![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 1 1 (2018) BluRay 1080p/ | 2020-10-01 16:59 | - | |
| 2 Gentlemen Of Verona (2018) WEBRip 1080p/ | 2020-10-01 19:17 | - | |
| 2 Hrs (2018) WEBRip 1080p/ | 2020-10-01 18:52 | - | |
| 4 20 Massacre (2018) 1080p/ | 2020-10-01 17:01 | - | |
| 5th Passenger (2018) 1080p/ | 2020-10-01 17:01 | - | |
| 6-Headed Shark Attack (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| 7 Days In Entebbe (2018) BluRay 1080p/ | 2020-10-01 18:08 | - | |
| 7 Splinters In Time (2018) 1080p/ | 2020-10-01 17:31 | - | |
| 8 Remains (2018) 720p/ | 2020-10-01 18:07 | - | |
| 10x10 (2018) 1080p/ | 2021-09-09 12:24 | - | |
| 12 Strong (2018) BluRay 1080p/ | 2020-10-01 17:31 | - | |
| 14 Cameras (2018) 1080p/ | 2020-10-01 18:14 | - | |
| 22 Chaser (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| 22 July (2018) 1080p/ | 2020-10-01 19:35 | - | |
| 29 To Life (2018) WEBRip 1080p/ | 2020-10-01 18:40 | - | |
| 30 Miles From Nowhere (2018) 1080p/ | 2020-10-01 16:10 | - | |
| 51 Nevada (2018) WEBRip 1080p/ | 2020-10-01 18:40 | - | |
| 100 Things (2018) BluRay 1080p/ | 2020-10-01 18:01 | - | |
| 211 (2018) 1080p/ | 2020-10-01 18:18 | - | |
| 303 (2018) BluRay 1080p/ | 2020-10-01 18:50 | - | |
| 1921 (2018) Desi Pre DvD Rip/ | 2020-10-01 17:53 | - | |
| 1985 (2018) BluRay 1080p/ | 2020-10-01 17:53 | - | |
| 2036 Origin Unknown (2018) BluRay 1080p/ | 2020-10-25 10:26 | - | |
| A-X-L (2018) BluRay 1080p/ | 2020-10-01 17:33 | - | |
| A.I. Rising (2018) 1080p/ | 2020-10-01 18:30 | - | |
| A Boy A Girl A Dream (2018) 1080p/ | 2020-10-01 18:54 | - | |
| A Christmas Carol (2018) WEBRip 1080p/ | 2020-10-01 18:15 | - | |
| A Christmas Prince The Royal Wedding (2018) 1080p/ | 2020-10-01 18:27 | - | |
| A Dark Place (2018) BluRay 1080p/ | 2020-10-01 18:02 | - | |
| A Fistful Of Lead (2018) 720p/ | 2020-10-01 18:52 | - | |
| A Futile And Stupid Gesture (2018) 1080p/ | 2020-10-01 16:10 | - | |
| A Horse From Heaven (2018) WEBRip 1080p/ | 2020-10-01 18:15 | - | |
| A Journey To The Fumigated Towns (2018) 1080p/ | 2020-10-01 16:10 | - | |
| A Leaf Of Faith (2018) 1080p/ | 2020-10-25 10:30 | - | |
| A Lesson In Cruelty (2018) WEBRip 1080p/ | 2020-10-01 18:08 | - | |
| A Lonely Woman (2018) 1080p/ | 2020-10-01 19:27 | - | |
| A Place In Hell (2018) 1080p/ | 2020-10-01 17:33 | - | |
| A Private War (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| A Quiet Place (2018) BluRay 1080p/ | 2020-10-01 19:18 | - | |
| A Rough Draft (2018) BluRay 1080p/ | 2020-10-01 17:06 | - | |
| A Simple Favor (2018) BluRay 1080p/ | 2020-10-01 18:04 | - | |
| A Sister's Secret (2018) WEBRip 1080p/ | 2020-10-01 18:22 | - | |
| A Song For The Living (2018) 1080p/ | 2020-10-01 18:14 | - | |
| A Star Is Born (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| A Twelve-Year Night (2018) 720p/ | 2020-10-01 17:29 | - | |
| A Vigilante (2018) BluRay 1080p/ | 2020-10-01 17:56 | - | |
| A Wizard's Tale (2018) BluRay 1080p/ | 2020-10-01 18:41 | - | |
| A Wrinkle In Time (2018) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| A Young Man With High Potential (2018) WEBRip 1080p/ | 2020-10-01 18:23 | - | |
| Abnormal Attraction (2018) 1080p/ | 2020-10-01 19:28 | - | |
| Accident Man (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Acrimony (2018) 1080p/ | 2020-10-01 19:33 | - | |
| Active Measures (2018) 720p/ | 2020-10-01 19:02 | - | |
| Acts Of Violence (2018) BluRay 1080p/ | 2020-10-01 17:15 | - | |
| Adam Patel Real Magic (2018) 1080p/ | 2020-10-01 17:57 | - | |
| Adam Sandler 100% Fresh (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Adrift (2018) 1080p/ | 2020-10-01 17:22 | - | |
| After Darkness (2018) 720p/ | 2020-10-01 19:16 | - | |
| After Everything (2018) 720p/ | 2020-10-01 19:05 | - | |
| After Porn Ends 3 (2018) WEBRip 1080p/ | 2020-10-01 19:20 | - | |
| Agatha And The Truth Of Murder (2018) BluRay 1080p/ | 2020-10-25 10:34 | - | |
| Age Of Summer (2018) WEBRip 1080p/ | 2020-10-01 19:11 | - | |
| Age Out (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Agenda Payback (2018) 1080p/ | 2020-10-01 18:21 | - | |
| Air Strike (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Alex & Me (2018) 1080p/ | 2020-10-01 17:08 | - | |
| Alex & The List (2018) 1080p/ | 2020-10-01 17:34 | - | |
| Alex Strangelove (2018) 1080p/ | 2020-10-01 17:23 | - | |
| Ali Wong Hard Knock Wife (2018) 1080p/ | 2020-10-01 17:28 | - | |
| Alien Expedition (2018) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| Alien Invasion (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Alien Overlords (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Alien Predator (2018) BluRay 1080p/ | 2020-10-01 19:28 | - | |
| Aliens Ate My Homework (2018) BluRay 1080p/ | 2020-10-01 16:56 | - | |
| All About Nina (2018) WEBRip 1080p/ | 2020-10-01 18:10 | - | |
| All Creatures Here Below (2018) WEBRip 1080p/ | 2020-10-01 18:10 | - | |
| All Is True (2018) WEBRip 1080p/ | 2020-10-01 17:21 | - | |
| All Light Will End (2018) 1080p/ | 2020-10-01 18:23 | - | |
| All Square (2018) 1080p WEBRip/ | 2020-10-01 18:10 | - | |
| All Styles (2018) 1080p/ | 2020-10-01 17:00 | - | |
| All The Creatures Were Stirring (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| All The Devil's Men (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Alone.We.Fight.2018/ | 2019-12-24 18:45 | - | |
| Alone We Fight (2018) BluRay 1080p/ | 2020-10-01 17:03 | - | |
| Along Came The Devil (2018) BluRay 1080p/ | 2020-10-01 18:46 | - | |
| Alpha (2018) 1080p/ | 2020-10-02 22:54 | - | |
| Alpha Wolf (2018) WEBRip 1080p/ | 2020-10-01 17:58 | - | |
| Alright Now (2018) 1080p/ | 2020-10-01 18:38 | - | |
| Altered Skin (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Amanda And The Fox (2018) 1080p WEBRip/ | 2020-10-01 17:58 | - | |
| Amazing China (2018) 720P/ | 2020-10-01 18:52 | - | |
| Amazing Grace (2018) 1080p BluRay/ | 2020-10-01 18:15 | - | |
| American Animals (2018) BluRay 1080p/ | 2020-10-01 17:23 | - | |
| American Chaos (2018) 1080p/ | 2020-10-01 19:02 | - | |
| American Dream American Knightmare (2018) 1080p/ | 2020-10-01 18:32 | - | |
| American Dresser (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| American Exorcist (2018) 1080p/ | 2020-10-01 17:55 | - | |
| American Fright Fest (2018) 1080p/ | 2020-10-01 16:10 | - | |
| American Nightmares (2018) 1080p/ | 2020-10-01 18:09 | - | |
| American Satan (2018) 1080p/ | 2020-10-01 18:38 | - | |
| American Woman (2018) BluRay 1080p/ | 2020-10-01 18:17 | - | |
| An Acceptable Loss (2018) 1080p/ | 2020-10-01 18:00 | - | |
| An Actor Prepares (2018) 1080p/ | 2020-10-01 19:27 | - | |
| An Audience Of Chairs (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| An Evening With Beverly Luff Linn (2018) BluRay 1080p/ | 2020-10-01 18:16 | - | |
| An Interview With God (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Andover (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Andre The Giant (2018) 1080p/ | 2020-10-01 18:05 | - | |
| Angel of Anywhere (2018) 1080p/ | 2020-10-01 18:29 | - | |
| Aniara (2018) BluRay 1080p/ | 2020-10-01 18:28 | - | |
| Anne (2018) 1080p/ | 2020-12-08 03:21 | - | |
| Anne Clark I'll Walk Out Into Tomorrow (2018) BluRay 1080p/ | 2020-10-01 18:37 | - | |
| Annihilation (2018) 1080p/ | 2020-10-01 17:44 | - | |
| Anon (2018) BluRay 1080p/ | 2020-10-01 17:31 | - | |
| Anonymous 616 (2018) 1080p/ | 2020-10-01 17:59 | - | |
| Another Time (2018) 1080p/ | 2020-10-01 17:25 | - | |
| Another WolfCop (2018) HDRip/ | 2020-10-01 18:54 | - | |
| Ant-Man And The Wasp (2018) BluRay 1080p/ | 2026-08-16 15:00 | - | |
| Anthem Of A Teenage Prophet (2018) BluRay 1080p/ | 2020-10-02 22:56 | - | |
| Antrum The Deadliest Film Ever Made (2018) 720p WEBRip/ | 2020-10-01 19:09 | - | |
| Apocalypse Rising (2018) 720p/ | 2020-10-01 17:51 | - | |
| Apostle (2018) 1080p/ | 2020-10-01 18:37 | - | |
| Aquarela (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Arctic (2018) BluRay 1080p/ | 2020-10-01 17:30 | - | |
| Arizona (2018) BluRay 1080p/ | 2020-10-01 19:37 | - | |
| Armed (2018) 1080p/ | 2020-10-01 18:17 | - | |
| Armenian Haunting (2018) WEBRip 1080p/ | 2020-10-01 18:27 | - | |
| Art Of Deception (2018) WEBRip 1080p/ | 2019-10-05 10:35 | - | |
| Asher (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Ashes In The Snow (2018) 1080p/ | 2020-10-01 18:39 | - | |
| Ask For Jane (2018) WEBRip 1080p/ | 2020-10-01 18:42 | - | |
| Assassination Nation (2018) 1080p BluRay/ | 2020-10-01 16:39 | - | |
| Astral (2018) 1080p/ | 2020-10-25 10:29 | - | |
| Astro (2018) 1080p/ | 2020-10-01 18:32 | - | |
| At First Light (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Atlantic Rim 2 (2018) 1080p/ | 2020-10-01 16:10 | - | |
| At the End of the Day (2018) HDRip/ | 2020-10-01 18:01 | - | |
| Attrition (2018) 1080p/ | 2020-10-01 19:30 | - | |
| Aux (2018) 1080p/ | 2020-10-01 19:32 | - | |
| Avengers Infinity War (2018) 1080p/ | 2020-10-01 17:40 | - | |
| Await Further Instructions (2018) BluRay 1080p/ | 2020-10-01 17:11 | - | |
| BLINK (2018) WEBRip 720p/ | 2020-10-01 16:10 | - | |
| Babes with Blades (2018) 1080p/ | 2020-10-01 18:41 | - | |
| Back Roads (2018) 1080p WEB-DL/ | 2020-10-01 16:10 | - | |
| Backtrace (2018) BluRay 1080p/ | 2020-10-01 18:25 | - | |
| Bad Apples (2018) 720p HDRip/ | 2020-10-01 18:59 | - | |
| Bad Samaritan (2018) 720p/ | 2020-10-02 11:52 | - | |
| Bad Times At The El Royale (2018) 1080p BluRay/ | 2020-10-01 18:18 | - | |
| Baja (2018) BluRay 1080p/ | 2020-10-01 18:24 | - | |
| Bao (2018) BluRay 1080p/ | 2020-10-01 19:28 | - | |
| Barren Trees (2018) WEBRip 1080p/ | 2020-10-01 17:19 | - | |
| Battalion (2018) 1080p/ | 2020-10-01 18:22 | - | |
| Battle (2018) BluRay 1080p/ | 2020-10-25 10:29 | - | |
| Battle Bots (2018) WEBRip 1080p/ | 2020-10-01 18:19 | - | |
| Bayou Caviar (2018) 1080p/ | 2020-10-01 17:25 | - | |
| Be With You (2018) [BluRay] [1080p] [YTS.AM]/ | 2020-10-01 16:58 | - | |
| Beach Babe Bingo (2018) WEBRip/ | 2020-10-01 17:12 | - | |
| Beast Of Burden (2018) 1080p/ | 2020-10-01 17:29 | - | |
| Beautiful Boy (2018) 1080p/ | 2020-10-01 18:37 | - | |
| Beautifully Broken (2018) DVDRip/ | 2020-10-01 16:10 | - | |
| Beauty & The Beholder (2018) 1080p/ | 2020-10-01 18:43 | - | |
| Been So Long (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Before Someone Gets Hurt (2018) BluRay 1080p/ | 2020-10-01 19:35 | - | |
| Being Frank (2018) WEBRip 1080p/ | 2020-10-01 17:19 | - | |
| Beirut (2018) BluRay 1080p/ | 2020-10-01 19:23 | - | |
| Bel Canto (2018) BluRay 1080p/ | 2020-10-01 18:12 | - | |
| Believer (2018) 1080p/ | 2020-10-01 18:28 | - | |
| Belong To Us (2018) WEBRip 1080p/ | 2020-10-01 18:22 | - | |
| Beloved Beast (2018) WEBRip 1080p/ | 2020-10-01 19:13 | - | |
| Ben Is Back (2018) BluRay 1080p/ | 2020-10-01 17:49 | - | |
| Benji (2018) 720p/ | 2020-10-01 17:10 | - | |
| Bent (2018) 1080p/ | 2020-10-01 17:58 | - | |
| Bernie The Dolphin (2018) 1080p/ | 2020-10-01 18:19 | - | |
| Best F(r)iends Volume 2 (2018) 1080p/ | 2020-10-01 18:14 | - | |
| Betrayed (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Between Worlds (2018) BluRay 1080p/ | 2020-10-01 18:55 | - | |
| Beyond Boundaries The Harvey Weinstein Scandal (2018) 1080p/ | 2020-10-01 18:43 | - | |
| Beyond The Edge (2018) BluRay 1080p/ | 2020-10-02 22:59 | - | |
| Beyond The Night (2018) 1080p/ | 2020-10-01 18:02 | - | |
| Beyond The Sky (2018) BluRay 1080p/ | 2020-10-01 19:06 | - | |
| Beyond The Woods (2018) 1080p/ | 2020-10-01 18:17 | - | |
| Beyond White Space (2018) 1080p/ | 2020-10-25 10:34 | - | |
| Big Kill (2018) BluRay 1080p/ | 2020-10-01 17:36 | - | |
| Big Legend (2018) 1080p/ | 2020-10-01 17:26 | - | |
| Bigger (2018) WEBRip 1080p/ | 2020-10-01 18:16 | - | |
| Billionaire Boys Club (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Bird Box (2018) 1080p/ | 2021-03-11 14:14 | - | |
| Birds Of A Feather 2 (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Birds Of Passage (2018) BluRay 1080p/ | 2020-10-02 22:55 | - | |
| Birthmarked (2018) 1080p/ | 2020-10-01 17:27 | - | |
| Bisbee '17 (2018) BluRay 1080p/ | 2020-10-01 17:30 | - | |
| BlacKkKlansman (2018) BluRay 1080p/ | 2020-10-01 18:11 | - | |
| Black 47 (2018) 1080p/ | 2020-10-01 16:51 | - | |
| Black Mirror Bandersnatch (2018) 1080p WEB-DL/ | 2020-10-01 16:10 | - | |
| Black Panther (2018) BluRay 1080p/ | 2026-08-14 04:38 | - | |
| Black Site (2018) 1080p BluRay/ | 2020-10-01 17:26 | - | |
| Black Wake (2018) 1080p/ | 2020-10-01 17:04 | - | |
| Blaze (2018) 1080p/ | 2020-10-01 16:52 | - | |
| Bleach (2018) BluRay 1080p/ | 2020-10-01 18:31 | - | |
| Blindspotting (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Blockers (2018) 1080p/ | 2020-10-01 17:23 | - | |
| Blood Fest (2018) BluRay 1080p/ | 2020-10-01 18:13 | - | |
| Blood Paradise (2018) WEBRip 1080p/ | 2020-10-01 17:33 | - | |
| Bloodline (2018) BluRay 1080p/ | 2020-10-01 18:33 | - | |
| Blue Iguana (2018) BluRay 1080p/ | 2020-10-01 18:02 | - | |
| Boar (2018) BDRip/ | 2020-10-02 22:57 | - | |
| Boarding School (2018) 1080p/ | 2020-10-01 19:03 | - | |
| Bob Lazar Area 51 & Flying Saucers (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| BodySnatch (2018) 720p/ | 2020-10-02 22:56 | - | |
| Body of Sin (2018) HDRip/ | 2020-10-01 16:10 | - | |
| Bohemian Rhapsody (2018) BluRay 1080p/ | 2020-10-01 17:20 | - | |
| Boogie Man (2018) WEBRip 1080p/ | 2020-10-02 22:45 | - | |
| Book Club (2018) BluRay 1080p/ | 2020-10-01 18:07 | - | |
| Book Of Monsters (2018) WEBRip 1080p/ | 2020-10-01 19:01 | - | |
| Born Racer (2018) BluRay 720p/ | 2020-10-01 18:12 | - | |
| Boundaries (2018) WEBRip 1080p/ | 2020-10-02 22:54 | - | |
| Boy Erased (2018) 1080p/ | 2020-10-01 17:30 | - | |
| Boyne Falls (2018) 1080p/ | 2020-10-01 17:26 | - | |
| Boys (2018) [WEBRip] [1080p] [YTS.AM]/ | 2020-10-01 19:18 | - | |
| Braid (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Brampton's Own (2018) WEBRip 1080p/ | 2020-10-01 19:16 | - | |
| Braven (2018) BluRay 1080p/ | 2020-10-01 17:26 | - | |
| Breaking & Exiting (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Breaking In (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Brian Banks (2018) WEBRip 1080p/ | 2020-10-01 17:57 | - | |
| Broken Star - 2018 - WEBRip 1080p/ | 2020-10-01 18:46 | - | |
| Broken Swords The Last In Line - 2018 - 1080p WEBRip/ | 2020-10-01 16:10 | - | |
| Bronson (2008) 1080p/ | 2018-11-20 11:09 | - | |
| Brothers' Nest (2018) 1080p/ | 2020-10-01 18:38 | - | |
| Brutal (2018) BluRay 1080p/ | 2020-10-01 17:12 | - | |
| Budapest (2018) 720p/ | 2020-10-01 16:10 | - | |
| Buffalo Boys (2018) WEBRip 1080p/ | 2020-10-01 19:25 | - | |
| Bumblebee (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Burning Kiss (2018) WEBRip 1080p/ | 2020-10-01 18:17 | - | |
| Burnt Offering (2018) 1080p/ | 2020-10-01 18:12 | - | |
| Buttons (2018) WEBRip 1080p/ | 2020-10-25 10:27 | - | |
| CTRL (2018) WEBRip 1080p/ | 2020-10-01 19:36 | - | |
| Calibre (2018) 1080p/ | 2020-10-01 18:16 | - | |
| California No (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Call Her Ganda (2018) 1080p/ | 2019-01-02 11:16 | - | |
| Cam (2018) 1080p/ | 2020-10-01 18:37 | - | |
| Camp Cold Brook (2018) 1080p WEBRip/ | 2020-10-01 18:39 | - | |
| Can You Ever Forgive Me (2018) 1080p/ | 2019-02-06 08:34 | - | |
| Canal Street (2018) WEBRip 1080p/ | 2020-10-01 18:45 | - | |
| Candy Jar (2018) 1080p/ | 2020-10-01 19:15 | - | |
| Care (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Carga (2018) 1080p/ | 2020-10-01 17:43 | - | |
| Carnivores (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Chandler Christmas Getaway (2018) 1080p WEBRip/ | 2020-10-01 19:25 | - | |
| Change In The Air (2018) WEBRip 1080p/ | 2020-10-01 19:29 | - | |
| Charlie Says (2018) BluRay 1080p/ | 2020-10-01 18:08 | - | |
| Chasing Bullitt (2018) WEBRip 1080p/ | 2020-10-01 19:12 | - | |
| Cheat The Hangman (2018) WEBRip 1080p/ | 2020-10-25 10:25 | - | |
| Cherokee Creek (2018) 1080p/ | 2020-10-01 19:12 | - | |
| Chimera Strain (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Chris Rock Tamborine (2018) 1080p/ | 2020-10-01 18:58 | - | |
| Christmas Break-In (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Christmas With A View (2018) 1080p/ | 2020-10-01 18:01 | - | |
| Christopher Robin (2018) BluRay 1080p/ | 2020-10-01 18:07 | - | |
| Cinderella The Enchanted Beginning (2018) 1080p WEB-DL/ | 2020-10-01 16:10 | - | |
| Cities Of Last Things (2018) WEBRip 1080p/ | 2020-10-02 22:57 | - | |
| City Of Gold (2018) BluRay 1080p/ | 2020-10-01 18:08 | - | |
| City Of Lies (2018) BluRay 720p/ | 2020-10-01 18:12 | - | |
| Clara's Ghost (2018) 1080p/ | 2020-10-25 10:28 | - | |
| Climax (2018) WEBRip 1080p/ | 2020-10-01 17:23 | - | |
| Code Name Dynastud (2018) 1080p/ | 2020-10-01 18:45 | - | |
| Cold Brook (2018) WEBRip 1080p/ | 2020-10-01 19:31 | - | |
| Cold War (2018) BluRay 1080p/ | 2020-10-01 17:05 | - | |
| Coldplay A Head Full Of Dreams (2018) WEBRip 1080p/ | 2020-10-01 18:04 | - | |
| Colette (2018) 1080p BluRay/ | 2020-10-01 16:36 | - | |
| Come Sunday (2018) BluRay 1080p/ | 2020-10-01 17:31 | - | |
| Comedy Central Roast Of Bruce Willis (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Con Man (2018) BDRip/ | 2020-10-01 19:03 | - | |
| Corbin Nash (2018) 1080p/ | 2020-10-01 18:17 | - | |
| Counterfeiting In Suburbia (2018) 720p/ | 2020-10-01 18:59 | - | |
| Cover Versions (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Crazy Rich Asians (2018) BluRay 1080p/ | 2020-10-01 18:45 | - | |
| Creed II (2018) BluRay 1080p/ | 2020-10-01 19:10 | - | |
| Crown And Anchor (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Cruise (2018) 1080p/ | 2020-10-01 18:27 | - | |
| Cutterhead (2018) WEBRip 1080p/ | 2020-10-02 23:01 | - | |
| Dachra (2018) 1080p/ | 2020-11-02 16:54 | - | |
| Daddy Issues (2018) WEBRip 1080p/ | 2020-10-01 17:31 | - | |
| Dagenham (2018) WEBRip 1080p/ | 2020-10-01 18:10 | - | |
| Damo & Ivor The Movie (2018) 1080p/ | 2020-10-01 18:20 | - | |
| Damsel (2018) 720p/ | 2020-10-01 19:28 | - | |
| Danger One (2018) 1080p/ | 2020-10-01 18:59 | - | |
| Daphne & Velma (2018) BluRay 1080p/ | 2020-10-01 18:02 | - | |
| Darc (2018) 1080p NF WEB/ | 2020-10-01 18:08 | - | |
| Dark, Deadly & Dreadful (2018) WEBRip 1080p/ | 2020-10-01 17:31 | - | |
| Dark Figure Of Crime (2018) BluRay 1080p/ | 2020-10-01 18:13 | - | |
| Dark Money (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Darker Than Night (2018) WEBRip 1080p/ | 2020-10-01 17:42 | - | |
| Das Schönste Mädchen Der Welt (2018) BluRay 1080p/ | 2020-10-02 23:01 | - | |
| Daughter Of Mine (2018) BluRay 1080p/ | 2020-10-02 22:54 | - | |
| Daughters Of The Sexual Revolution The Untold Story Of The Dallas Cowboys Cheerleaders (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Dawn (2018) WEBRip 1080p/ | 2020-10-01 18:11 | - | |
| Day of the Dead Bloodline (2018) 1080p/ | 2020-10-01 19:37 | - | |
| Days Of Power (2018) 1080p/ | 2020-10-01 17:33 | - | |
| Dead End (2018) WEBRip 1080p/ | 2020-10-01 18:08 | - | |
| Dead In A Week Or Your Money Back (2018) BluRay 1080p/ | 2020-10-01 19:34 | - | |
| Dead In The Water (2018) 1080p/ | 2020-10-01 18:08 | - | |
| Dead Ringer (2018) WEBRip 1080p/ | 2020-10-01 19:01 | - | |
| Dead Sexy (2018) WEBRip 1080p/ | 2020-10-01 18:20 | - | |
| Dead Squad Temple Of The Undead (2018) 1080p/ | 2020-10-01 18:01 | - | |
| DeadTectives (2018) 720p WEBRip/ | 2020-10-01 16:10 | - | |
| Deadly Runway (2018) WEBRip 1080p/ | 2020-10-01 19:16 | - | |
| Deadpool 2 (2018) BluRay 1080p/ | 2020-10-02 22:55 | - | |
| Dear Dictator (2018) 720p/ | 2020-10-01 16:10 | - | |
| Death Kiss (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Death Of A Nation (2018) [BluRay] [1080p] [YTS.AM]/ | 2020-10-25 10:31 | - | |
| Death Race 4 Beyond Anarchy (2018) 720p/ | 2020-10-01 18:42 | - | |
| Death Wish (2018) BluRay 1080p/ | 2020-10-01 18:48 | - | |
| Deathday (2018) BluRay 1080p/ | 2020-10-01 17:46 | - | |
| Deep Blue Sea 2 (2018) 720p/ | 2020-10-01 18:21 | - | |
| Deep Murder (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Delinquent (2018) BluRay 1080p/ | 2020-10-01 17:06 | - | |
| Delirium (2018) 1080p BluRay/ | 2020-10-01 18:48 | - | |
| Demon House (2018) 1080p/ | 2020-10-01 16:57 | - | |
| Den of Thieves (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Derren Brown Sacrifice (2018) 1080p/ | 2020-10-01 17:10 | - | |
| Desolate (2018) WEBRip 1080p/ | 2020-10-01 19:34 | - | |
| Desperate Cowboys (2018) WEBRip 1080p/ | 2020-10-01 18:19 | - | |
| Destination Dewsbury (2018) WEBRip 1080p/ | 2020-10-01 18:55 | - | |
| Destination Wedding (2018) BluRay 1080p/ | 2020-10-01 17:38 | - | |
| Destined To Ride (2018) WEBRip 1080p/ | 2020-10-01 19:17 | - | |
| Destroyer (2018) BluRay 1080p/ | 2020-10-01 18:22 | - | |
| Detective Chinatown 2 (2018) BluRay 720p/ | 2020-11-29 14:27 | - | |
| Devil's Tree Rooted Evil (2018) 1080p/ | 2020-10-01 17:56 | - | |
| Devils Path (2018) 1080p AMZN WEB-DL DDP5 1 H264-CMRGEtHD/ | 2020-10-01 16:10 | - | |
| Devious Nanny (2018) 1080p/ | 2020-10-01 17:23 | - | |
| Die In One Day (2018) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| Dirty Dealing 3D (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Distorted (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Do Women Have A Higher Sex Drive (2018) 1080p/ | 2020-10-01 19:34 | - | |
| Do You Trust This Computer (2018) 1080p/ | 2020-10-01 18:41 | - | |
| Doe (2018) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Dog Days (2018) WEBRip 1080p/ | 2020-10-01 17:32 | - | |
| Don't Go (2018) BluRay 1080p/ | 2020-10-01 18:20 | - | |
| Don't Leave Home (2018) 720p/ | 2020-10-01 16:10 | - | |
| Don't Open Your Eyes (2018) 720p/ | 2020-10-01 16:10 | - | |
| Don't Worry, He Won't Get Far On Foot (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Donbass (2018) BluRay 1080p/ | 2020-10-01 17:44 | - | |
| Donnybrook (2018) 1080p/ | 2020-10-01 19:11 | - | |
| Doses Of Horror (2018) 1080p/ | 2020-10-01 18:03 | - | |
| Double Eagle Ranch (2018) WEBRip 1080p/ | 2020-10-01 19:10 | - | |
| Doubting Thomas (2018) WEBRip 1080p/ | 2020-10-01 19:27 | - | |
| Down A Dark Hall (2018) BluRay 1080p/ | 2020-10-01 17:26 | - | |
| Down River (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Downrange (2018)/ | 2020-10-01 16:10 | - | |
| Dracula In Love (2018) 1080p/ | 2020-10-01 18:25 | - | |
| Dragged Across Concrete (2018) 1080p/ | 2020-10-01 19:35 | - | |
| Draug (2018) BluRay 1080p/ | 2020-10-01 18:12 | - | |
| Dreams I Never Had (2018) 720p/ | 2020-10-01 16:10 | - | |
| Driven (2018) BluRay 1080p/ | 2020-10-01 18:16 | - | |
| Driven To Dance (2018) 1080p/ | 2020-10-01 17:20 | - | |
| Drug$ (2018) 1080p/ | 2020-10-01 18:27 | - | |
| Drugs As Weapons Against Us The CIA War On Musicians And Activists (2018) 720p/ | 2020-10-01 17:46 | - | |
| Dublin Oldschool (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Duck Butter (2018) 1080p/ | 2020-10-01 19:34 | - | |
| Dude (2018) 1080p/ | 2020-10-01 18:42 | - | |
| Dumplin' (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Dying Embers (2018) 720p/ | 2020-10-01 17:57 | - | |
| E-Demon (2018) 1080p/ | 2020-10-01 18:10 | - | |
| Eat Me (2018) WEBRip 1080p/ | 2020-10-01 18:43 | - | |
| Eaten By Lions (2018) WEBRip 1080p/ | 2020-10-01 18:37 | - | |
| Edge Of Fear (2018) 1080p/ | 2020-10-01 18:18 | - | |
| Edging (2018) WEBRip 1080p/ | 2020-10-01 18:20 | - | |
| Eighth Grade (2018) 1080p BluRay/ | 2020-10-01 17:44 | - | |
| El Angel (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| El Chicano (2018) BluRay 1080p/ | 2020-10-01 19:17 | - | |
| Elephants (2018) 720p/ | 2020-10-01 17:01 | - | |
| Elevate (2018) WEBRip 1080p/ | 2020-10-01 19:00 | - | |
| Elizabeth Harvest (2018) BluRay 1080p/ | 2020-10-01 17:55 | - | |
| Elvis Presley The Searcher (2018) BluRay 1080p/ | 2020-10-01 18:54 | - | |
| End Of The World (2018) 1080p BluRay/ | 2020-10-01 16:10 | - | |
| End Trip (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Enter The Wild (2018) 1080p/ | 2020-10-01 16:55 | - | |
| Escape Plan 2 Hades (2018) 1080p BluRay/ | 2020-10-02 22:54 | - | |
| Every 21 Seconds (2018) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Every Day (2018) BluRay 1080p/ | 2020-10-01 19:31 | - | |
| Everybody Knows (2018) BluRay 1080p/ | 2020-10-01 17:35 | - | |
| Everything Is Wonderful (2018) WEBRip 1080p/ | 2020-10-01 17:17 | - | |
| Exposure (2018) 720p/ | 2020-10-01 18:37 | - | |
| Extinction (2018) 1080p/ | 2020-10-01 17:09 | - | |
| Extracurricular (2018) 1080p/ | 2020-10-01 18:07 | - | |
| Fahrenheit 11 9 (2018) 720p/ | 2020-10-01 18:04 | - | |
| Fahrenheit 451 (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Faith, Love & Chocolate (2018) 1080p/ | 2020-10-01 19:06 | - | |
| False Flag (2018) WEBRip 1080p/ | 2020-10-01 19:38 | - | |
| Family (2018) 720p/ | 2020-10-01 17:52 | - | |
| Family Blood (2018) 1080p/ | 2020-10-01 17:32 | - | |
| Family Vanished (2018) 720p/ | 2020-10-02 23:00 | - | |
| Fantastic Beasts The Crimes Of Grindelwald (2018) BluRay 1080p/ | 2020-10-25 10:25 | - | |
| Far Cry 5 Inside Eden's Gate (2018) 1080p/ | 2020-10-01 17:14 | - | |
| Farming (2018) WEBRip 1080p/ | 2020-10-01 18:18 | - | |
| Fast Color (2018) BluRay 1080p/ | 2020-10-01 19:11 | - | |
| Fatal Crossing (2018) 1080p/ | 2020-10-25 10:30 | - | |
| Father Of The Year (2018) 1080p/ | 2020-10-01 18:15 | - | |
| Father To Son (2018) 1080p BluRay/ | 2020-10-01 17:51 | - | |
| Feminists What Were They Thinking (2018) 1080p/ | 2020-10-01 19:38 | - | |
| Fifty Shades Freed (2018) BluRay 1080p/ | 2020-10-01 18:41 | - | |
| Fighting The Sky (2018) 1080p/ | 2020-10-01 17:07 | - | |
| Final Score (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Finding Steve McQueen (2018) 1080p/ | 2020-10-01 18:52 | - | |
| Firecrackers (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| First Man (2018) BluRay 1080p/ | 2020-10-01 19:33 | - | |
| First We Take Brooklyn (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Fishbowl California (2018) BluRay 1080p/ | 2020-10-01 18:32 | - | |
| Flesh Blanket (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Flight 666 (2018) 1080p WEB/ | 2019-02-19 09:49 | - | |
| Foods That Cure Disease (2018) WEBRip 1080p/ | 2020-10-01 18:45 | - | |
| For The Love Of George (2018) WEBRip 1080p/ | 2020-10-01 17:36 | - | |
| Forever My Girl (2018) BluRay 1080p/ | 2020-10-01 19:16 | - | |
| Forgive - Don't Forget (2018) 1080p/ | 2020-10-01 16:51 | - | |
| Forsaken (2018)/ | 2020-10-01 16:57 | - | |
| Fourplay (2018) WEBRip 1080p/ | 2020-10-01 18:16 | - | |
| Fractured (2018) 1080p/ | 2020-10-01 17:23 | - | |
| Frank And Ava (2018) WEBRip 1080p/ | 2020-10-01 17:56 | - | |
| Frat Pack (2018) 1080p/ | 2020-10-01 19:01 | - | |
| Freaks (2018) BluRay 1080p/ | 2020-10-01 19:04 | - | |
| Free Rein The Twelve Neighs Of Christmas (2018) 1080p/ | 2020-10-01 18:08 | - | |
| Free Solo (2018) BluRay 1080p/ | 2020-10-01 18:24 | - | |
| Frenzy (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Fronteras (2018) WEBRip 1080p/ | 2020-10-01 17:31 | - | |
| Frozen In Love (2018) 720p/ | 2020-10-01 19:35 | - | |
| Funny Story (2018) WEBRip 1080p/ | 2020-10-01 19:26 | - | |
| Furlough (2018) 1080p/ | 2020-10-01 18:02 | - | |
| Future World (2018) 1080p/ | 2020-10-01 18:41 | - | |
| Gags The Clown (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Galaxy Lords (2018) 1080p/ | 2020-10-01 17:17 | - | |
| Galveston (2018) BluRay 1080p/ | 2020-10-01 17:42 | - | |
| Game Night (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Game Over Man (2018) 1080p/ | 2020-10-01 17:18 | - | |
| Genesis (2018) 1080p/ | 2020-10-01 19:22 | - | |
| Ghost Light (2018) WEBRip 1080p/ | 2020-10-01 17:24 | - | |
| Ghost Of Camp Blood (2018) 1080p/ | 2020-10-01 18:03 | - | |
| Ghost Stories (2018) 1080p WEB/ | 2020-10-01 18:51 | - | |
| Ghostbox Cowboy (2018) 1080p/ | 2020-10-01 17:26 | - | |
| Giant Little Ones (2018) WEBRip 1080p/ | 2020-10-01 17:26 | - | |
| Girl (2018) BluRay 1080p/ | 2020-10-02 22:59 | - | |
| Glass Jaw (2018) WEBRip 1080p/ | 2020-10-25 10:35 | - | |
| Gloria Bell (2018) BluRay 1080p/ | 2020-10-01 18:45 | - | |
| Glossary Of Broken Dreams (2018) BluRay 1080p/ | 2020-10-01 18:09 | - | |
| God's Not Dead A Light In Darkness (2018) BluRay 1080p/ | 2020-10-01 17:06 | - | |
| God Bless The Broken Road (2018) BluRay 1080p/ | 2020-10-01 18:40 | - | |
| Gold Blooded (2018) WEBRip 1080p/ | 2020-10-02 22:58 | - | |
| Gone Are The Days (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Goosebumps 2 Haunted Halloween (2018) 720p BluRay Dual-Audio/ | 2020-10-01 18:10 | - | |
| Gosnell The Trial Of America's Biggest Serial Killer (2018) 1080p/ | 2020-10-01 18:11 | - | |
| Gothic Harvest (2018) WEBRip 1080p/ | 2020-10-01 19:38 | - | |
| Gotti (2018) 1080p/ | 2020-10-25 10:35 | - | |
| Gray Matter (2018) 1080p/ | 2020-10-01 19:00 | - | |
| Green Book (2018) BluRay 1080p/ | 2020-10-01 17:19 | - | |
| Greta (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Gringo (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Guardians Of The Tomb (2018) 720p/ | 2020-10-01 17:27 | - | |
| Gundermann (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Guns Of The Apocalypse (2018) 1080p/ | 2020-10-01 17:39 | - | |
| Gwen (2018) BluRay 1080p/ | 2020-10-01 18:48 | - | |
| Hacker's Game Redux (2018) WEBRip 1080p/ | 2020-10-01 19:05 | - | |
| Hale County This Morning, This Evening (2018) BluRay 720p/ | 2020-10-01 17:56 | - | |
| Half Magic (2018) 1080p/ | 2020-10-01 18:42 | - | |
| Halloween (2018) BluRay 1080p/ | 2024-10-17 07:57 | - | |
| Halloween Horror Tales (2018) 1080p/ | 2020-10-01 17:43 | - | |
| Hamlet In The Golden Vale (2018) WEBRip 1080p/ | 2020-10-01 18:40 | - | |
| Happy Anniversary (2018) 1080p/ | 2020-10-01 16:52 | - | |
| Happy Birthday Hannah (2018) 720p/ | 2020-10-01 16:10 | - | |
| Harmony (2018) BluRay 1080p/ | 2020-10-01 18:25 | - | |
| Haunting On Fraternity Row (2018) 1080p/ | 2020-10-01 18:19 | - | |
| He's Out There (2018) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| Head Count (2018) WEBRip 1080p/ | 2020-10-01 17:14 | - | |
| Head Full Of Honey (2018) WEBRip 1080p/ | 2020-10-01 18:24 | - | |
| Headgame (2018) BluRay 1080p/ | 2020-10-01 18:13 | - | |
| Hearts Beat Loud (2018) 1080p/ | 2020-10-01 19:01 | - | |
| Heaven & Hell (2018) 1080p/ | 2020-10-01 19:28 | - | |
| Hell Fest (2018) 1080p/ | 2020-10-25 10:26 | - | |
| Hellfest (2018) 1080p dual/ | 2020-10-01 18:13 | - | |
| Hellmington (2018) WEBRip 1080p/ | 2020-10-25 10:27 | - | |
| Hellraiser Judgment (2018) 1080p BluRay/ | 2020-10-01 18:28 | - | |
| Her Only Choice (2018) WEBRip 1080p/ | 2020-10-02 22:53 | - | |
| Her Side Of The Bed (2018) WEBRip 1080p/ | 2020-10-01 18:08 | - | |
| Her Side of the Bed (2018) HDRip/ | 2019-03-12 09:57 | - | |
| Her Smell (2018) BluRay 1080p/ | 2020-10-01 18:14 | - | |
| Her Worst Nightmare (2018) WEBRip 1080p/ | 2020-10-01 18:59 | - | |
| Here And Now (2018) 1080p/ | 2020-10-01 18:52 | - | |
| Hereditary (2018) 1080p/ | 2020-10-01 18:14 | - | |
| Herstory (2018) BluRay 1080p/ | 2020-10-01 18:15 | - | |
| Hex (2018) WEBRip 1080p/ | 2020-10-01 18:36 | - | |
| High Life (2018) BluRay 1080p/ | 2020-10-01 16:54 | - | |
| High Strung Free Dance (2018) WEBRip 1080p/ | 2020-10-01 18:11 | - | |
| High Voltage (2018) 1080p/ | 2020-10-01 17:25 | - | |
| Higher Power (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Hippopotamus (2018) 720p WEBRip/ | 2021-12-19 10:38 | - | |
| His Perfect Obsession (2018)/ | 2020-10-01 17:33 | - | |
| Hold the Dark (2018) 1080p/ | 2020-10-01 17:02 | - | |
| Holiday (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Holly Star (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Holmes & Watson (2018) 1080p/ | 2020-10-01 18:07 | - | |
| Holy Lands (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Hooligan Escape The Russian Job (2018) 1080p/ | 2020-10-01 17:22 | - | |
| Hope Springs Eternal (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Hornet (2018) 1080p BluRay/ | 2020-10-01 18:03 | - | |
| Horror And Hamsters (2018) 1080p/ | 2020-10-01 17:31 | - | |
| Hospitality (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Hot Air (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Hotel Artemis (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Hotel Mumbai (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| How It Ends (2018) 1080p/ | 2020-10-01 16:10 | - | |
| How To Say Goodbye (2018) WEBRip 1080p/ | 2020-10-01 17:47 | - | |
| Howard Lovecraft And The Kingdom Of Madness (2018) WEBRip 1080p/ | 2018-12-07 12:41 | - | |
| Human Affairs (2018) WEBRip 1080p/ | 2020-10-01 18:16 | - | |
| Hunt For The Skinwalker (2018) 1080p/ | 2020-10-01 19:35 | - | |
| Hunter Killer (2018) WEBRip 1080p/ | 2020-10-01 17:48 | - | |
| Hurricane (2018) 1080p BluRay/ | 2020-10-01 19:04 | - | |
| I'll Be Next Door For Christmas (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| I'll Take Your Dead (2018) BluRay 1080p/ | 2020-10-01 17:43 | - | |
| I Am Vengeance (2018) 1080p/ | 2020-10-01 17:16 | - | |
| I Before Thee (2018) WEBRip 1080p/ | 2020-10-01 17:05 | - | |
| I Can Only Imagine (2018) BluRay 1080p/ | 2020-10-01 17:30 | - | |
| I Feel Pretty (2018) 720p/ | 2020-10-01 17:58 | - | |
| I Like Me (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| I Love My Mum (2018) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| I Still See You (2018) BluRay 1080p/ | 2020-10-01 17:31 | - | |
| I Think We're Alone Now (2018) BluRay 1080p/ | 2020-10-01 17:22 | - | |
| Ibiza (2018) 1080p/ | 2020-10-01 16:10 | - | |
| Icebox (2018) 1080p/ | 2020-10-01 18:22 | - | |
| Ideal Home (2018) 1080p/ | 2020-10-02 11:45 | - | |
| Idled (2018) 1080p/ | 2020-10-01 18:54 | - | |
| If Beale Street Could Talk (2018) BluRay 1080p/ | 2020-10-01 19:00 | - | |
| Iliza Elder Millennial (2018) 1080p/ | 2020-10-01 18:30 | - | |
| In A Relationship (2018) 1080p/ | 2020-10-01 18:52 | - | |
| In Darkness (2018) 1080p/ | 2020-10-01 19:34 | - | |
| In Echo Park (2018) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| In Fabric (2018) WEBRip 1080p/ | 2020-10-01 18:29 | - | |
| In God I Trust (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| In Like Flynn (2018) 1080p/ | 2020-10-01 16:10 | - | |
| In Reality (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| In The Aisles (2018) BluRay 1080p/ | 2020-10-25 10:33 | - | |
| In The Cloud (2018) 1080p/ | 2020-10-01 17:25 | - | |
| In This Gray Place (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Incoming (2018) 720p WEBRip/ | 2020-10-01 17:24 | - | |
| Incredible Violence (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| Indivisible (2018) BluRay 1080p/ | 2020-10-01 18:43 | - | |
| Inhumane (2018) 720p/ | 2020-10-01 18:38 | - | |
| Inside The Manson Cult The Lost Tapes (2018) 1080p/ | 2020-10-01 19:32 | - | |
| Insidious The Last Key (2018) 1080p/ | 2020-10-01 18:04 | - | |
| Instant Family (2018) BluRay 1080p/ | 2020-10-01 17:42 | - | |
| Interactive Introverts (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| Interference (2018) 1080p/ | 2020-10-01 18:54 | - | |
| Invisible Sue (2018) WEBRip 1080p/ | 2020-10-01 18:18 | - | |
| Invoking 5 (2018) WEBRip 720p/ | 2020-10-01 16:10 | - | |
| Is That You (2018) 720p/ | 2021-05-25 05:36 | - | |
| Isabelle (2018) BluRay 1080p/ | 2020-10-01 16:10 | - | |
| It's A Hard Truth Ain't It (2018) 1080p/ | 2020-10-01 18:32 | - | |
| It Will Be Chaos (2018) WEBRip 1080p/ | 2020-10-01 17:28 | - | |
| JFK The Lost Assassination Tapes (2018)/ | 2020-10-01 18:30 | - | |
| JT LeRoy (2018) BluRay 1080p/ | 2020-10-01 18:26 | - | |
| Jane Fonda In Five Acts (2018) 1080p/ | 2020-10-01 18:14 | - | |
| Jesus Christ Superstar Live In Concert (2018) 1080p/ | 2020-10-01 17:38 | - | |
| Jinn (2018) HDRip/ | 2020-10-01 18:13 | - | |
| Jirga (2018) WEBRip 1080p/ | 2020-10-01 18:11 | - | |
| John & Yoko Above Us Only Sky (2018) BluRay 1080p/ | 2020-10-01 18:17 | - | |
| John McEnroe In The Realm Of Perfection (2018) BluRay 1080p/ | 2020-10-01 19:06 | - | |
| Johnny English Strikes Again (2018) 1080p Bluray/ | 2020-10-01 18:01 | - | |
| Jonathan (2018) BluRay 1080p/ | 2020-10-02 11:50 | - | |
| Josie (2018) 1080p/ | 2018-05-18 12:19 | - | |
| Journal 64 (2018) 1080p BluRay/ | 2020-10-01 16:10 | - | |
| Joy (2018) WEBRip 1080p/ | 2020-10-01 18:41 | - | |
| Juliet, Naked (2018) BluRay 1080p/ | 2020-10-01 18:38 | - | |
| Jurassic Galaxy (2018) BluRay 1080p/ | 2020-10-01 18:09 | - | |
| Jurassic World Fallen Kingdom (2018) BluRay 1080p/ | 2020-10-02 23:00 | - | |
| Juug Gone Wrong (2018) WEBRip 1080p/ | 2020-10-01 17:40 | - | |
| Kaleidoscope (2016) 1080p/ | 2020-10-01 19:05 | - | |
| Kevin James Never Don't Give Up (2018) 1080p/ | 2020-10-01 19:15 | - | |
| Kevin Smith Silent But Deadly (2018) WEBRip 1080p/ | 2020-10-01 16:10 | - | |
| Kickboxer Retaliation (2018) 1080p/ | 2020-10-01 18:18 | - | |
| Killer Kate! (2018) BluRay 1080p/ | 2020-10-02 23:02 | - | |
| Killer Under the Bed (2018) 1080p WEBRip/ | 2022-02-05 10:12 | - | |
| Killer Weekend (2018) WEBRip 1080p/ | 2020-10-01 18:40 | - | |
| Killing Joan (2018) 720p/ | 2020-10-01 16:10 | - | |
| Kin (2018) BluRay 1080p/ | 2020-10-25 10:30 | - | |
| King Of Crime (2018) 1080p/ | 2020-10-01 16:11 | - | |
| King Of Thieves (2018) BluRay 1080p/ | 2020-10-01 18:37 | - | |
| Klippers (2018) 1080p/ | 2020-10-01 19:05 | - | |
| Knuckleball (2018) WEBRip 1080p/ | 2020-10-25 10:32 | - | |
| Kodachrome (2018) 1080p/ | 2020-10-01 18:57 | - | |
| Krampus Origins (2018) 1080p/ | 2020-10-01 18:22 | - | |
| Kursk (2018) BluRay 1080p/ | 2020-10-01 17:56 | - | |
| Ladies In Black (2018) BluRay 1080p/ | 2020-10-01 19:23 | - | |
| Lady-Like (2018) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Ladyworld (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Lake Fear 3 (2018) WEBRip 1080p/ | 2020-10-01 19:13 | - | |
| Lake Placid Legacy (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Landing Up (2018) HDRip AC3 X264/ | 2018-05-18 05:45 | - | |
| Lasso (2018) WEBRip 1080p/ | 2020-10-01 18:31 | - | |
| Last American Horror Show (2018) 720p/ | 2020-10-01 18:15 | - | |
| Last Seen In Idaho (2018) 1080p/ | 2020-10-01 18:06 | - | |
| Last Summer (2018) WEBRip 1080p/ | 2020-10-02 22:55 | - | |
| Latin History For Morons John Leguizamo's Road To Broadway (2018) 1080p/ | 2020-10-01 18:39 | - | |
| Laugh Or Die (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Lazer Team 2 (2018) 1080p/ | 2020-10-01 19:16 | - | |
| Leave No Trace (2018) 1080p/ | 2020-10-01 17:01 | - | |
| Legend Of Hallowaiian (2018) 1080p/ | 2020-10-01 18:41 | - | |
| Leprechaun Returns (2018) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| Let's Not Meet (2018) 1080p/ | 2020-10-01 18:42 | - | |
| Lethal Admirer (2018) HDRip/ | 2020-10-01 17:14 | - | |
| Level 16 (2018) BluRay 1080p/ | 2020-10-01 17:02 | - | |
| Lez Bomb (2018) 1080p/ | 2020-10-01 19:35 | - | |
| Life In The Doghouse (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Life Itself (2018) BluRay 1080p/ | 2020-10-01 18:16 | - | |
| Life Of The Party (2018) 1080p/ | 2020-10-01 18:39 | - | |
| Lifechanger (2018) 1080p/ | 2020-10-01 19:07 | - | |
| Like Father (2018) WEBRip 1080p/ | 2020-10-02 22:53 | - | |
| Lionheart (2018) WEBRip 1080p/ | 2020-10-25 10:33 | - | |
| Little Bitches (2018) 1080p/ | 2020-10-01 17:32 | - | |
| Little Italy (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Little Women (2018) WEBRip 1080p/ | 2020-10-25 10:33 | - | |
| Liverleaf (2018) BluRay 1080p/ | 2020-10-01 18:22 | - | |
| Living Space (2018) HDRip/ | 2020-10-01 19:37 | - | |
| Lizzie (2018) 1080p BluRay/ | 2020-10-02 23:02 | - | |
| Locating Silver Lake (2018) WEBRip 1080p/ | 2020-10-01 19:05 | - | |
| Locked Alone (2018) 1080p WEBRip/ | 2020-10-01 16:11 | - | |
| London Fields (2018) BluRay 1080p/ | 2020-10-01 18:40 | - | |
| London Rampage (2018) WEBRip 1080p/ | 2020-10-01 17:13 | - | |
| Long Day's Journey Into Night (2018) 720p/ | 2021-12-06 04:53 | - | |
| Long Lost (2018) WEBRip 1080p/ | 2020-10-01 19:16 | - | |
| Look Away (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Looking For Lennon (2018) BluRay 1080p/ | 2020-10-01 18:22 | - | |
| Looking Glass (2018) 1080p/ | 2020-10-01 19:34 | - | |
| Lords of Chaos (2018) 1080p WEB/ | 2020-10-01 17:39 | - | |
| Loro (2018) 1080p BluRay/ | 2020-10-01 19:28 | - | |
| Loss Prevention (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Lost Child (2018) 1080p/ | 2020-10-01 16:53 | - | |
| Lost Fare (2018) 1080p/ | 2020-10-01 17:25 | - | |
| Lost in London (2018)/ | 2020-10-01 19:04 | - | |
| Loudon Wainwright III Surviving Twin (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Love & Debt (2018) 1080p/ | 2020-10-01 18:16 | - | |
| Love, Simon (2018) 1080p/ | 2020-10-25 10:29 | - | |
| Love Shot (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Love on Safari 2018 Hallmark 720p/ | 2020-10-01 16:11 | - | |
| Loving Pablo (2018) 720p/ | 2020-10-01 17:54 | - | |
| MARS Inside SpaceX (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Macbeth (2018) WEBRip 1080p/ | 2020-10-02 22:55 | - | |
| Madeline's Madeline (2018) BluRay 1080p/ | 2020-10-25 10:22 | - | |
| Madhouse Mecca (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Maiden (2018) BluRay 1080p/ | 2020-10-01 18:40 | - | |
| Mail Order Monster (2018) WEBRip 1080p/ | 2020-10-01 17:11 | - | |
| Maine (2018) 1080p/ | 2020-10-01 18:33 | - | |
| Make Us Dream (2018) 1080p/ | 2020-10-01 19:38 | - | |
| Making A Killing (2018) WEBRip 1080p/ | 2020-10-01 18:12 | - | |
| Making Babies (2018) WEBRip 1080p/ | 2020-10-01 17:49 | - | |
| Malevolence 3 Killer (2018) 1080p/ | 2018-10-15 07:43 | - | |
| Malevolent (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Malicious (2018) 1080p/ | 2020-10-01 18:42 | - | |
| Mamma Mia! Here We Go Again (2018) BluRay 1080p/ | 2020-10-01 18:38 | - | |
| Mandy (2018) 1080p/ | 2020-10-01 19:04 | - | |
| Mandy The Doll (2018) BluRay 1080p/ | 2020-10-01 17:46 | - | |
| Mapplethorpe (2018) WEBRip 1080p/ | 2020-10-01 19:03 | - | |
| Maquia When The Promised Flower Blooms (2018) BluRay 1080p/ | 2020-12-31 17:09 | - | |
| Mara (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Marfa Girl 2 (2018) WEBRip 1080p/ | 2020-10-01 18:46 | - | |
| Mari (2018) WEBRip 1080p/ | 2020-10-01 17:25 | - | |
| Marla Mae (2018) WEBRip 1080p/ | 2020-10-01 18:26 | - | |
| Mary Magdalene (2018) BluRay 720p/ | 2020-10-02 23:00 | - | |
| Mary Poppins Returns (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Mary Queen Of Scots (2018) BluRay 1080p/ | 2020-10-01 18:16 | - | |
| Matangi Maya M.I.A. (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Maze Runner The Death Cure (2018) 720p BluRay/ | 2021-12-05 16:41 | - | |
| Maze Runner The Death Cure (2018) BluRay 1080p/ | 2020-10-01 17:59 | - | |
| McQueen (2018) 1080p BluRay/ | 2020-10-01 19:28 | - | |
| Measure Of A Man (2018) WEBRip 1080p/ | 2020-10-25 10:26 | - | |
| Megalodon (2018) BluRay 1080p/ | 2020-10-02 11:51 | - | |
| Meme (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Mercury 13 (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Message Man (2018) 1080p/ | 2020-10-25 10:26 | - | |
| Mia And The White Lion (2018) BluRay 1080p/ | 2020-10-01 19:28 | - | |
| Mid90s (2018) 1080p/ | 2020-10-01 18:01 | - | |
| Midday Demons (2018) WEBRip 1080p/ | 2020-10-01 17:13 | - | |
| Midnight Sun (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Mile 22 (2018) BluRay 1080p/ | 2020-10-01 17:34 | - | |
| Minding The Gap (2018) 720p WEB/ | 2020-10-01 18:07 | - | |
| Mirage (2018) WEBRip 1080p/ | 2020-10-01 18:56 | - | |
| Miss Arizona (2018) WEBRip 1080p/ | 2020-10-25 10:25 | - | |
| Miss Dalà (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| Mission - Impossible - Fallout (2018) IMAX 1080p BluRay 10bit/ | 2021-02-14 16:54 | - | |
| Mistrust (2018) WEBRip 1080p/ | 2020-10-01 17:25 | - | |
| Mobile Suit Gundam Narrative (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Model Home (2018) WEBRip 1080p/ | 2020-10-01 17:32 | - | |
| Mom and Dad (2018) HDRip/ | 2020-10-01 17:00 | - | |
| Mommy Be Mine (2018) HDTV x264-TTL/ | 2020-10-01 18:53 | - | |
| Monster Hunt 2 (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Monster Party (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Monsters And Men (2018) BluRay 1080p/ | 2020-10-01 18:25 | - | |
| Monsters At Large (2018) WEBRip 1080p/ | 2020-10-01 18:11 | - | |
| Mooch (2018) 1080p/ | 2020-10-01 19:28 | - | |
| More Human Than Human (2018) 1080p/ | 2020-10-01 17:29 | - | |
| Morning, Noon & Night (2018) WEBRip 1080p/ | 2020-10-25 10:30 | - | |
| Mortal Engines (2018) BluRay 1080p/ | 2020-10-01 18:20 | - | |
| Most Likely To Murder (2018) 1080p/ | 2020-10-01 19:37 | - | |
| Mouthpiece (2018) WEBRip 1080p/ | 2020-10-01 18:02 | - | |
| Mowgli Legend of the Jungle (2018) 1080p NF WEBRip/ | 2020-10-01 18:12 | - | |
| Mrs. Claus (2018) WEBRip 1080p/ | 2020-10-01 18:32 | - | |
| Mute (2018) 720p BluRay/ | 2020-10-01 18:12 | - | |
| My Dinner With Hervé (2018) 1080p/ | 2020-10-01 18:45 | - | |
| My Friend 'A' (2018) BluRay 1080p/ | 2020-10-01 19:29 | - | |
| My Husbands Double Life (2018)/ | 2020-10-01 16:58 | - | |
| My Perfect Romance (2018) 1080p WEBRip/ | 2020-10-01 19:36 | - | |
| My Teacher, My Obsession (2018) 1080p/ | 2020-10-01 18:24 | - | |
| Nancy (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Nappily Ever After (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Nativity Rocks! (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Nazi Overlord (2018) BluRay 1080p/ | 2020-10-01 16:51 | - | |
| Nekrotronic (2018) BluRay 1080p/ | 2020-10-01 17:05 | - | |
| Never Goin' Back (2018) 1080p/ | 2020-10-01 18:08 | - | |
| Never Heard (2018) WEBRip 1080p/ | 2020-10-01 19:01 | - | |
| Never Look Away (2018) BluRay 1080p/ | 2020-10-01 18:48 | - | |
| Nigerian Prince (2018) WEBRip 1080p/ | 2020-10-01 18:08 | - | |
| Night Comes On (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Night Hunter (2018) BluRay 1080p/ | 2020-10-01 17:12 | - | |
| Night Of 7 Years (2018) 720p/ | 2021-03-12 19:39 | - | |
| Night School (2018) BluRay 1080p/ | 2020-10-01 18:12 | - | |
| Night Zero (2018) WEBRip 1080p/ | 2020-10-01 17:16 | - | |
| Nightclub Secrets (2018) 1080p/ | 2020-10-01 17:09 | - | |
| Nightmare Cinema (2018) BluRay 1080p/ | 2020-10-01 17:29 | - | |
| Nightshift (2018) 1080p/ | 2020-10-01 17:15 | - | |
| Nightshooters (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| No Alternative (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| No Good Heroes (2018) 1080p/ | 2020-10-01 18:43 | - | |
| No Surrender (2018) BluRay 1080p/ | 2020-10-01 16:54 | - | |
| Nobody's Fool (2018) BluRay 1080p/ | 2020-10-01 17:56 | - | |
| Nobody Famous (2018) WEBRip 1080p/ | 2020-10-01 18:41 | - | |
| Nostalgia (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Not Cinderella's Type (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Notes From Dunblane Lesson From A School Shooting (2018) 1080p/ | 2020-10-01 17:30 | - | |
| Notes From The Field (2018) 1080p/ | 2020-10-01 17:41 | - | |
| Nowhere Mind (2018) 1080p/ | 2020-10-01 16:11 | - | |
| O.G. (2018) 1080p/ | 2020-10-01 18:43 | - | |
| Obey (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Occult Angel (2018) WEBRip 1080p/ | 2020-10-01 18:38 | - | |
| Occupation (2018) 1080p/ | 2020-10-01 18:39 | - | |
| Ocean's Eight (2018) 1080p/ | 2020-10-01 18:39 | - | |
| Odds Are (2018) WEBRip 720p/ | 2020-10-25 10:35 | - | |
| Off The Menu (2018) 1080p/ | 2020-10-01 18:39 | - | |
| Office Uprising (2018) 1080p/ | 2020-10-01 19:05 | - | |
| Olavi Virta (2018) BluRay 1080p/ | 2020-10-01 19:29 | - | |
| Old Boys (2018) WEBRip 1080p/ | 2020-10-01 19:26 | - | |
| On The Basis Of Sex (2018) BluRay 1080p/ | 2020-10-02 11:45 | - | |
| On The Ropes (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Once Upon a Christmas Miracle (2018)/ | 2020-10-01 19:28 | - | |
| One Last Thing (2018) 720p/ | 2020-10-01 18:51 | - | |
| One Must Fall (2018) WEBRip 1080p/ | 2020-10-01 19:05 | - | |
| Only You (2018) WEBRip 1080p/ | 2020-10-01 17:29 | - | |
| Open 24 Hours (2018) 1080p BluRay/ | 2021-08-01 04:36 | - | |
| Operation Finale (2018) BluRay 1080p/ | 2021-03-04 15:56 | - | |
| Operation Red Sea (2018) BluRay 720p/ | 2020-10-01 17:08 | - | |
| Ophelia (2018) BluRay 1080p/ | 2020-10-01 18:38 | - | |
| Ouija House (2018) 1080p/ | 2020-10-01 17:13 | - | |
| Our House (2018) 1080p BluRay/ | 2020-10-01 19:03 | - | |
| Out Of Blue (2018) 1080p/ | 2019-03-23 10:33 | - | |
| Out Of Many, One (2018) 1080p/ | 2020-10-01 19:10 | - | |
| Outlaw King (2018) 720p/ | 2020-10-01 16:11 | - | |
| Outlawed (2018) WEBRip 1080p/ | 2020-10-01 17:04 | - | |
| Overboard (2018) 1080p/ | 2020-10-01 19:19 | - | |
| Overexposed (2018) 720p/ | 2020-10-01 18:06 | - | |
| Overlord (2018) BluRay 1080p/ | 2020-10-01 17:56 | - | |
| Owned, A Tale Of Two Americas (2018) BluRay 1080p/ | 2020-10-01 16:54 | - | |
| Pacific Rim 2 Uprising (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Painkillers (2018) 1080p/ | 2020-10-01 19:10 | - | |
| Paper Year (2018) WEBRip 1080p/ | 2020-10-01 18:07 | - | |
| Papi Chulo (2018) WEBRip 1080p/ | 2020-10-01 19:32 | - | |
| Papillon (2018) 1080p WEB-DL/ | 2020-10-01 16:11 | - | |
| Paradox (2018) 1080p/ | 2020-10-25 10:34 | - | |
| Party Hype (2018) 1080p/ | 2020-10-01 18:16 | - | |
| Paskal (2018) 1080p/ | 2020-10-01 17:37 | - | |
| Paterno (2018) 1080p/ | 2020-10-01 17:29 | - | |
| Patient Zero (2018) 1080p/ | 2020-10-01 18:07 | - | |
| Patient Zero (2018) 1080p BluRay/ | 2020-10-01 16:11 | - | |
| Patrick (2018) 1080p/ | 2020-10-01 17:45 | - | |
| Patrick (2018) BluRay 1080p/ | 2020-10-01 16:11 | - | |
| Paul, Apostle Of Christ (2018) BluRay 1080p/ | 2020-10-01 17:20 | - | |
| PawParazzi (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Payday (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| Penance (2018) 1080p/ | 2020-10-01 17:30 | - | |
| Peppermint (2018) 1080p/ | 2020-10-01 16:11 | - | |
| Perception (2018) WEBRip 1080p/ | 2020-10-01 18:34 | - | |
| Perdida (2018) WEBRip 1080p/ | 2020-10-01 16:11 | - | |
| Perfect (2018) WEBRip 1080p/ | 2020-10-01 18:41 | - | |
| Perfect Skin (2018) 1080p/ | 2020-10-01 18:20 | - | |
| Peter Rabbit (2018) 720p/ | 2020-10-01 17:25 | - | |
| Peterloo (2018) BluRay 1080p/ | 2020-10-01 18:18 | - | |
| Pickings (2018) WEBRip 1080p/ | 2020-10-01 17:29 | - | |
| Piercing (2018) BluRay 1080p/ | 2020-10-01 17:43 | - | |
| Pimp (2018) 1080p/ | 2020-10-01 19:13 | - | |
| Pimped (2018) 1080p/ | 2019-02-10 09:25 | - | |
| Pledge (2018) BluRay 1080p/ | 2020-10-01 17:37 | - | |
| Pocketman And Cargoboy (2018) 1080p/ | 2020-10-01 17:24 | - | |
| Point Man (2018) 1080p/ | 2020-10-01 17:59 | - | |
| Polterheist (2018) WEBRip 1080p/ | 2020-10-01 19:00 | - | |
| Pond Life (2018) WEBRip 1080p/ | 2020-10-01 18:16 | - | |
| Poor Boy (2018) 1080p/ | 2020-10-01 16:35 | - | |
| Pope Francis A Man Of His Word (2018) BluRay 1080p/ | 2020-10-02 23:02 | - | |
| Possum (2018) BluRay 1080p/ | 2020-10-01 16:36 | - | |
| Postcards From London (2018) BluRay 1080p/ | 2020-10-01 19:35 | - | |
| Pretty Little Stalker (2018) WEBRip 1080p/ | 2020-10-01 18:18 | - | |
| Primal Rage (2018) BluRay 1080p/ | 2022-09-23 07:15 | - | |
| Principal Koi Suru Watashi Wa Heroine Desu Ka (2018) BluRay 1080p/ | 2020-10-01 16:28 | - | |
| Private Life (2018) 1080p/ | 2020-10-01 18:32 | - | |
| Projekt Antarktis (2018) BluRay 1080p/ | 2020-10-01 17:30 | - | |
| Prospect (2018) BluRay 1080p/ | 2020-10-01 18:17 | - | |
| Proud Mary (2018) 1080p/ | 2020-10-01 16:29 | - | |
| Prowler (2018) WEBRip 1080p/ | 2020-10-01 17:21 | - | |
| Proxy Kill (2018) 1080p/ | 2020-10-01 16:31 | - | |
| Public Disturbance (2018) 1080p/ | 2020-10-01 19:33 | - | |
| Pumpkins (2018) WEBRip 1080p/ | 2020-10-01 17:32 | - | |
| Puppet Master The Littlest Reich (2018) BluRay 1080p/ | 2020-10-01 19:22 | - | |
| Puppy Star Christmas (2018) WEBRip 1080p/ | 2020-10-01 17:55 | - | |
| Puzzle (2018) 1080p/ | 2020-10-01 18:07 | - | |
| Rémi Sans Famille (2018) WEBRip 1080p/ | 2020-10-01 18:17 | - | |
| RBG (2018) BluRay 1080p/ | 2020-10-01 18:02 | - | |
| Rafiki (2018) BluRay 1080p/ | 2020-10-01 16:59 | - | |
| Rampage (2018) 1080p BluRay/ | 2020-10-25 10:26 | - | |
| Ravers (2018) 1080p WEBRip/ | 2020-10-01 18:41 | - | |
| Ray & Liz (2018) BluRay 1080p/ | 2020-10-01 16:57 | - | |
| Ready Player One (2018) 1080p/ | 2020-10-01 17:18 | - | |
| Recall (2018) 1080p/ | 2020-10-01 17:45 | - | |
| Records Collecting Dust II (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Recovery Boys (2018) 1080p/ | 2020-10-01 16:36 | - | |
| Red Army Hooligans (2018) BluRay 1080p/ | 2020-10-01 18:57 | - | |
| Red Joan (2018) BluRay 1080p/ | 2020-10-01 16:36 | - | |
| Red Sparrow (2018) 1080p/ | 2020-10-01 17:02 | - | |
| Redbad - 2018 - WEBRip 1080p/ | 2024-10-10 06:23 | - | |
| Redcon-1 (2018) BluRay 1080p/ | 2020-10-01 17:56 | - | |
| Relentless (2018) 1080p/ | 2020-10-01 18:07 | - | |
| Replicas (2018) BluRay 1080p/ | 2020-10-01 17:56 | - | |
| Reprisal (2018) 1080p/ | 2020-10-01 18:57 | - | |
| Requiem For A Fighter (2018) WEBRip 1080p/ | 2020-10-01 19:27 | - | |
| Resolution Song (2018) 1080p/ | 2020-10-01 18:42 | - | |
| Return Of The Hero (2018) 1080p BluRay/ | 2020-10-01 16:33 | - | |
| Revenge (2018) 720p WEB/ | 2020-10-02 22:57 | - | |
| Revenge Is A Promise (2018) WEBRip 1080p/ | 2020-10-01 16:49 | - | |
| Reversing Roe (2018) 1080p/ | 2020-10-01 16:52 | - | |
| Rich Boy, Rich Girl (2018) WEBRip 1080p/ | 2020-10-01 18:42 | - | |
| Ride (2018) 720p/ | 2020-10-01 16:36 | - | |
| Rideshare (2018) 1080p/ | 2020-10-01 18:58 | - | |
| River Runs Red (2018) 1080p/ | 2020-10-01 16:39 | - | |
| Robbery (2018) WEBRip 1080p/ | 2020-10-01 16:28 | - | |
| Robin Hood The Rebellion (2018) 1080p/ | 2020-10-25 10:23 | - | |
| Robin Watch For Wishes (2018) WEBRip 1080p/ | 2020-10-01 18:38 | - | |
| Robot Planet (2018) 720p/ | 2020-10-01 19:34 | - | |
| Roma (2018) 720p NF WEB-DL/ | 2020-10-01 18:23 | - | |
| Ron White If You Quit Listening, I'll Shut Up (2018) 1080p/ | 2020-10-01 18:33 | - | |
| Rondo (2018) WEBRip 1080p/ | 2020-10-01 18:36 | - | |
| Ronnie Coleman The King (2018) WEBRip 1080p/ | 2020-10-01 16:29 | - | |
| Rootwood (2018) WEBRip 1080p/ | 2020-10-01 17:36 | - | |
| Rosie (2018) WEBRip 1080p/ | 2020-10-01 19:26 | - | |
| Rosy (2018) 1080p/ | 2020-10-01 17:40 | - | |
| Roulez Jeunesse (2018) BluRay 720p/ | 2020-10-01 16:39 | - | |
| Royally Ever After (2018) BluRay 1080p/ | 2020-10-01 18:19 | - | |
| Rudeboy The Story Of Trojan Records (2018) 1080p BluRay/ | 2020-10-01 18:38 | - | |
| Run For The High Country (2018) WEBRip 1080p/ | 2020-10-01 18:55 | - | |
| Running Out Of Time (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| Running for Grace (2018) 1080p/ | 2020-10-01 18:28 | - | |
| Rust (2018) 720p/ | 2020-10-01 17:09 | - | |
| Sadie (2018) 1080p/ | 2020-10-01 19:33 | - | |
| Saint Judy (2018) WEBRip 1080p/ | 2020-10-01 17:09 | - | |
| Saints Rest (2018) WEBRip 1080p/ | 2020-10-02 22:54 | - | |
| Sam And Elvis (2018) 1080p/ | 2020-10-01 16:27 | - | |
| Samson (2018) 1080p/ | 2020-10-01 19:16 | - | |
| Santet (2018) 1080p/ | 2020-10-01 17:46 | - | |
| Sauvage Wild (2018) BluRay 1080p/ | 2020-10-01 18:17 | - | |
| Savage Youth (2018) WEBRip 1080p/ | 2020-10-01 17:39 | - | |
| Saving Flora (2018) BluRay 1080p/ | 2020-10-01 17:32 | - | |
| Saving My Baby (2018) HDTV/ | 2020-10-25 10:24 | - | |
| Say Her Name The Life And Death Of Sandra Bland (2018) WEBRip 1080p/ | 2020-10-01 16:28 | - | |
| Say My Name (2018) WEBRip 1080p/ | 2020-10-01 19:11 | - | |
| Scarborough (2018) WEBRip 1080p/ | 2020-10-01 17:35 | - | |
| Scooby-Doo & Batman the Brave and the Bold (2018)/ | 2020-10-01 18:12 | - | |
| Scorched Earth (2018) 1080p BluRay/ | 2020-10-01 19:07 | - | |
| Screwball (2018) HDRip/ | 2020-10-01 18:28 | - | |
| Searching (2018) WEBRip 1080p/ | 2020-10-01 17:51 | - | |
| Seaside (2018) WEBRip 1080p/ | 2020-10-01 16:27 | - | |
| Second Act (2018) BluRay 1080p/ | 2020-10-01 17:12 | - | |
| Seeds (2018) WEBRip 1080p/ | 2020-10-25 10:35 | - | |
| Selfie From Hell (2018) 1080p/ | 2020-10-01 16:33 | - | |
| Set It Up (2018) 1080p/ | 2020-10-01 17:56 | - | |
| Seven In Heaven (2018) 1080p/ | 2020-10-01 19:14 | - | |
| Sex Weather (2018) 1080p/ | 2020-10-01 16:31 | - | |
| Shadow Fighter (2018) 1080p/ | 2020-10-01 19:13 | - | |
| Shadows On The Road (2018) 1080p/ | 2020-10-01 16:37 | - | |
| Shangri-La Near Extinction (2018) 1080p/ | 2020-10-01 16:32 | - | |
| Sharkwater Extinction (2018) WEBRip 1080p/ | 2020-10-01 16:34 | - | |
| Sharon 1.2.3. (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Shiner (2018) 1080p/ | 2020-10-01 18:20 | - | |
| Shooting In Vain (2018) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| Shopkins Wild (2018) 1080p/ | 2020-10-01 17:20 | - | |
| Show Dogs (2018) 1080p/ | 2020-10-01 18:06 | - | |
| Siberia (2018) BluRay 1080p/ | 2020-12-26 03:07 | - | |
| Sicario Day Of The Soldado (2018) 1080p/ | 2026-01-06 13:39 | - | |
| Sick For Toys (2018) BluRay 1080p/ | 2020-10-01 17:37 | - | |
| Sierra Burgess Is A Loser (2018) 1080p/ | 2020-10-01 17:57 | - | |
| Silencer (2018) BluRay 1080p/ | 2020-10-01 17:23 | - | |
| Sk8 Dawg (2018) WEBRip 1080p/ | 2020-10-01 17:37 | - | |
| Skate Kitchen (2018) 1080p/ | 2020-10-01 18:46 | - | |
| Skateboard Or Die (2018) 1080p/ | 2020-10-01 19:00 | - | |
| Skeletons In The Closet (2018) 1080p/ | 2020-10-01 19:22 | - | |
| Skin (2018) BluRay 1080p/ | 2020-10-01 18:38 | - | |
| Skyscraper (2018) BluRay 1080p/ | 2020-10-01 18:12 | - | |
| Slaughterhouse Rulez (2018) BluRay 1080p/ | 2020-10-01 18:46 | - | |
| Slender Man (2018) BluRay 1080p/ | 2020-10-01 18:42 | - | |
| Slice (2018) 1080p/ | 2020-10-01 18:08 | - | |
| Smoke Screen (2018) 1080p/ | 2020-10-01 18:07 | - | |
| Snake Outta Compton (2018) BluRay 1080p/ | 2020-10-01 18:45 | - | |
| Snapshots (2018) WEBRip 1080p/ | 2020-10-01 16:33 | - | |
| Snowbound (2018) HDRip/ | 2020-10-01 19:33 | - | |
| Soft Matter (2018) HDRip/ | 2020-10-01 16:53 | - | |
| Solis (2018) BluRay 1080p/ | 2020-10-01 16:35 | - | |
| Solo A Star Wars Story (2018) BluRay 1080p/ | 2020-10-01 18:20 | - | |
| Somnium (2018) 1080p/ | 2020-10-01 17:54 | - | |
| Song Of Back And Neck (2018) WEBRip 1080p/ | 2020-10-01 19:31 | - | |
| Sorry For Your Loss (2018) WEBRip 1080p/ | 2020-10-01 18:13 | - | |
| Sorry To Bother You (2018) BluRay 1080p/ | 2020-10-01 18:45 | - | |
| Soul To Keep (2018) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Speed Kills (2018) 1080p/ | 2020-10-01 19:10 | - | |
| Spell (2018) WEBRip 1080p/ | 2020-10-01 18:32 | - | |
| Spider-Man Into The Spider Versee (2018) 1080p/ | 2020-10-01 18:57 | - | |
| Spinning Man (2018) 1080p/ | 2020-10-01 16:54 | - | |
| Sprinter (2018) WEBRip 1080p/ | 2020-10-01 17:50 | - | |
| St. Agatha (2018) BluRay 1080p/ | 2020-10-01 17:38 | - | |
| Stalked By A Reality Star (2018) 720p/ | 2020-10-01 19:04 | - | |
| Stalked By MY Doctor Patient's Revenge (2018) 1080p/ | 2020-10-01 16:30 | - | |
| Stan & Ollie (2018) BluRay 1080p/ | 2020-10-01 18:34 | - | |
| Starfish (2018) WEBRip 1080p/ | 2020-10-01 16:30 | - | |
| Stargate Origins Catherine (2018) 1080p/ | 2020-10-01 16:55 | - | |
| State Like Sleep (2018) 1080p/ | 2020-10-01 17:24 | - | |
| Status Update (2018) BluRay 1080p/ | 2020-10-01 16:29 | - | |
| Stella's Last Weekend (2018) 1080p/ | 2020-10-01 18:54 | - | |
| Step Sisters (2018) HDRip/ | 2020-10-01 16:29 | - | |
| Still (2018) 1080p/ | 2020-10-01 17:25 | - | |
| Stillwater (2018) WEBRip 1080p/ | 2020-10-01 19:19 | - | |
| Stockholm (2018) WEBRip 1080p/ | 2020-10-01 16:35 | - | |
| Straight Up Kentucky Bourbon (2018) 1080p/ | 2020-10-01 16:33 | - | |
| Strange Nature (2018) BluRay 1080p/ | 2020-10-01 19:17 | - | |
| Street Dreams - Los Angeles (2018) WEBRip 1080p/ | 2020-10-01 18:08 | - | |
| Stretch Marks (2018) 1080p/ | 2020-10-01 17:21 | - | |
| Student Athlete (2018) 1080p/ | 2020-10-01 18:57 | - | |
| Suicide Squad Hell to Pay (2018)/ | 2020-10-01 18:03 | - | |
| Summer '03 (2018) 1080p/ | 2020-10-01 17:42 | - | |
| Summer Of '67 (2018) 720p/ | 2020-10-01 17:10 | - | |
| Summer Of 84 (2018) 1080p/ | 2020-10-01 18:08 | - | |
| SuperFly (2018) 1080p/ | 2020-10-01 18:22 | - | |
| SuperGrid (2018) 720p/ | 2020-10-01 17:51 | - | |
| Super Troopers 2 (2018) 1080p/ | 2020-10-25 10:33 | - | |
| Supercon (2018) 1080p/ | 2020-10-25 10:34 | - | |
| Support The Girls (2018) 1080p/ | 2020-10-25 10:31 | - | |
| Surviving Christmas With The Relatives (2018) WEBRip 1080p/ | 2020-10-01 17:42 | - | |
| Suspiria (2018) 1080p BluRay/ | 2020-10-01 17:34 | - | |
| Sweeney Killing Sweeney (2018) WEBRip 1080p/ | 2020-10-01 18:02 | - | |
| Swinging Safari (2018) BluRay 1080p/ | 2020-10-01 18:45 | - | |
| Sylvia (2018) WEBRip 1080p/ | 2020-10-01 18:07 | - | |
| Tag (2018) BluRay 1080p/ | 2020-10-01 19:28 | - | |
| Take The Ball, Pass The Ball (2018) BluRay 1080p/ | 2020-10-01 17:07 | - | |
| Take Your Pills (2018) WEBRip 720p/ | 2020-10-02 22:45 | - | |
| Tales From The Hood 2 (2018) BluRay 1080p/ | 2020-10-01 18:37 | - | |
| Tau (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Teen Spirit (2018) WEBRip 1080p/ | 2020-10-01 16:29 | - | |
| Tell It To The Bees (2018) 1080p/ | 2020-10-01 16:51 | - | |
| Tempus Tormentum (2018) 1080p BluRay/ | 2020-10-01 16:31 | - | |
| Terminal (2018) 1080p/ | 2020-10-02 23:03 | - | |
| Th'dread Rattlin' (2018) 1080p/ | 2020-10-01 19:37 | - | |
| The 11th Patient (2018) WEBRip 1080p/ | 2020-10-01 17:30 | - | |
| The 12th Man (2018) HDRip XviD AC3 EVO/ | 2020-10-01 16:37 | - | |
| The 15 17 To Paris (2018) 1080p/ | 2020-10-01 16:30 | - | |
| The Actor (2018) 1080p/ | 2020-10-01 18:41 | - | |
| The After Party (2018) 1080p/ | 2020-10-25 10:28 | - | |
| The American Meme (2018) WEBRip 1080p/ | 2020-10-01 19:18 | - | |
| The Angel (2018) 1080p/ | 2020-10-25 10:22 | - | |
| The Appearance (2018) 720p/ | 2020-10-25 10:31 | - | |
| The Ashram (2018) 1080p/ | 2020-10-02 11:45 | - | |
| The Assassin's Code (2018) 1080p/ | 2020-10-01 19:36 | - | |
| The Axiom (2018) WEBRip 1080p/ | 2021-10-02 08:17 | - | |
| The BBQ (2018) HDRip/ | 2020-10-01 19:36 | - | |
| The Bad Man (2018) 720p/ | 2020-10-01 19:17 | - | |
| The Bad Nun (2018) DVDRip/ | 2020-10-01 18:13 | - | |
| The Ballad Of Buster Scruggs (2018) 1080p/ | 2021-01-01 15:57 | - | |
| The Basement (2018) BluRay 1080p/ | 2020-10-01 17:58 | - | |
| The Belly Of The Whale (2018) WEBRip 1080p/ | 2020-10-01 17:29 | - | |
| The Biggest Little Farm (2018) BluRay 1080p/ | 2020-10-01 18:05 | - | |
| The Bits Of Yesterday (2018) WEBRip 1080p/ | 2020-10-01 18:56 | - | |
| The Boat (2018) BluRay 1080p/ | 2020-10-01 17:32 | - | |
| The Bombing (2018) 1080p/ | 2020-10-01 17:14 | - | |
| The Bouncer (2018) 1080p BluRay/ | 2020-10-01 16:38 | - | |
| The Breaker Upperers (2018) BluRay 1080p/ | 2020-10-01 17:44 | - | |
| The Browsing Effect (2018) WEBRip 1080p/ | 2020-10-01 18:07 | - | |
| The Burial Of Kojo (2018) WEBRip 1080p/ | 2020-10-02 22:53 | - | |
| The Butchering (2018) HDRip/ | 2020-10-01 18:13 | - | |
| The Cabin (2018) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| The Care They've Earned (2018) WEBRip 1080p/ | 2020-10-01 18:56 | - | |
| The Catcher Was A Spy (2018) 1080p/ | 2020-10-01 18:59 | - | |
| The Chaperone (2018) WEBRip 1080p/ | 2020-10-02 22:59 | - | |
| The Christmas Contract (2018) 1080p/ | 2020-10-01 19:06 | - | |
| The Cleaning Lady (2018) WEBRip 1080p/ | 2020-10-01 19:01 | - | |
| The Clovehitch Killer (2018) BluRay 1080p/ | 2020-10-01 19:02 | - | |
| The Cloverfield Paradox (2018) 1080p BluRay/ | 2020-10-01 18:00 | - | |
| The Commuter (2018) 1080p/ | 2020-10-02 22:58 | - | |
| The Competition (2018) BluRay 1080p/ | 2020-10-01 18:57 | - | |
| The Con Is On (2018) BluRay 1080p/ | 2020-10-01 18:15 | - | |
| The Conductor (2018) BluRay 1080p/ | 2020-10-01 16:37 | - | |
| The Convent (2018) BluRay 1080p/ | 2020-10-01 16:31 | - | |
| The Cured (2018)/ | 2018-05-18 12:05 | - | |
| The Curse Of Lilith Ratchet (2018) BluRay 1080p/ | 2020-10-01 18:10 | - | |
| The Cursed (2018) BluRay 1080p/ | 2020-10-01 19:15 | - | |
| The D Train (2015) 1080p BluRay/ | 2018-05-06 11:22 | - | |
| The Dark (2018) 1080p/ | 2020-10-01 19:32 | - | |
| The Darkest Minds (2018) 1080p/ | 2020-10-01 16:40 | - | |
| The Darkest Minds (2018) BluRay 1080p/ | 2020-10-01 19:06 | - | |
| The Dead And The Damned 3 Ravaged (2018) BluRay 720p/ | 2020-10-01 18:18 | - | |
| The Dead Center (2018) BluRay 1080p/ | 2020-10-01 16:27 | - | |
| The Death And Life Of John F. Donovan (2018) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| The Debt Collector (2018) BluRay 1080p/ | 2020-10-01 18:45 | - | |
| The Demonologist (2018) 1080p/ | 2020-10-01 18:22 | - | |
| The Devil's Doorway (2018) 1080p BluRay/ | 2020-10-01 19:33 | - | |
| The Devil We Know (2018) 1080p/ | 2020-10-01 18:55 | - | |
| The Dig (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| The Dip Run (2018) WEBRip 1080p/ | 2020-10-01 16:35 | - | |
| The Domestics (2018) 1080p/ | 2020-10-25 10:29 | - | |
| The Dwarves Of Demrel (2018) 1080p/ | 2020-10-01 17:10 | - | |
| The Equalizer 2 (2018) BluRay 1080p/ | 2020-10-01 16:38 | - | |
| The Escape (2018) 1080p/ | 2020-10-01 16:33 | - | |
| The Escape of Prisoner 614 (2018) 1080p/ | 2020-10-01 16:30 | - | |
| The Etruscan Smile (2018) BluRay 1080p/ | 2020-10-01 18:12 | - | |
| The Extraordinary Journey Of The Fakir (2018) BluRay 1080p/ | 2020-10-01 19:10 | - | |
| The Famous Five And The Valley Of Dinosaurs (2018) BluRay 1080p/ | 2020-10-01 18:02 | - | |
| The Fare (2018) WEBRip 1080p/ | 2020-10-01 16:31 | - | |
| The Favourite (2018) BluRay 1080p/ | 2020-10-01 17:29 | - | |
| The Festival (2018) 1080p BluRay/ | 2020-10-01 18:34 | - | |
| The Fight (2018) WEBRip 1080p/ | 2020-10-01 16:32 | - | |
| The Final Wish (2018) BluRay 1080p/ | 2020-10-25 10:33 | - | |
| The First Purge (2018) 1080p/ | 2020-10-01 18:39 | - | |
| The Fitzroy (2018) WEBRip 1080p/ | 2020-10-01 18:15 | - | |
| The Front Runner (2018) BluRay 1080p/ | 2020-10-01 19:30 | - | |
| The Game Changers (2018) WEBRip 1080p/ | 2020-10-01 16:27 | - | |
| The Gateway (2018) 1080p BluRay/ | 2020-10-01 19:00 | - | |
| The Ghost Beyond (2018) WEBRip 1080p/ | 2020-10-01 16:34 | - | |
| The Girl in the Spiders Web (2018 ) 1080p/ | 2020-10-02 23:03 | - | |
| The Grizzlies (2018) WEBRip 1080p/ | 2020-10-01 17:35 | - | |
| The Guard Of Auschwitz (2018) WEBRip 1080p/ | 2020-10-01 19:00 | - | |
| The Guardian Angel (2018) 1080p/ | 2020-10-01 16:58 | - | |
| The Guernsey Literary And Potato Peel Pie Society (2018) BluRay 1080p/ | 2020-10-01 17:54 | - | |
| The Guilty (2018) 720p BluRay Dual Audio/ | 2020-10-02 22:57 | - | |
| The Happy Prince (2018) 720p/ | 2020-10-01 19:36 | - | |
| The Happytime Murders (2018) 1080p BluRay/ | 2020-10-01 16:30 | - | |
| The Hate U Give (2018) 1080p/ | 2020-10-01 19:33 | - | |
| The Haunted (2018) WEBRip 1080p/ | 2020-10-01 16:36 | - | |
| The Head Hunter (2018) BluRay 1080p/ | 2020-10-01 18:30 | - | |
| The Hitman Agency (2018) 1080p/ | 2020-10-01 18:58 | - | |
| The Hoard (2018) WEBRip 1080p/ | 2020-10-01 19:27 | - | |
| The Holiday Calendar (2018) 1080p/ | 2020-10-01 19:03 | - | |
| The Holy Fail (2018) WEBRip 1080p/ | 2020-10-01 17:29 | - | |
| The House Of Violent Desire (2018) 1080p/ | 2020-10-01 18:57 | - | |
| The House That Jack Built (2018) WEBDL 1080p Sub/ | 2020-10-01 17:15 | - | |
| The House with a Clock in Its Walls (2018) 1080p BluRay/ | 2020-10-01 19:35 | - | |
| The Hummingbird Project (2018) BluRay 1080p/ | 2020-10-01 18:23 | - | |
| The Hurricane Heist (2018) BluRay 1080p [Telugu + Tam + Hin + Eng]/ | 2020-10-01 17:42 | - | |
| The Immortal Wars (2018) BluRay 1080p/ | 2020-10-01 19:35 | - | |
| The Incantation (2018) 1080p/ | 2020-10-01 17:29 | - | |
| The Intent 2 The Come Up (2018) BluRay 1080p/ | 2020-10-01 17:25 | - | |
| The Iron Orchard (2018) WEBRip 1080p/ | 2020-10-01 18:53 | - | |
| The Joke Thief (2018) 1080p/ | 2020-10-01 17:22 | - | |
| The Jonah Movie (2018) WEBRip 1080p/ | 2020-10-01 18:10 | - | |
| The Jurassic Games (2018)/ | 2020-10-25 10:28 | - | |
| The Keeper (2018) BluRay 1080p/ | 2020-10-01 17:34 | - | |
| The Kindergarten Teacher (2018) WEBRip 1080p/ | 2020-10-01 16:30 | - | |
| The Kissing Booth (2018) 1080p/ | 2020-10-01 18:18 | - | |
| The Lake Vampire (2018) WEBRip 1080p/ | 2020-10-01 17:17 | - | |
| The Land Of Steady Habits (2018) 1080p/ | 2020-10-01 17:41 | - | |
| The Last Man (2018) BluRay 1080p/ | 2020-10-01 18:23 | - | |
| The Last Sharknado Its About Time (2018) 720p BluRay/ | 2020-10-01 18:32 | - | |
| The Last Witness (2018) 1080p/ | 2020-10-01 18:59 | - | |
| The Legacy Of A Whitetail Deer Hunter (2018) 1080p/ | 2020-10-01 18:28 | - | |
| The Legend Of Cocaine Island (2018) WEBRip 1080p/ | 2020-10-01 18:29 | - | |
| The Legend Of Halloween Jack (2018) 1080p/ | 2020-10-01 17:28 | - | |
| The Lie (2018) 1080p WEBRip/ | 2020-12-03 10:16 | - | |
| The Little Mermaid (2018) 1080p/ | 2020-10-01 16:35 | - | |
| The Little Stranger (2018) BluRay 1080p/ | 2020-10-01 16:38 | - | |
| The Little Witch (2018) WEBRip 1080p/ | 2020-10-01 16:28 | - | |
| The Long Dumb Road (2018) BluRay 1080p/ | 2020-10-01 18:17 | - | |
| The Lotus (2018) 1080p/ | 2020-10-01 18:05 | - | |
| The Lucky Man (2018) 1080p WEB/ | 2020-10-01 16:28 | - | |
| The Lullaby (2018) 1080p/ | 2020-10-01 17:49 | - | |
| The Maestro (2018) WEBRip 1080p/ | 2020-10-01 18:43 | - | |
| The Man Who Killed Don Quixote (2018) BDRip/ | 2020-10-02 22:59 | - | |
| The Man Who Stole Banksy (2018) 1080p/ | 2020-10-02 22:56 | - | |
| The Manor (2018) 720p WEB/ | 2020-10-01 17:37 | - | |
| The Marine 6 Close Quarters (2018) BluRay 1080p/ | 2020-10-01 16:28 | - | |
| The Martyr Maker (2018) WEBRip 1080p/ | 2020-10-01 16:27 | - | |
| The Meg (2018) BluRay 1080p/ | 2020-10-01 17:18 | - | |
| The Mercy (2018) BluRay 1080p/ | 2020-10-01 18:26 | - | |
| The Merger (2018) BluRay 1080p/ | 2020-10-25 10:36 | - | |
| The Mermaid Lake Of The Dead (2018) BluRay 1080p/ | 2020-10-01 16:30 | - | |
| The Midwife's Deception (2018) 720p/ | 2020-10-01 16:35 | - | |
| The Midwife's Deception (2018) 1080p/ | 2020-10-02 23:00 | - | |
| The Minds Of Men (2018) 1080p/ | 2020-10-01 17:50 | - | |
| The Miracle Season (2018) BluRay 1080p/ | 2020-10-01 17:53 | - | |
| The Miseducation Of Cameron Post (2018) BluRay 1080p/ | 2020-10-01 18:40 | - | |
| The More You Ignore Me (2018) WEBRip 1080p/ | 2020-10-01 18:24 | - | |
| The Mountain (2018) WEBRip 1080p/ | 2020-10-01 17:04 | - | |
| The Mule (2018) BluRay 1080p/ | 2020-10-01 17:30 | - | |
| The Music Box (2018) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| The Negotiation (2018) BluRay 720p/ | 2020-10-25 10:33 | - | |
| The Neighbor (2018) BluRay 1080p/ | 2020-10-01 18:11 | - | |
| The New Romantic (2018) 1080p/ | 2020-10-01 18:32 | - | |
| The Night Comes For Us (2018) 1080p/ | 2020-10-02 23:01 | - | |
| The Night Sitter (2018) WEBRip 1080p/ | 2020-10-02 22:54 | - | |
| The Nightingale (2018) WEBRip 1080p/ | 2020-10-01 18:14 | - | |
| The Nightmare Gallery (2018) WEBRip 1080p/ | 2020-10-01 18:12 | - | |
| The Nightshifter (2018) SUBBED 1080p/ | 2020-10-01 16:33 | - | |
| The Ninth Passenger (2018) 1080p/ | 2020-10-01 17:23 | - | |
| The Nun (2018) 720p/ | 2020-12-28 11:53 | - | |
| The Nutcracker And The Four Realms (2018) BluRay 1080p/ | 2020-10-01 16:31 | - | |
| The Oath (2018) 1080p/ | 2020-10-01 19:33 | - | |
| The Odds (2018) WEBRip 1080p/ | 2020-10-02 22:55 | - | |
| The Old Man & The Gun (2018) BluRay 1080p/ | 2020-10-01 16:36 | - | |
| The Open House (2018) 720p/ | 2020-10-01 18:16 | - | |
| The Other Side Of The Wind (2018) 1080p/ | 2020-10-01 19:31 | - | |
| The Outer Wild (2018) 1080p/ | 2020-10-01 19:32 | - | |
| The Outsider (2018) 1080p/ | 2020-10-01 16:39 | - | |
| The Package (2018) WEBRip 1080p/ | 2020-10-01 18:17 | - | |
| The Padre (2018) 1080p/ | 2020-10-01 18:40 | - | |
| The Panama Papers (2018) 1080p/ | 2020-10-01 16:29 | - | |
| The Parting Glass (2018) WEBRip 1080p/ | 2020-10-01 18:55 | - | |
| The Party's Just Beginning (2018) 1080p/ | 2020-10-01 19:15 | - | |
| The Pastor And The Pro (2018) 1080p/ | 2020-10-01 16:28 | - | |
| The Perfection (2018) WEBRip 1080p/ | 2020-10-02 22:55 | - | |
| The Pinch (2018) 1080p/ | 2020-10-01 18:08 | - | |
| The Possession Of Hannah Grace (2018) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| The Post (2018) DVDScr/ | 2020-10-01 17:33 | - | |
| The Predator (2018) BluRay 1080p/ | 2020-10-01 18:13 | - | |
| The Pretenders (2018) WEBRip 1080p/ | 2020-10-01 19:09 | - | |
| The Price For Silence (2018) WEBRip 1080p/ | 2020-10-01 18:13 | - | |
| The Professor (2018) BluRay 1080p/ | 2020-10-01 19:31 | - | |
| The Public (2018) BluRay 1080p/ | 2020-10-01 16:38 | - | |
| The Purity Of Vengeance (2018) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| The Quake (2018) BluRay 1080p/ | 2020-10-01 18:52 | - | |
| The Rainbow Bridge Motel (2018) WEBRip 1080p/ | 2020-10-01 16:31 | - | |
| The Rake (2018) 1080p/ | 2020-10-01 16:27 | - | |
| The Ranger (2018) 1080p/ | 2020-10-01 19:36 | - | |
| The Redeemed And The Dominant Fittest On Earth (2018) 720p/ | 2020-10-01 18:37 | - | |
| The Redeeming (2018) 720p/ | 2020-10-01 17:45 | - | |
| The Revenge Of Robert The Doll (2018) 1080p/ | 2020-10-01 18:18 | - | |
| The Riot Act (2018) WEBRip 1080p/ | 2020-10-01 17:54 | - | |
| The Rocket (2018) HDRip/ | 2020-10-01 18:21 | - | |
| The Scorpion King Book Of Souls (2018) BluRay 1080p/ | 2020-10-01 17:53 | - | |
| The Scythian (2018) BluRay 1080p/ | 2020-10-01 18:15 | - | |
| The Seagull (2018) BluRay 1080p/ | 2020-10-01 16:37 | - | |
| The Second (2018) 1080p/ | 2020-10-01 18:03 | - | |
| The Second Coming Of Christ(2018)/ | 2020-10-01 18:23 | - | |
| The Sentence (2018) 1080p/ | 2020-10-01 19:28 | - | |
| The Seven Deadly Sins - Prisoners of the Sky - 2018/ | 2020-10-01 18:38 | - | |
| The Sisters Brothers (2018) BluRay 1080p/ | 2020-10-01 18:38 | - | |
| The Snarling (2018) WEBRip 1080p/ | 2020-10-01 18:26 | - | |
| The Spy Who Dumped Me (2018) BluRay 1080p/ | 2020-10-01 16:27 | - | |
| The Standoff At Sparrow Creek (2018) BluRay 1080p/ | 2020-10-01 16:31 | - | |
| The Stolen Princess Ruslan And Ludmila (2018) BluRay 1080p/ | 2020-10-01 18:06 | - | |
| The Strangers Prey At Night (2018) 1080p/ | 2020-10-01 17:54 | - | |
| The Strangers Prey at Night (2018) 720p/ | 2020-10-01 18:37 | - | |
| The Surrounding Game (2018) 1080p/ | 2020-10-01 18:10 | - | |
| The Sweetheart (2018) WEBRip 1080p/ | 2020-10-01 16:31 | - | |
| The System (2018) 1080p/ | 2020-10-01 16:38 | - | |
| The Tale (2018) 720p/ | 2018-05-29 10:16 | - | |
| The Texture Of Falling (2018) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| The Thinning New World Order (2018) 1080p/ | 2020-10-01 18:16 | - | |
| The Titan (2018) 1080p/ | 2020-10-01 18:23 | - | |
| The Toxic Avenger The Musical (2018) 1080p/ | 2020-10-01 17:56 | - | |
| The Toybox (2018) BluRay 1080p/ | 2020-10-01 18:03 | - | |
| The Truth About Killer Robots (2018) WEBRip 1080p/ | 2020-10-01 19:12 | - | |
| The Unity Of Heroes (2018) BluRay 1080p/ | 2020-10-01 16:34 | - | |
| The Unthinkable (2018) 1080p BluRay/ | 2021-05-05 05:14 | - | |
| The Vanished (2018) 1080p/ | 2020-10-01 18:53 | - | |
| The Vanishing (2018) BluRay 1080p/ | 2020-10-25 10:31 | - | |
| The Vice (2018) DVDSCR/ | 2020-10-01 18:42 | - | |
| The Wedding Guest (2018) WEBRip 1080p/ | 2020-10-01 18:46 | - | |
| The Week Of (2018) 1080p/ | 2020-10-02 22:59 | - | |
| The White Crow (2018) BluRay 1080p/ | 2020-10-01 18:15 | - | |
| The Wind (2018) WEBRip 1080p/ | 2020-10-01 18:19 | - | |
| The Witch Files (2018) 1080p/ | 2020-10-01 18:08 | - | |
| The Witch In The Window (2018) 720p/ | 2020-10-01 16:38 | - | |
| The Wrong Todd (2018) WEBRip 1080p/ | 2020-10-01 18:01 | - | |
| There Is No Place Like Home (2018) BluRay 1080p/ | 2020-10-01 17:29 | - | |
| The wrong daughter (2018) 480p hdtv/ | 2020-10-01 17:50 | - | |
| They'll Love Me When I'm Dead (2018) 1080p/ | 2020-10-01 17:12 | - | |
| They Remain (2018) 1080p/ | 2020-10-01 19:08 | - | |
| They Shall Not Grow Old (2018) BluRay 1080p/ | 2020-10-01 16:32 | - | |
| Thousand Yard Stare (2018) BluRay 1080p/ | 2020-10-01 19:27 | - | |
| Three Identical Strangers (2018) BluRay 1080p/ | 2020-10-01 18:44 | - | |
| Three Worlds (2018) 1080p/ | 2020-10-01 18:16 | - | |
| Thriller (2018) WEBRip 1080p/ | 2020-10-01 16:30 | - | |
| Through Black Spruce - 2018 - 1080p BluRay/ | 2020-10-01 19:33 | - | |
| Thunder Road (2018) BluRay 1080p/ | 2020-10-01 19:22 | - | |
| Tiger (2018) 1080p/ | 2020-10-01 17:24 | - | |
| Time Freak (2018) BluRay 1080p/ | 2020-10-01 16:36 | - | |
| Time Jumpers (2018) 1080p/ | 2020-10-01 16:39 | - | |
| Tinker' (2018) WEBRip 1080p/ | 2020-10-01 17:28 | - | |
| To All The Boys I've Loved Before (2018) 1080p/ | 2020-10-01 17:24 | - | |
| To Catch A Serial Killer With Trevor McDonald (2018) 1080p/ | 2020-10-01 19:35 | - | |
| Tomb Invader (2018) 1080p BluRay/ | 2020-10-01 19:01 | - | |
| Tomb Raider (2018) 1080p/ | 2020-10-01 19:17 | - | |
| Tommy Battles The Silver Sea Dragon (2018) WEBRip 1080p/ | 2020-10-01 16:32 | - | |
| Too Macabre The Making Of Elvira, Mistress Of The Dark (2018) BluRay 1080p/ | 2020-10-01 17:23 | - | |
| Torvill & Dean (2018) BluRay 1080p/ | 2020-10-01 17:41 | - | |
| Toy Gun (2018) 1080p/ | 2020-10-01 19:27 | - | |
| Traffik (2018) BluRay 1080p/ | 2020-10-01 16:31 | - | |
| TransMilitary (2018) WEBRip 1080p/ | 2020-10-01 18:15 | - | |
| Transition (2018) WEBRip 1080p/ | 2020-10-01 16:30 | - | |
| Trashsploitation (2018) 1080p/ | 2020-10-01 17:42 | - | |
| Trauma Is A Time Machine (2018) WEBRip 1080p/ | 2020-10-01 19:19 | - | |
| Tremors A Cold Day In Hell (2018) BluRay 1080p/ | 2020-10-01 18:12 | - | |
| Trespassers (2018) WEBRip 1080p/ | 2020-10-01 18:03 | - | |
| Triassic World (2018) BluRay 1080p/ | 2020-10-01 18:57 | - | |
| Trico Tri Happy Halloween (2018) WEBRip 1080p/ | 2020-10-01 17:06 | - | |
| Troy The Resurrection Of Aeneas (2018) 1080p/ | 2020-10-01 16:29 | - | |
| Truth Or Dare (2018) 1080p/ | 2020-10-01 18:49 | - | |
| Tucked (2018) WEBRip 1080p/ | 2020-10-01 18:09 | - | |
| Tully (2018) BluRay 1080p/ | 2020-10-01 18:38 | - | |
| Twisted (2018) 1080p/ | 2020-10-01 19:26 | - | |
| Two Graves (2018) 1080p/ | 2020-10-01 17:32 | - | |
| Tyrel (2018) BluRay 1080p/ | 2020-10-01 19:33 | - | |
| UFO (2018) 1080p/ | 2020-10-01 17:45 | - | |
| Ulysses A Dark Odyssey (2018) 1080p BluRay/ | 2020-10-01 19:13 | - | |
| Unbridled (2018) WEBRip 1080p/ | 2020-10-02 22:58 | - | |
| Unbroken Path To Redemption (2018) BluRay 1080p/ | 2020-10-01 19:36 | - | |
| Uncle Drew (2018) 1080p/ | 2020-10-01 16:51 | - | |
| Under The Eiffel Tower (2018) WEBRip 1080p/ | 2020-10-01 18:41 | - | |
| Under The Silver Lake (2018) WEBRip 1080p/ | 2020-10-01 18:09 | - | |
| Understanding The Opioid Epidemic (2018) 1080p/ | 2020-10-01 18:33 | - | |
| Unfriended Dark Web (2018) BluRay 1080p/ | 2020-10-01 16:37 | - | |
| Unintended (2018) WEBRip 1080p/ | 2020-10-01 18:23 | - | |
| Union (2018) WEBRip 720p/ | 2020-10-01 19:02 | - | |
| United Skates (2018) 1080p/ | 2020-10-01 17:29 | - | |
| Unlovable (2018) 1080p/ | 2020-10-01 19:11 | - | |
| Unsane (2018) 1080p/ | 2020-10-01 16:38 | - | |
| Unwritten (2018) WEBRip 1080p/ | 2020-10-01 18:41 | - | |
| Upgrade (2018) 1080p/ | 2020-10-01 16:30 | - | |
| Urban Country (2018) BluRay 1080p/ | 2020-10-01 19:09 | - | |
| VS. (2018) 1080p/ | 2020-10-01 18:18 | - | |
| Valentine DayZ (2018) 1080p/ | 2020-10-01 18:46 | - | |
| Venom (2018) 1080p 10bit/ | 2021-02-06 06:12 | - | |
| Vice (2018) BluRay 1080p/ | 2020-10-01 17:26 | - | |
| Viking Destiny (2018) BluRay 1080p/ | 2020-10-01 18:22 | - | |
| Viper Club (2018) 1080p/ | 2020-10-01 18:06 | - | |
| Vir Das Losing It (2018) 1080p/ | 2020-10-01 16:31 | - | |
| Virgin Cheerleaders In Chains (2018) WEBRip 1080p/ | 2020-10-01 17:29 | - | |
| Virus Of The Dead (2018) 1080p/ | 2020-10-01 18:18 | - | |
| Vita & Virginia (2018) BluRay 1080p/ | 2020-10-01 16:39 | - | |
| Voldemort Origins of the Heir (2018) 1080p/ | 2020-10-01 18:49 | - | |
| Vox Lux (2018) BluRay 1080p/ | 2020-10-01 17:28 | - | |
| Vultures (2018) BluRay 1080p/ | 2020-10-01 17:51 | - | |
| Waiting For The Miracle To Come (2018) WEBRip 1080p/ | 2020-10-01 17:39 | - | |
| Wake (2018) WEBRip 1080p/ | 2020-10-01 18:38 | - | |
| Walk Like A Panther (2018) 720p/ | 2020-10-01 19:37 | - | |
| Wanderland (2018) 1080p/ | 2020-10-01 19:26 | - | |
| Warfighter (2018) WEBRip 1080p/ | 2020-10-01 16:38 | - | |
| Warning Shot (2018) BluRay 1080p/ | 2020-10-01 19:15 | - | |
| Warrior Pride (2018) WEBRip 1080p/ | 2020-10-01 16:30 | - | |
| Wasted Talent (2018) 1080p/ | 2020-10-01 18:06 | - | |
| Wastelander (2018) HDRip/ | 2020-10-01 18:17 | - | |
| Watch If You Dare (2018) 1080p/ | 2020-10-01 19:20 | - | |
| We Are Boats (2018) WEBRip 1080p/ | 2020-10-01 19:18 | - | |
| We Belong Together (2018) 1080p NF/ | 2020-10-01 17:56 | - | |
| We The Animals (2018) BluRay 1080p/ | 2020-10-01 18:24 | - | |
| Webcast (2018) WEBRip 1080p/ | 2020-10-01 18:39 | - | |
| Weight (2018) 1080p/ | 2020-10-01 16:36 | - | |
| Welcome Home (2018) BluRay 1080p/ | 2020-10-01 18:23 | - | |
| Welcome The Stranger (2018) 1080p/ | 2020-10-01 19:34 | - | |
| Welcome To Curiosity (2018) BluRay 1080p/ | 2020-10-01 18:31 | - | |
| Welcome To Hell (2018) 1080p/ | 2020-10-01 18:10 | - | |
| Welcome To Marwen (2018) BluRay 1080p/ | 2020-10-01 16:31 | - | |
| Welcome To Mercy (2018) 1080p/ | 2020-10-01 16:36 | - | |
| Werewolf (2018) 720p/ | 2020-10-01 18:10 | - | |
| What Death Leaves Behind (2018) WEBRip 1080p/ | 2020-10-01 18:38 | - | |
| What Keeps You Alive (2018) BluRay 1080p/ | 2020-10-01 16:56 | - | |
| What Still Remains (2018) 720p/ | 2020-10-01 16:50 | - | |
| What They Had (2018) 1080p/ | 2020-10-01 19:38 | - | |
| When Jeff Tried To Save The World (2018) 1080p/ | 2020-10-01 19:04 | - | |
| When We First Met (2018) 1080p/ | 2020-10-01 18:40 | - | |
| Where Hands Touch (2018) 1080p/ | 2020-10-01 19:33 | - | |
| White Boy Rick (2018) 1080p BluRay/ | 2020-10-01 19:30 | - | |
| White Chamber (2018) WEBRip 1080p/ | 2020-10-25 10:34 | - | |
| White Fang (2018) BluRay 1080p/ | 2020-10-01 18:44 | - | |
| White Orchid (2018) 1080p/ | 2020-10-01 19:31 | - | |
| White Rabbit (2018) WEBRip 1080p/ | 2020-10-01 18:08 | - | |
| Who We Are Now (2018)/ | 2020-10-01 18:11 | - | |
| Why Dont You Just Die (2018) 720p BluRay/ | 2020-11-30 12:18 | - | |
| Why Hide (2018) 1080p/ | 2020-10-25 10:32 | - | |
| Wicked Witches (2018) WEBRip 1080p/ | 2020-10-01 18:01 | - | |
| Widows (2018) BluRay 1080p/ | 2020-10-01 19:13 | - | |
| Wild Honey Pie (2018) 1080p/ | 2020-10-01 16:50 | - | |
| Wild Rose (2018) BluRay 1080p/ | 2020-10-01 17:25 | - | |
| Wildlife (2018) 1080p/ | 2020-10-01 16:31 | - | |
| Wildling (2018) BluRay 1080p/ | 2020-10-01 17:15 | - | |
| Winchester (2018) 1080p/ | 2020-10-01 16:37 | - | |
| Winters Dream (2018) 720p/ | 2020-10-01 18:38 | - | |
| Winterskin (2018) WEBRip 1080p/ | 2020-10-02 22:58 | - | |
| Woman At War (2018) BluRay 1080p/ | 2020-10-25 10:24 | - | |
| Women and Sometimes Men (2018) 1080p/ | 2020-10-01 17:43 | - | |
| Wont You Be My Neighbor (2018) 720p/ | 2020-10-01 18:24 | - | |
| Working Class Boy (2018) BluRay 1080p/ | 2020-10-01 18:37 | - | |
| Worth (2018) WEBRip 1080p/ | 2020-10-01 16:52 | - | |
| Wretch (2018) WEBRip 1080p/ | 2020-10-01 18:39 | - | |
| Wuff (2018) BluRay 1080p/ | 2020-10-01 16:30 | - | |
| Wunderland (2018) 1080p/ | 2020-10-01 18:37 | - | |
| Yardie (2018) BluRay 1080p/ | 2020-10-01 18:13 | - | |
| Yesterday's Girl (2018) WEBRip 1080p/ | 2020-10-01 18:33 | - | |
| Yinz (2018) WEBRip 1080p/ | 2020-10-25 10:25 | - | |
| Yoga Hosers (2016) BluRay 1080p/ | 2020-10-01 17:26 | - | |
| You Might Be The Killer (2018) BluRay 1080p/ | 2020-10-01 16:33 | - | |
| Your Move (2018) HDRip/ | 2020-10-25 10:28 | - | |
| Yuli - 2018 - BluRay 1080p/ | 2020-10-01 17:27 | - | |
| Zabawa, Zabawa (2018) BluRay 1080p/ | 2020-10-01 19:36 | - | |
| Zoe (2018) BluRay 1080p/ | 2020-10-01 17:54 | - | |
| Zombies (2018) 1080p/ | 2020-10-01 17:03 | - | |
| Zoo (2018) WEBRip 1080p/ | 2020-10-01 17:16 | - | |
|
|---|