - | |
| Siren Song (2016) 1080p BluRay/ | 2020-10-01 19:27 | - | |
| Six Gun Savior (2016) HDRip/ | 2020-10-01 19:35 | - | |
| Skiptrace (2016) 1080p/ | 2020-10-01 18:08 | - | |
| Sky Ladder The.Art Of Cai Guo-Qiangs (2016) SWESUB 720p WEBRip/ | 2020-10-01 20:12 | - | |
| Slash (2016) HDRip/ | 2020-10-01 19:22 | - | |
| Sniper Deadliest Missions/ | 2020-10-01 19:39 | - | |
| Sniper Ghost Shooter (2016) 1080p/ | 2020-10-01 17:53 | - | |
| Sniper Special Ops (2016) 720p/ | 2020-10-01 19:21 | - | |
| Snow White Happily Ever After (2016) HDRip/ | 2020-10-01 19:12 | - | |
| Snowden (2016) 720p/ | 2020-10-01 20:00 | - | |
| Sohra Bridge (2016) HDRip/ | 2020-10-01 17:50 | - | |
| Sole Proprietor (2016) HDRip/ | 2020-10-01 19:49 | - | |
| Something in the Woods (2016) HDRip/ | 2020-10-01 16:55 | - | |
| Somnus (2016) HDRip/ | 2020-10-01 20:29 | - | |
| Sons Of Ben (2016) 1080p/ | 2020-10-01 19:53 | - | |
| Southside With You (2016) 1080p/ | 2020-10-01 19:35 | - | |
| Space Cop (2016) BRRip/ | 2020-10-01 19:43 | - | |
| Spaghettiman (2016) BluRay 1080p/ | 2020-10-25 10:45 | - | |
| Special Correspondents (2016) 720p WEBRip/ | 2020-10-01 16:58 | - | |
| Spectral (2016) 1080p/ | 2020-10-01 16:44 | - | |
| Spirit Of The Game (2016) 1080p/ | 2020-10-01 19:48 | - | |
| Split (2016) 1080p/ | 2020-10-01 19:48 | - | |
| Split (2016) 1080p BluRay 10bit/ | 2021-01-25 04:56 | - | |
| Sr Pig (2016) 1080p/ | 2020-10-01 18:06 | - | |
| Standoff (2016) 1080p/ | 2020-10-01 19:03 | - | |
| Standoff 2016 BRRip/ | 2020-10-01 19:57 | - | |
| Star.Wars.Anthology.720p.BRRip.x264-x0r/ | 2016-04-04 17:17 | - | |
| Star Trek Beyond (2016) [1080p]/ | 2020-10-01 17:41 | - | |
| Star Wars - The Complete Saga - 1080p/ | 2019-06-13 15:00 | - | |
| Stargate Trilogy - Stargate, The Ark of Truth, Continuum Sci-Fi Eng [H264-mp4]/ | 2020-10-01 16:55 | - | |
| Stealing Cars 2016 DVDRip/ | 2020-10-01 20:15 | - | |
| Steve Jobs 2015 1080p/ | 2020-10-01 20:25 | - | |
| Stoner Express (2016) 1080p/ | 2020-10-01 20:14 | - | |
| Storks (2016) 1080p/ | 2020-10-01 19:52 | - | |
| Strawberry Shortcake Sweet Sunshine Adventures (2016) HDRip/ | 2020-10-01 20:07 | - | |
| Stray Bullets (2016) 720p/ | 2020-10-01 16:56 | - | |
| Stressed to Kill (2016) HDRip/ | 2020-10-01 16:50 | - | |
| Sugar Mountain (2016) BluRay 1080p/ | 2020-10-01 16:58 | - | |
| Suicide Squad (2016) 1080p BluRay/ | 2021-02-17 20:31 | - | |
| Summer of 8 (2016) HDRip/ | 2020-10-01 16:59 | - | |
| Sundown (2016) 1080p/ | 2020-10-01 20:30 | - | |
| Survival Family (2016) BluRay 1080p/ | 2020-10-01 16:49 | - | |
| Sweet Dreams (2016) BluRay 1080p/ | 2020-10-01 19:09 | - | |
| Swiss Army Man (2016) 1080p/ | 2021-06-06 14:18 | - | |
| Take Down (2016) 720p/ | 2020-10-01 20:01 | - | |
| Take Me to the River (2016) HDRip/ | 2020-10-01 20:23 | - | |
| Tank 432 (2016) HDRip/ | 2020-10-01 16:56 | - | |
| Te Ata (2016) BluRay 1080p/ | 2020-10-01 20:08 | - | |
| Teenage Cocktail (2016) 1080p/ | 2020-10-01 19:54 | - | |
| Teenage Mutant Ninja Turtles Out of the Shadows (2016) 1080p/ | 2020-10-25 10:42 | - | |
| Tell Me How I Die 2016 HDRip/ | 2020-10-01 18:00 | - | |
| Temps (2016)HDRip/ | 2020-10-01 16:53 | - | |
| Term Life (2016) 1080p/ | 2020-10-01 16:46 | - | |
| Terrifier (2016) 1080p/ | 2020-10-01 17:54 | - | |
| Terrordactyl (2016) HDRip/ | 2020-10-01 20:00 | - | |
| Texas Heart (2016) 1080p/ | 2020-10-01 18:04 | - | |
| Texas Rein (2016) BRRip/ | 2020-10-01 17:46 | - | |
| The.Adventures.Of.Panda.Warrior.2016.DVDRip.XviD-EVO/ | 2020-10-01 20:13 | - | |
| The.Bet.2016.HDRip.XviD.AC3-EVO/ | 2020-10-01 16:56 | - | |
| The.Boy.2016.TS.HQ.XviD-PARS/ | 2020-10-01 16:45 | - | |
| The.Childhood.of.a.Leader.2016.HDRip.XviD.AC3-EVO/ | 2020-10-01 19:20 | - | |
| The.Dead.Room.2016.HDRip.XviD.AC3-EVO/ | 2020-10-01 17:44 | - | |
| The.Harvesting.2016.HDRip.XviD.AC3-EVO/ | 2020-10-01 19:57 | - | |
| The.Huntsman.Winters.War.2016.EXTENDED.BRRip.XviD.AC3-EVO/ | 2020-10-01 19:17 | - | |
| The.Nice.Guys.2016.HDRip.XViD-ETRG/ | 2020-10-01 19:56 | - | |
| The 5th Wave (2016) 1080p/ | 2020-10-01 17:57 | - | |
| The 9th Life Of Louis Drax (2016) 1080p/ | 2020-10-01 18:07 | - | |
| The Accountant (2016) 1080p/ | 2020-10-01 17:49 | - | |
| The Adventures of Panda Warrior (2016) HDRip/ | 2020-10-01 16:43 | - | |
| The Age Of Shadows (2016) 1080p/ | 2020-10-01 19:57 | - | |
| The Alchemist Cookbook (2016) 1080p/ | 2020-10-01 16:55 | - | |
| The American Side (2016) 720p/ | 2020-10-01 20:18 | - | |
| The Amityville Terror (2016) 1080p/ | 2020-10-01 16:53 | - | |
| The Asian Connection (2016) BluRay 1080p/ | 2020-10-01 19:11 | - | |
| The Automatic Hate (2016) HDRip/ | 2020-10-01 16:45 | - | |
| The Autopsy Of Jane Doe (2016) 1080p/ | 2020-10-01 20:03 | - | |
| The Awnser (2016) HDRip/ | 2020-10-01 18:03 | - | |
| The BFG (2016) 720p/ | 2020-10-01 20:03 | - | |
| The Bad Batch (2016) 1080p BluRay/ | 2020-10-01 19:53 | - | |
| The Bad Kids (2016) BluRay 1080p/ | 2020-10-25 10:48 | - | |
| The Belko Experiment (2016) 1080p/ | 2020-10-25 10:41 | - | |
| The Biggest Game in Town (2016) 1080p/ | 2020-10-01 20:04 | - | |
| The Birth of a Nation (2016) HDRip/ | 2020-10-01 19:20 | - | |
| The Blueberry Hunt (2016) 720p/ | 2020-10-01 19:59 | - | |
| The Boss (2016) 1080p/ | 2020-10-01 20:20 | - | |
| The Bourne Series 1, 2, 3, 4 - 720p/ | 2020-10-01 19:57 | - | |
| The Boy (2016) 720p/ | 2020-10-01 19:57 | - | |
| The Bronx Bull (2016) HDRip/ | 2020-10-01 20:22 | - | |
| The Brothers Grimsby (2016) 1080p/ | 2020-10-01 19:15 | - | |
| The Call Up (2016) BluRay 1080p/ | 2020-10-01 16:42 | - | |
| The Caretaker (2016) 720p WEB-DL/ | 2020-10-01 19:11 | - | |
| The Caretaker (2016) HDRip/ | 2020-10-01 20:32 | - | |
| The Carrier 2016 HDRip/ | 2020-10-01 19:48 | - | |
| The Chamber (2016) 1080p/ | 2020-10-01 20:04 | - | |
| The Choice (2016) 1080p/ | 2020-10-01 20:12 | - | |
| The Christmas Project (2016) WEBRip 1080p/ | 2020-10-25 10:45 | - | |
| The Cleanse (2016) WEBRip 1080p/ | 2020-10-01 19:48 | - | |
| The Coming War On China (2016) 1080p/ | 2020-10-01 19:09 | - | |
| The Conduit (2016)HDRip/ | 2020-10-01 17:53 | - | |
| The Confirmation (2016) 1080p BluRay/ | 2020-10-01 16:58 | - | |
| The Conjuring 2 (2016) [1080p]/ | 2020-10-01 19:55 | - | |
| The Correspondence (2016) BDRip/ | 2020-10-01 19:13 | - | |
| The Curse Of Sleeping Beauty (2016) 1080p/ | 2020-10-01 16:54 | - | |
| The Dark Stranger (2016) HDRip/ | 2020-10-01 19:36 | - | |
| The Darkness (2016) 1080p Blu-ray/ | 2016-09-03 05:27 | - | |
| The Devil's Dolls (2016) 1080p/ | 2020-10-01 20:14 | - | |
| The Devil Complex (2016) 1080p/ | 2020-10-01 19:48 | - | |
| The Disappointments Room (2016) 1080p/ | 2020-10-01 20:30 | - | |
| The Do Over (2016) 1080p/ | 2020-10-01 16:43 | - | |
| The Dog Lover (2016) BluRay 1080p/ | 2020-10-01 17:40 | - | |
| The Dooms Chapel Horror (2016) HDRip/ | 2020-10-01 19:53 | - | |
| The Drowning (2016) 1080p/ | 2020-10-01 20:26 | - | |
| The Duel (2016) 1080p/ | 2020-10-01 20:00 | - | |
| The Edge of Seventeen (2016) 1080p BluRay/ | 2020-10-01 16:55 | - | |
| The Emeryville Experiments (2016) HDRip/ | 2020-10-01 19:41 | - | |
| The End (2016)WEBRiP/ | 2020-10-01 19:23 | - | |
| The Evi Gene (2016) HDRip/ | 2020-10-01 20:25 | - | |
| The Evil Dead Trilogy/ | 2020-10-01 16:49 | - | |
| The Evil in Us (2016) 720p/ | 2020-10-01 16:59 | - | |
| The Exception (2016) 1080p/ | 2020-10-01 19:43 | - | |
| The Exorcism Of Anna Ecklund (2016) 1080p WEBRip/ | 2020-10-01 20:20 | - | |
| The Eyes Of My Mother (2016) 1080p/ | 2020-10-01 19:39 | - | |
| The Faith of Anna Waters (2016) 720p/ | 2020-10-01 19:37 | - | |
| The Fall Of The Krays (2016) 1080p/ | 2020-10-01 16:58 | - | |
| The Fearless Vampire Killers - Roman Polanski Horror/ | 2020-10-01 19:13 | - | |
| The Fiancé (2016) HDRip/ | 2020-10-01 19:52 | - | |
| The Finest Hours (2016) 1080p/ | 2020-10-01 16:52 | - | |
| The Fockers Trilogy/ | 2020-10-01 16:52 | - | |
| The Forest (2016) 1080p/ | 2020-10-01 16:58 | - | |
| The Founder (2016) 1080p/ | 2020-10-01 17:53 | - | |
| The Fourth Phase (2016) 1080p/ | 2020-10-01 20:26 | - | |
| The Frontier (2016) HDRip/ | 2020-10-01 20:10 | - | |
| The Fundamentals Of Caring (2016) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| The Ghost and the Whale (2016) HDRip/ | 2020-10-01 19:08 | - | |
| The Girl On The Train (2016) 1080p/ | 2020-10-01 19:17 | - | |
| The Girl Without Hands (2016) 1080p BluRay/ | 2020-10-01 20:03 | - | |
| The Girl with All the Gifts (2016) 720p/ | 2020-10-01 19:59 | - | |
| The Godfather Trilogy [ I. II. III ]-1080p/ | 2023-11-19 08:31 | - | |
| The Good Neighbor (2016) 1080p/ | 2020-10-01 16:47 | - | |
| The Greasy Strangler (2016) BluRay 1080p/ | 2020-10-01 16:51 | - | |
| The Great Gilly Hopkins (2016) 1080p/ | 2020-10-01 19:56 | - | |
| The Great Wall (2016) 1080p/ | 2020-10-01 20:26 | - | |
| The Guardian Brothers (2016) 720p/ | 2022-01-09 13:07 | - | |
| The Happiest Day In The Life Of Olli Mäki (2016) 1080p BluRay/ | 2020-10-01 16:49 | - | |
| The Hatching (2016) 1080p/ | 2020-10-01 17:56 | - | |
| The Haunted House On Kirby Road (2016) 1080p/ | 2020-10-01 20:26 | - | |
| The Haunting of Woodland Hills (2016) HDRip/ | 2020-10-01 19:27 | - | |
| The Hexecutioners (2016) HDRip/ | 2020-10-01 18:05 | - | |
| The High Frontier (2016) 1080p BluRay/ | 2020-10-01 16:42 | - | |
| The Hollars (2016) 1080p/ | 2020-10-01 19:29 | - | |
| The Hollow Point (2016) 1080p/ | 2020-10-01 20:16 | - | |
| The Horde (2016) 1080p/ | 2020-10-01 20:04 | - | |
| The Housemaid (2016) 720p/ | 2020-10-01 19:01 | - | |
| The Hunger Games Mockingjay - Part 1/ | 2020-10-01 19:23 | - | |
| The Huntsman Winters War (2016) 1080p/ | 2020-10-01 19:52 | - | |
| The Infiltrator (2016) 1080p/ | 2020-10-01 19:02 | - | |
| The Intent (2016) WEBRip 1080p/ | 2020-10-01 19:39 | - | |
| The Intervention (2016) 1080p/ | 2020-10-01 19:04 | - | |
| The Invisible Guest (2016) 720p/ | 2020-10-01 20:31 | - | |
| The Jungle Book (2016) 1080p/ | 2020-11-18 08:51 | - | |
| The Killer Robots Crash and Burn (2016) HDRip/ | 2020-10-01 20:21 | - | |
| The King's Choice (2016) 1080p BluRay/ | 2020-12-10 14:10 | - | |
| The Land (2016) HDRip/ | 2020-10-25 10:43 | - | |
| The Land Before Time XIV Journey Of The Brave (2016) 1080p/ | 2020-10-01 19:01 | - | |
| The Last Descent (2016) 1080p/ | 2020-10-01 20:24 | - | |
| The Last Film Festival (2016) HDRip/ | 2020-10-01 19:57 | - | |
| The Last Heist (2016) 720p WEBRip/ | 2020-10-01 19:40 | - | |
| The Last King (2016) BluRay 1080p/ | 2020-10-01 17:46 | - | |
| The Late Bloomer (2016) 1080p/ | 2020-10-01 19:32 | - | |
| The Legend Of Tarzan (2016) 1080p/ | 2020-10-01 19:39 | - | |
| The Lennon Report (2016) HDRip/ | 2020-10-25 10:48 | - | |
| The Liability (2012)/ | 2020-10-01 19:57 | - | |
| The Light Between Oceans (2016) HDRip/ | 2020-10-01 20:28 | - | |
| The Lighthouse (2016) BluRay 1080p/ | 2020-10-01 16:54 | - | |
| The Limehouse Golem (2016) 1080p/ | 2020-10-01 20:03 | - | |
| The Lion King - Trilogy - 1080p/ | 2017-03-11 10:24 | - | |
| The Lost City of Z (2016) 1080p/ | 2020-10-25 10:48 | - | |
| The Love Witch (2016) 1080p/ | 2020-10-01 19:59 | - | |
| The Magnificent Seven (2016) 720p/ | 2020-10-01 16:45 | - | |
| The Man From Mo'Wax (2016) BluRay 1080p/ | 2020-10-01 16:44 | - | |
| The Marauders (2016) HQ 1080p/ | 2020-10-01 20:30 | - | |
| The Masked Saint (2016)HDRip/ | 2020-10-01 16:54 | - | |
| The Matchbreaker (2016)/ | 2020-10-01 19:01 | - | |
| The Matrix Collection - 720p/ | 2021-10-04 07:29 | - | |
| The Melancholy Fantastic (2016) HDRip/ | 2020-10-01 19:15 | - | |
| The Mermaid (2016) 1080p/ | 2016-06-15 18:13 | - | |
| The Midnight Man (2016) 1080p BluRay/ | 2020-10-01 17:45 | - | |
| The Model (2016) 720p BluRay/ | 2020-10-01 20:28 | - | |
| The Neighbor (2016) 720p/ | 2016-09-19 18:21 | - | |
| The Neighbor (2016) 1080p BluRay/ | 2022-03-04 10:34 | - | |
| The Neon Demon (2016) 1080p/ | 2021-10-04 07:41 | - | |
| The Neon Demon (2016) HDRip/ | 2016-09-01 14:32 | - | |
| The Nice Guys (2016) 1080p/ | 2020-10-01 20:04 | - | |
| The Night (2016) 1080p/ | 2020-10-01 18:01 | - | |
| The Offering (2016) 1080p/ | 2020-10-01 16:49 | - | |
| The Ones Below (2016) BRRip/ | 2016-08-29 06:31 | - | |
| The Osiris Child (2016) 1080p/ | 2020-10-01 19:19 | - | |
| The Other Side Of The Door (2016) 1080p/ | 2020-10-01 20:01 | - | |
| The Other Wife (2016) HDRip/ | 2020-10-01 19:13 | - | |
| The Perfect Match (2016) 720p/ | 2020-10-01 20:25 | - | |
| The Perfect Weapon (2016) 1080p BluRay/ | 2020-10-01 17:52 | - | |
| The Phenom (2016) 1080p/ | 2020-10-01 20:30 | - | |
| The Possession Experiment (2016) HDRip/ | 2020-10-01 16:45 | - | |
| The Promise (2016) 1080p/ | 2020-10-01 20:08 | - | |
| The Purge Election Year (2016) [1080p]/ | 2020-10-01 16:46 | - | |
| The Red Pill (2016) 1080p/ | 2020-10-01 19:57 | - | |
| The Remains (2016) BRRip/ | 2020-10-01 19:54 | - | |
| The Resurrection Of Gavin Stone (2016) BluRay 1080p/ | 2020-10-01 19:03 | - | |
| The River Thief (2016) HDRip/ | 2020-10-01 18:01 | - | |
| The Road Movie (2016) BluRay 1080p/ | 2020-10-01 19:54 | - | |
| The Salesman (2016) 1080p/ | 2020-10-01 19:43 | - | |
| The Secret Life Of Pets (2016) 1080p/ | 2020-10-01 20:25 | - | |
| The Secrets of Emily Blair (2016) HDRip/ | 2020-10-01 19:57 | - | |
| The Shallows (2016) 720p/ | 2020-10-01 20:22 | - | |
| The Shelter (2016) HDRip/ | 2020-10-01 19:35 | - | |
| The Siege Of Jadotville (2016) WEBRip 1080p/ | 2020-10-01 16:49 | - | |
| The Stakelander (2016) BluRay 1080p/ | 2020-10-01 19:28 | - | |
| The Standoff (2016) HDRip/ | 2020-10-01 19:29 | - | |
| The Suffering (2016) 1080p/ | 2020-10-01 16:57 | - | |
| The Sultan And The Saint (2016) 1080p/ | 2020-10-01 16:49 | - | |
| The Sun At Midnight (2016) BluRay 1080p/ | 2020-10-01 19:01 | - | |
| The Swan Princess Princess Tomorrow Pirate Today (2016) 1080p/ | 2020-10-01 20:01 | - | |
| The Sweet Life (2016) HDRip/ | 2020-10-01 20:19 | - | |
| The Sweet Life 2016 720p WEBRip 650 MB - iExTV/ | 2020-10-01 19:52 | - | |
| The Table (2016) 1080p/ | 2020-10-01 16:42 | - | |
| The Tell Tale Heart (2016)DVDRip/ | 2020-10-01 20:04 | - | |
| The Terry Kath Experience (2016) 1080p BluRay/ | 2020-10-01 17:47 | - | |
| The Thinning (2016) 720p/ | 2020-10-01 20:14 | - | |
| The Ticket (2016) 1080p/ | 2020-10-01 19:17 | - | |
| The Trust (2016) 1080p/ | 2020-10-01 16:52 | - | |
| The Unwilling (2016) 720p/ | 2020-10-01 19:48 | - | |
| The Veil 2016 720p/ | 2020-10-01 19:55 | - | |
| The Wailing (2016) 1080p BluRay/ | 2020-10-01 20:11 | - | |
| The War Show (2016) SUBBED DVDRip/ | 2020-10-01 16:54 | - | |
| The Whole Truth (2016) 1080p/ | 2020-10-01 19:56 | - | |
| The Wild Life (2016) [1080p] [YTS.AG]/ | 2020-10-01 19:57 | - | |
| The Windmill (2016) 1080p/ | 2020-10-01 19:00 | - | |
| The Witch (2016) HDTS/ | 2020-10-01 19:29 | - | |
| The Wolfman Dual - 1080p/ | 2020-10-01 19:48 | - | |
| The Woman Who Left (2016) 1080p BluRay/ | 2020-10-01 19:53 | - | |
| The Women's Balcony (2016) 1080p BluRay/ | 2020-10-01 19:52 | - | |
| The Young Messiah (2016) 720p/ | 2020-10-01 17:45 | - | |
| They Look Like People (2016) HDRip/ | 2020-10-25 10:44 | - | |
| Thirst (2016) HDRip/ | 2020-10-01 20:20 | - | |
| Time Rush (2016) BRRip/ | 2020-10-01 19:50 | - | |
| To Keep The Light (2016) BluRay 1080p/ | 2020-10-01 20:26 | - | |
| To Live and Die in Amsterdam (2016) HDRip/ | 2020-10-01 20:28 | - | |
| Tom Clancy's The Division Agent Origins 2016 2160p/ | 2020-10-01 20:17 | - | |
| Tom and Jerry Back to Oz (2016) DVDRip/ | 2020-10-01 16:57 | - | |
| Toni Erdmann (2016) BluRay 1080p/ | 2020-10-01 19:11 | - | |
| Toy Story Trilogy - 1080p/ | 2017-03-11 10:24 | - | |
| Traded (2016)/ | 2020-10-01 20:30 | - | |
| Train To Busan (2016) 1080p/ | 2020-10-01 18:03 | - | |
| Transpecos (2016) 1080p/ | 2020-10-01 20:11 | - | |
| Trespass Against Us (2016) 1080p/ | 2020-10-01 17:00 | - | |
| Trick or Treaters (2016) HDRip/ | 2020-10-01 16:57 | - | |
| Triple 9 (2016) 720p/ | 2020-10-01 20:25 | - | |
| Trivisa (2016) 720p/ | 2020-10-01 19:33 | - | |
| Trolland (2016) 720p/ | 2020-10-01 18:01 | - | |
| Trolls (2016) 1080p/ | 2020-10-01 17:53 | - | |
| True Memoirs of an International Assassin (2016) 720p/ | 2020-10-01 17:50 | - | |
| Tsukiji Wonderland (2016) 1080p BluRay/ | 2020-10-01 20:23 | - | |
| Tulips in Spring (2016) 720p/ | 2020-10-01 19:11 | - | |
| Two Lovers And A Bear (2016) WEBRip 1080p/ | 2020-10-01 19:03 | - | |
| USS Indianapolis Men Of Courage (2016) 1080p/ | 2020-10-25 10:40 | - | |
| Uncaged 2016 HDRip/ | 2020-10-01 20:26 | - | |
| Under the Shadow 2016 720p/ | 2020-10-01 16:43 | - | |
| Underworld Blood Wars (2016) HDCAM/ | 2020-10-01 18:07 | - | |
| Unnatural (2016) 1080p/ | 2020-10-01 17:00 | - | |
| Until Forever (2016) 1080p/ | 2020-10-01 19:57 | - | |
| Up For Love (2016) BluRay 1080p/ | 2020-10-01 17:42 | - | |
| Urge (2016) HDRip/ | 2020-10-01 16:53 | - | |
| Vigilante Diaries 2016 1080p/ | 2020-10-01 16:50 | - | |
| Viking Legacy (2016) 1080p/ | 2020-10-01 16:46 | - | |
| Vineland (2016) 1080p/ | 2020-10-01 19:48 | - | |
| Viral (2016)/ | 2020-10-01 16:44 | - | |
| Viral (2016) 1080p/ | 2020-10-01 19:53 | - | |
| War Dogs (2016) 1080p/ | 2020-10-01 20:08 | - | |
| War On Everyone (2016) 1080p/ | 2020-10-01 17:00 | - | |
| Warcraft (2016) 1080p BluRay/ | 2020-10-01 20:17 | - | |
| We've Forgotten More Than We Ever Knew (2016) 1080p/ | 2020-10-01 20:30 | - | |
| We Are The Flesh (2016) BluRay 1080p/ | 2020-10-01 18:59 | - | |
| We Still Steal the Old Way (2016) DvDRip/ | 2020-10-01 19:11 | - | |
| Weaponized (2016)/ | 2020-10-01 20:18 | - | |
| Weepah Way for Now (2016)/ | 2020-10-01 20:23 | - | |
| Welcome To Willits (2016) 1080p/ | 2020-10-25 10:44 | - | |
| What's The Matter With Gerald (2016) 1080p/ | 2020-10-01 16:58 | - | |
| When The Bough Breaks (2016) 1080p/ | 2020-10-01 19:56 | - | |
| Where Love Found Me - 2016 - WEBRip 1080p/ | 2020-10-01 16:53 | - | |
| Whiskey Tango Foxtrot (2016) 1080p BluRay/ | 2020-10-01 20:22 | - | |
| Who Gets The Dog (2016) BluRay 1080p/ | 2020-10-01 19:51 | - | |
| Why Him (2016) 1080p/ | 2020-10-01 19:17 | - | |
| Wiener-Dog (2016) 720p/ | 2020-10-01 19:30 | - | |
| Witchcraft 16 Hollywood Coven (2016) WEBRip/ | 2020-10-01 17:40 | - | |
| Wolf Mother (2016) 1080p BluRay/ | 2020-10-01 17:39 | - | |
| Wolves (2016) WEBRip 1080p/ | 2020-10-25 10:41 | - | |
| Worry Dolls (2016)/ | 2020-10-01 19:23 | - | |
| Woven (2016) 1080p/ | 2020-10-01 16:56 | - | |
| X-Men Apocalypse (2016) 1080p BluRay/ | 2020-10-01 20:31 | - | |
| XOXO (2016) 1080p/ | 2020-10-25 10:49 | - | |
| Yakuza Apocalypse (2015) 1080p/ | 2018-10-14 10:50 | - | |
| Yoga Hosers (2016) BluRay 1080p/ | 2020-10-01 20:17 | - | |
| You May Now Kill The Bride (2016) HDTV/ | 2020-10-01 19:58 | - | |
| Zero Days (2016) 1080p/ | 2020-10-01 19:53 | - | |
| Zoolander 2 (2016) 1080p/ | 2020-10-01 16:43 | - | |
| Zootopia (2016) 720p/ | 2020-10-01 19:59 | - | |
| interrogation (2016) 720p/ | 2020-10-01 16:48 | - | |
|
|---|