![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Zoombies 2 (2019)/ | 2019-11-09 09:17 | - | |
| Zombieland Double Tap (2019) BluRay 1080p/ | 2020-10-01 22:27 | - | |
| Zombie Tidal Wave (2019) 720p/ | 2020-10-01 22:21 | - | |
| Zeroville (2019) WEBRip 1080p/ | 2020-10-01 22:50 | - | |
| Z (2019) 1080p WEBRip/ | 2020-10-01 19:12 | - | |
| You Will Die at 20 (2019) 720p/ | 2021-01-01 19:31 | - | |
| Yesterday (2019) BluRay 1080p/ | 2020-10-01 23:00 | - | |
| Xenophobia (2019) WEBRip 1080p/ | 2020-10-16 20:34 | - | |
| Wounds (2019) WEBRip 1080p/ | 2020-10-01 19:31 | - | |
| Woodstock Or Bust (2019) WEBRip 1080p/ | 2020-10-16 20:33 | - | |
| Wolf (2019) 1080p WEBRip/ | 2020-10-01 22:16 | - | |
| Witnesses (2019) WEBRip 1080p/ | 2020-10-01 19:27 | - | |
| Witches In The Woods (2019) 1080p/ | 2020-10-01 19:33 | - | |
| Wish Man (2019) WEBRip 1080p/ | 2020-10-01 22:46 | - | |
| William (2019) WEBRip 1080p/ | 2020-10-01 22:50 | - | |
| Wild Rose (2019) 1080p WEB-DL/ | 2020-10-02 21:55 | - | |
| Who.Killed.Cock.Robin..2017/ | 2019-12-24 16:59 | - | |
| Who's Stalking Me (2019)/ | 2019-02-24 08:20 | - | |
| Where We Go From Here (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| Where Sleeping Dogs Lie (2019) 1080p WEBRip/ | 2020-10-01 19:01 | - | |
| Where'd You Go, Bernadette (2019) BluRay 1080p/ | 2020-10-01 22:24 | - | |
| What Men Want (2019) HDCAM/ | 2020-10-01 22:25 | - | |
| What Lies Ahead 2019 1080p/ | 2019-03-06 10:27 | - | |
| Westside vs the World (2019) 720p WEBRip/ | 2020-10-01 22:27 | - | |
| West of Sunshine (2019) 1080p/ | 2020-10-01 19:17 | - | |
| Welcome to Marwen (2019) 720p/ | 2020-10-01 22:52 | - | |
| Welcome To Acapulco (2019) BluRay 1080p/ | 2020-10-01 16:51 | - | |
| We Die Young (2019) BluRay 1080p/ | 2020-10-01 19:35 | - | |
| We Are Gathered Here (2019) WEBRip 1080p/ | 2020-10-01 19:03 | - | |
| Waves - 2019 - 1080p WEBRip/ | 2020-10-01 22:36 | - | |
| Wasp Network (2019) 1080p/ | 2020-10-01 23:05 | - | |
| Wally Got Wasted (2019) 1080p WEBRip/ | 2020-10-01 22:01 | - | |
| Wake Up (2019) WEBRip 1080p/ | 2020-10-01 19:06 | - | |
| WWE Royal Rumble (2019) BluRay 1080p/ | 2020-10-01 19:15 | - | |
| Vivarium (2019) 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| Vita and Virginia (2019) 1080p/ | 2020-10-01 22:39 | - | |
| Virginia Minnesota (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| Villains (2019) 1080p BluRay/ | 2020-10-01 16:51 | - | |
| Viking Blood (2019) 1080p WEB/ | 2020-10-01 19:04 | - | |
| Victoria Gotti My Father's Daughter (2019) 1080p/ | 2020-10-01 19:04 | - | |
| Verotika (2019) 1080p WEBRip/ | 2020-10-25 16:53 | - | |
| Velvet Buzzsaw (2019) 1080p WEB/ | 2020-10-01 16:08 | - | |
| Vault (2019) BluRay 1080p/ | 2020-10-01 22:52 | - | |
| Varsity Punks (2019) HDRip/ | 2020-10-01 22:18 | - | |
| Varda By Agnès (2019) BluRay 1080p/ | 2020-10-01 22:18 | - | |
| Vampz! (2019) 1080p/ | 2020-10-25 11:15 | - | |
| Valentine in the Vineyard (2019) 720p/ | 2020-10-01 22:16 | - | |
| VFW (2019) 1080p BluRay/ | 2020-10-01 22:17 | - | |
| Us (2019) BluRay 1080p/ | 2020-10-02 21:45 | - | |
| Urban Fears (2019) 720p WEBRip/ | 2020-10-01 22:37 | - | |
| Up There (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Untogether (2019) 1080p WEB-DL/ | 2020-10-01 22:17 | - | |
| Unplanned (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Uncut Gems (2019) BluRay 1080p/ | 2022-03-14 10:15 | - | |
| Two Blue Stripes (2019) 720 WEB-DL/ | 2021-12-13 05:20 | - | |
| Twelve (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Truth and Justice (2019)/ | 2020-10-01 22:20 | - | |
| Trust No 1 (2019) HDRip/ | 2020-10-01 22:19 | - | |
| True Love Blooms (2019) 720p/ | 2020-10-01 22:29 | - | |
| True.History.of.the.Kelly.Gang.2019.1080p.WEB-DL.DDP5.1.H264-CMRG/ | 2020-01-25 19:11 | - | |
| Triple Threat (2019) BluRay 1080p/ | 2020-10-01 19:07 | - | |
| Triple Frontier (2019) 1080p NF WEB/ | 2020-10-01 16:08 | - | |
| Trick (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| Trial by Fire (2019) HDRip/ | 2020-10-01 22:58 | - | |
| Treehouse (2019)/ | 2020-10-01 22:57 | - | |
| Trauma Therapy (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Trauma Center - 2019 - 1080p BluRay/ | 2020-10-01 22:41 | - | |
| Trauma.Center.2019/ | 2019-12-24 16:59 | - | |
| Transit 17 (2019) 720p/ | 2020-10-01 16:08 | - | |
| Trading Paint (2019) 1080p WEB/ | 2020-10-01 19:03 | - | |
| Toy Story 4 (2019) 720p HDCAM/ | 2020-10-01 22:45 | - | |
| Tower Of Silence (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Torpedo (2019) 1080p WEBRip/ | 2020-10-01 22:57 | - | |
| Top End Wedding (2019) BluRay 1080p/ | 2020-10-01 19:08 | - | |
| Tone-Deaf (2019) BluRay 1080p/ | 2020-10-01 23:01 | - | |
| Tolkien (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Togo (2019) WEBRip 1080p/ | 2020-10-01 19:29 | - | |
| To The Ends Of The Earth (2019) 1080p BluRay/ | 2021-03-09 05:09 | - | |
| Through The Ashes (2019) 720p WEB-DL/ | 2020-10-01 19:28 | - | |
| This Time, Maybe (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| This Is Our Home (2019) WEBRip 1080p/ | 2020-10-01 19:23 | - | |
| Theyre Inside (2019) 720p WEBRip/ | 2020-10-01 16:51 | - | |
| The warden (2019) 720p/ | 2021-05-22 15:19 | - | |
| Then Came You (2019) 1080p WEB/ | 2020-10-01 22:02 | - | |
| Them That Follow (2019) BluRay 1080p/ | 2020-10-01 19:28 | - | |
| Them.That.Follow.2019/ | 2019-12-24 17:02 | - | |
| The Young Cannibals (2019) WEBRip 1080p/ | 2020-10-01 22:13 | - | |
| The Wretched (2019) 1080p WEBRip/ | 2020-10-01 22:30 | - | |
| The World We Make (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| The Wolf Hour (2019) WEBRip 1080p/ | 2020-10-01 19:21 | - | |
| The Wolf's Call (2019) BluRay 1080p/ | 2020-10-01 19:39 | - | |
| The Wind (2019) 1080p BluRay/ | 2020-10-01 22:26 | - | |
| The White Storm 2 Drug Lords (2019) 1080p WEB-DL/ | 2021-12-13 07:18 | - | |
| The Wheel (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| The Wedding Year (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| The Wave (2019) 1080p BluRay/ | 2020-10-01 22:06 | - | |
| The Village In The Woods (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Viking War (2019) 1080p/ | 2019-02-26 10:43 | - | |
| The Vigil (2019) 1080p WEBRip/ | 2020-11-28 07:51 | - | |
| The Vibe (2019) 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| The Vast Of Night (2019) 1080p WEBRip/ | 2020-10-01 16:51 | - | |
| The Utah Cabin Murders (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| The Unicorn (2019) 1080p/ | 2020-10-01 22:19 | - | |
| The Two Popes (2019) 1080p WEBRip/ | 2020-10-01 22:24 | - | |
| The Turkey Bowl (2019) WEBRip 1080p/ | 2020-10-01 19:14 | - | |
| The True Don Quixote (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| The Trap (2019) 720p HDRip/ | 2020-10-01 19:01 | - | |
| The Traitor (2019) 1080p BluRay/ | 2020-10-25 11:22 | - | |
| The Tracker (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| The Tomorrow Man (2019) WEBRip 1080p/ | 2020-10-01 19:30 | - | |
| The Tombs (2019) WEBRip 1080p/ | 2020-10-01 22:47 | - | |
| The Sun Is Also A Star (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| The Story of Us (2019) Hallmark 720p HDTV/ | 2020-10-01 19:35 | - | |
| The Story of Us (2019)/ | 2019-02-11 04:55 | - | |
| The Spy Who Fell to Earth (2019) 1080p NF WEB-DL/ | 2020-10-01 22:19 | - | |
| The Spy (2019) 1080p BluRay/ | 2020-10-01 22:15 | - | |
| The Souvenir (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| The Sound Of Silence (2019) WEBRip 1080p/ | 2020-10-01 22:16 | - | |
| The Soul Collector (2019) 1080p/ | 2021-03-04 11:54 | - | |
| The Song Of Names (2019) 1080p BluRay/ | 2020-10-25 11:18 | - | |
| The Sisterhood (2019) 1080p/ | 2020-10-01 19:37 | - | |
| The Silence (2019) BluRay 1080p/ | 2020-10-01 22:41 | - | |
| The Shed - 2019 - BluRay 1080p/ | 2020-10-01 22:16 | - | |
| The Shasta Triangle (2019) WEBRip 1080p/ | 2020-10-01 19:30 | - | |
| The Seven (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| The Russian Bride (2019) 1080p/ | 2020-10-01 22:20 | - | |
| The Room (2019) 1080p BluRay/ | 2020-10-01 16:08 | - | |
| The Rising Hawk (2019) 720p/ | 2021-05-24 08:45 | - | |
| The Report (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| The Refuge (2019) WEBRip 1080p/ | 2020-10-01 22:00 | - | |
| The Red Sea Diving Resort (2019) WEBRip 1080p/ | 2020-10-01 19:12 | - | |
| The Rebels (2019) 1080p/ | 2020-10-01 22:28 | - | |
| The Pursuit (2019) 720p WEBRip/ | 2020-10-01 19:37 | - | |
| The Protector (2019) 1080p/ | 2020-10-01 19:14 | - | |
| The Professor And The Madman (2019) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| The Poison Rose (2019) BluRay 1080p/ | 2020-10-01 22:58 | - | |
| The Platform (2019) 1080p WEBRip/ | 2020-10-01 22:47 | - | |
| The Perfect Date (2019) WEBRip 1080p/ | 2020-10-01 22:26 | - | |
| The Peanut Butter Falcon (2019) BluRay 1080p/ | 2020-10-01 16:51 | - | |
| The Passing Parade (2019) WEBRip 1080p/ | 2020-10-01 22:16 | - | |
| The Parts You Lose (2019) BluRay 1080p/ | 2020-10-01 22:16 | - | |
| The Painted Bird (2019) 720p/ | 2020-10-01 19:04 | - | |
| The Outsider (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| The Other Side Of Heaven 2 Fire Of Faith (2019) BluRay 1080p/ | 2020-10-01 22:18 | - | |
| The Operative (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| The Mustang (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| The Murder Of Nicole Brown Simpson (2019) WEBRip 1080p/ | 2020-10-01 19:37 | - | |
| The Mummy Rebirth (2019) WEBRip 1080p/ | 2020-10-01 22:54 | - | |
| The Mountain (2019) HDRip/ | 2020-10-02 12:01 | - | |
| The Many Lives of Nick Buoniconti (2019) 1080p WEBRip/ | 2020-10-01 19:12 | - | |
| The Manson Family Massacre (2019) 1080p WEBRip/ | 2020-10-25 11:21 | - | |
| The Mandela Effect (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| The Man Without Gravity (2019) 1080p NF/ | 2020-10-01 22:23 | - | |
| The Man Who Killed Hitler and Then the Bigfoot (2019) 1080p/ | 2020-10-01 22:24 | - | |
| The Madness Within (2019) WEBRip 1080p/ | 2020-10-01 19:09 | - | |
| The Lovebirds (2020) 1080p WEBRip/ | 2020-10-01 22:48 | - | |
| The Lodge (2019) 1080p BluRay/ | 2020-10-01 22:30 | - | |
| The Lion King (2019) 1080p BluRay/ | 2020-10-01 22:22 | - | |
| The Lighthouse (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Lift Boy (2019) 720p WEBRip/ | 2020-10-01 22:54 | - | |
| The Legend Of 5 Mile Cave (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| The Legacy Of The Bones (2019) 720p/ | 2020-10-01 19:03 | - | |
| The League Of Legend Keepers Shadows (2019) WEBRip 1080p/ | 2020-10-01 19:18 | - | |
| The Laundromat (2019) WEBRip 1080p/ | 2020-10-01 22:40 | - | |
| The Last Whistle (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| The Last Summer (2019) WEBRip 1080p/ | 2020-10-16 20:34 | - | |
| The Last Laugh (2019) WEBRip 1080p/ | 2020-10-01 22:46 | - | |
| The Last Full Measure - 2019 - WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| The Last Faust (2019) WEBRip 1080p/ | 2020-10-01 22:55 | - | |
| The Last Boy (2019) 1080p/ | 2020-10-01 22:23 | - | |
| The Last Black Man In San Francisco (2019) BluRay 1080p/ | 2020-10-01 23:06 | - | |
| The Knight Before Christmas (2019) WEBRip 1080p/ | 2020-10-01 23:03 | - | |
| The Kitchen (2019) 1080p BluRay/ | 2020-10-01 22:36 | - | |
| The King (2019) WEBRip 1080p/ | 2020-10-01 22:37 | - | |
| The Killer Next Door (2019) 720p HDTV/ | 2020-10-25 11:16 | - | |
| The Killer Downstairs (2019)HDTV/ | 2020-10-02 12:00 | - | |
| The Kill Team (2019) 720p/ | 2020-10-02 22:08 | - | |
| The Kid Who Would Be King (2019) BluRay 1080p/ | 2020-10-25 11:21 | - | |
| The Isle (2019) 1080p/ | 2020-10-01 22:21 | - | |
| The Irishman (2019) 1080p WEBRip/ | 2020-10-01 22:28 | - | |
| The Inventor Out For Blood In Silicon Valley (2019) 720p/ | 2020-10-01 22:50 | - | |
| The Intruder (2019) BluRay 1080p/ | 2020-10-01 16:51 | - | |
| The Informer (2019) 1080p BluRay/ | 2021-11-07 04:48 | - | |
| The Influence (2019) WEBRip 1080p/ | 2020-10-16 20:33 | - | |
| The Immortal Wars Resurgence (2019) WEBRip 1080p/ | 2020-10-02 12:01 | - | |
| The Hustle (2019) 1080p WEB-DL/ | 2020-10-01 19:27 | - | |
| The Hurt (2019) 720p WEBRip/ | 2020-10-01 22:24 | - | |
| The Huntress Rune Of The Dead (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| The Hole In The Ground (2019) BluRay 1080p/ | 2020-10-01 22:47 | - | |
| The Highwaymen (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| The Haunting of Sharon Tate (2019) 1080p BluRay/ | 2020-10-01 22:48 | - | |
| The Haunting Of Borley Rectory (2019) WEBRip 1080p/ | 2020-10-01 22:23 | - | |
| The Hard Way (2019) 1080p/ | 2019-03-11 10:46 | - | |
| The Halloween Family (2019) WEBRip 1080p/ | 2020-10-01 19:29 | - | |
| The Great War (2019) WEBRip 1080p/ | 2020-10-01 19:09 | - | |
| The Great Hack (2019) 1080p NF WEB-DL/ | 2020-10-01 22:58 | - | |
| The Good Liar - 2019 - 1080p WEBRip/ | 2020-10-01 22:04 | - | |
| The Golem (2019) 1080p/ | 2020-10-01 19:13 | - | |
| The Goldfinch (2019) BluRay 1080p/ | 2020-10-01 23:00 | - | |
| The Glorious Seven (2019) BluRay 1080p/ | 2021-09-09 16:29 | - | |
| The Gentlemen (2019) 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| The Gallows Act II (2019) BluRay 1080p/ | 2020-10-01 19:29 | - | |
| The Furnace (2019) 720p WEBRip/ | 2020-10-01 22:22 | - | |
| The Furies (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| The Flood (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| The Final Wish (2019) 1080p/ | 2019-02-08 10:42 | - | |
| The Final Level Escaping Rancala (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Filthy Thirteen (2019) 720p/ | 2020-10-01 16:08 | - | |
| The Fighting Preacher (2019) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| The Field (2019) WEBRip 1080p/ | 2020-10-01 22:13 | - | |
| The Farewell (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| The Fanatic (2019) BluRay 1080p/ | 2020-10-01 22:29 | - | |
| The Experience (2019) WEBRip 1080p/ | 2020-10-01 19:09 | - | |
| The Evil Inside Her (2019) WEBRip 1080p/ | 2020-10-01 22:54 | - | |
| The Edge of Democracy (2019) 1080p/ | 2020-10-16 20:34 | - | |
| The Dustwalker (2019) 1080p WEBRip/ | 2020-10-01 19:27 | - | |
| The Dunes (2019) WEBRip 1080p/ | 2020-10-01 22:55 | - | |
| The Drone (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| The Driver (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Dragon Unleashed (2019) BluRay 1080p/ | 2020-10-01 19:16 | - | |
| The Divorce Party (2019) BluRay 1080p/ | 2020-10-01 22:20 | - | |
| The Dirt (2019) 1080p NF/ | 2019-03-23 10:16 | - | |
| The Directive (2019) 720p/ | 2020-10-01 22:20 | - | |
| The Diggers (2019) 720p/ | 2020-10-01 19:07 | - | |
| The Deeper You Dig (2019) 1080p/ | 2020-10-01 22:26 | - | |
| The Death Of Dick Long (2019) WEBRip 1080p/ | 2020-10-01 19:26 | - | |
| The Death And Return Of Superman (2019) BluRay 1080p/ | 2020-10-01 22:59 | - | |
| The Dead Don't Die (2019) BluRay 1080p/ | 2020-10-01 22:27 | - | |
| The Day Shall Come (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| The Dawn (2019) 1080p WEBRip/ | 2020-10-01 19:06 | - | |
| The Dark Within (2019) WEBRip 1080p/ | 2020-10-01 19:18 | - | |
| The Dark Kingdom (2019) 1080p/ | 2020-10-02 12:01 | - | |
| The Curse of La Llorona (2019) 1080p/ | 2020-10-01 22:18 | - | |
| The Creatress (2019) BluRay 1080p/ | 2020-10-01 22:11 | - | |
| The Courier (2019) 1080p BluRay/ | 2022-03-17 21:45 | - | |
| The Corrupted (2019) 1080p BluRay/ | 2020-10-01 22:37 | - | |
| The Combination Redemption (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Collini Case (2019) BluRay 1080p/ | 2020-10-01 22:56 | - | |
| The Cleansing Hour (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| The Chronicle Mysteries-The Wrong Man (2019) 720p x264-Hallmark/ | 2020-10-01 22:16 | - | |
| The Christ Slayer (2019) 1080p/ | 2020-10-01 22:01 | - | |
| The Challenger Disaster (2019) 1080p/ | 2020-10-02 21:50 | - | |
| The Chair to Everywhere (2019) HDRip/ | 2020-10-01 22:19 | - | |
| The Chain (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| The Cat And The Moon (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Car Road to Revenge (2019)/ | 2019-01-29 06:53 | - | |
| The Bygone (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Brighton Miracle (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| The Brawler (2019) 1080p/ | 2020-10-02 22:02 | - | |
| The Brave (2019) WEBRip 1080p/ | 2020-10-01 23:04 | - | |
| The Boy Who Harnessed The Wind (2019)/ | 2019-06-03 15:49 | - | |
| The Body Remembers When The World Broke Open (2019) WEBRip 1080p/ | 2020-10-01 22:23 | - | |
| The Black Godfather (2019) 1080p WEB-DL/ | 2020-10-01 22:48 | - | |
| The Birdcatcher (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Big Trip (2019) 1080p BluRay/ | 2020-10-01 19:36 | - | |
| The Best Of Enemies (2019) BluRay 1080p/ | 2020-10-01 22:27 | - | |
| The Beach Bum (2019) BluRay 1080p/ | 2020-10-01 22:28 | - | |
| The Baylock Residence (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| The Banana Splits Movie (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| The Balkan Line (2019) 1080p BluRay/ | 2021-05-06 11:40 | - | |
| The Assistant (2019) 1080p WEBRip/ | 2020-10-01 22:04 | - | |
| The Art Of Self-Defense (2019) BluRay 1080p/ | 2020-10-01 18:30 | - | |
| The Art Of Racing In The Rain (2019) BluRay 1080p/ | 2020-10-01 22:27 | - | |
| The Apollo (2019) WEBRip 1080p/ | 2020-10-01 18:32 | - | |
| The Angel Of Auschwitz (2019) WEBRip 1080p/ | 2020-10-01 23:07 | - | |
| The Aftermath (2019) [BluRay] [1080p] [YTS.LT]/ | 2019-06-21 10:45 | - | |
| The Aeronauts (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| The 27 Club (2019) 720p/ | 2020-10-01 22:21 | - | |
| The 16th Episode (2019) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| The.World.We.Make.2019.1080p.WEB-DL.H264.AC3-EVO/ | 2019-06-04 19:43 | - | |
| The.Tombs.2019/ | 2019-12-24 17:02 | - | |
| The.Shasta.Triangle.2019/ | 2019-12-24 17:03 | - | |
| The.Seven.2019/ | 2019-12-24 17:03 | - | |
| The.Reliant.2019/ | 2019-12-24 17:04 | - | |
| The.Pilgrims.Progress.2019.1080p.WEBRip.x264-RARBG/ | 2019-07-06 09:44 | - | |
| The.Peanut.Butter.Falcon.2019/ | 2019-11-09 09:57 | - | |
| The.Outsider.2019/ | 2019-12-24 17:04 | - | |
![[VID]](/icons/movie.gif) | The.Night.Clerk.2019.720p.WEBRip.800MB.x264-GalaxyRG.mp4 | 2025-11-20 17:37 | 899M | |
| The.Mummy.Rebirth.2019/ | 2019-12-24 17:05 | - | |
| The.Mandela.Effect.2019/ | 2019-12-24 17:05 | - | |
| The.Madness.Within.2019/ | 2019-12-24 17:06 | - | |
| The.League.Of.Legend.Keepers.Shadows.2019/ | 2019-12-24 17:06 | - | |
| The.Last.Whistle.2019.1080p.WEB-DL.H264.AC3-EVO/ | 2019-06-28 19:08 | - | |
| The.Knight.Before.Christmas.2019/ | 2019-12-03 13:16 | - | |
| The.King.2019/ | 2019-11-09 09:35 | - | |
| The.Irishman.2019/ | 2019-12-03 13:16 | - | |
| The.Great.War.2019/ | 2019-12-24 17:07 | - | |
| The.Gallows.Act.II.2019/ | 2019-12-24 17:07 | - | |
| The.Furies.2019/ | 2019-12-03 13:14 | - | |
| The.Final.Level.Escaping.Rancala.2019/ | 2019-12-24 17:08 | - | |
| The.Fighting.Preacher.2019/ | 2019-11-09 09:35 | - | |
| The.Experience.2019/ | 2019-12-03 13:12 | - | |
| The.Dustwalker.2019.1080p.BluRay.1400MB.DD5.1.x264-GalaxyRG[TGx]/ | 2020-03-24 17:48 | - | |
| The.Driver.2019/ | 2019-12-03 13:11 | - | |
| The.Courier.2019/ | 2019-12-03 13:11 | - | |
| The.Brighton.Miracle.2019/ | 2019-12-24 17:08 | - | |
| The.Beach.Bum.2019.1080p.BluRay.H264.AAC-RARBG/ | 2019-06-13 17:55 | - | |
| The.Answer.2015/ | 2019-06-29 04:17 | - | |
| The.Aeronauts.2019/ | 2019-12-24 17:37 | - | |
| The.3rd.Eye.2.2019/ | 2019-06-29 04:17 | - | |
| The-Blackout-2019-1080p-BluRay.mp4 | 2025-01-29 18:44 | 2.4G | |
| Terminator Dark Fate (2019) BluRay 1080p/ | 2021-09-08 23:01 | - | |
| Teacher (2019) WEBRip 1080p/ | 2020-10-01 19:00 | - | |
| Tapestry (2019) WEBRip 1080p/ | 2020-10-01 22:09 | - | |
| Tangent Room (2019) HDRip/ | 2020-10-01 22:29 | - | |
| Tall Girl (2019) WEBRip 1080p/ | 2020-10-01 19:07 | - | |
| Tales From The Lodge (2019) WEBRip 1080p/ | 2020-10-01 22:08 | - | |
| Take Home Pay (2019) 1080p BluRay/ | 2020-10-01 22:49 | - | |
| Take.Home.Pay.2019/ | 2019-12-24 17:38 | - | |
| TKKG (2019) BluRay 1080p/ | 2020-10-01 19:07 | - | |
| Swell (2019) WEBRip 1080p/ | 2020-10-01 22:19 | - | |
| Sweetheart (2019) 1080p WEB-DL/ | 2020-10-01 16:08 | - | |
| Swallow (2019) 1080p BluRay/ | 2020-10-01 22:21 | - | |
| Surviving Confession (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Survival Box (2019) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| Sunrise In Heaven (2019) WEBRip 1080p/ | 2020-10-01 19:05 | - | |
| Sunny Daze (2019) 1080p WEBRip/ | 2020-10-01 19:24 | - | |
| Summer Night (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| Stuber (2019) BluRay 1080p/ | 2020-10-01 22:25 | - | |
| Stray (2019) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Strawberry Flavored Plastic (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Strange Events 2 (2019) [WEBRip] [1080p] [YTS.LT]/ | 2019-06-20 18:28 | - | |
| Strange But True (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Storm Boy (2019) BluRay 1080p/ | 2020-10-16 20:34 | - | |
| Step Up China - 2019 - 1080p WEBRip/ | 2020-10-01 22:29 | - | |
| Steam Room Stories The Movie! (2019) WEBRip 1080p/ | 2020-10-25 11:11 | - | |
| Stay Out Stay Alive (2019) WEBRip 1080p/ | 2020-10-01 22:47 | - | |
| Stay Awesome, China! (2019) 1080p/ | 2020-10-01 22:19 | - | |
| Star Wars Episode IX - The Rise Of Skywalker (2019) 1080p BluRay/ | 2020-10-02 21:47 | - | |
| Stained (2019) WEBRip 1080p/ | 2020-10-01 19:03 | - | |
| Split Lip (2019) 1080p/ | 2020-10-01 22:26 | - | |
| Spiral Farm (2019) WEBRip 1080p/ | 2020-10-01 22:51 | - | |
| Spiral.Farm.2019/ | 2019-12-24 17:38 | - | |
| Spinster (2019) 1080p/ | 2020-10-01 22:29 | - | |
| SpiderMan Far From Home 2019 720p NEW HDCAM-1XBET[TGx]/ | 2019-07-06 09:44 | - | |
| Spider In The Web (2019) WEBRip 1080p/ | 2020-10-01 22:43 | - | |
| Spider-Man Far From Home (2019) BluRay 1080p/ | 2020-10-01 22:28 | - | |
| Space MOMs (2019) 1080p WEBRip/ | 2021-04-02 05:05 | - | |
| South Mountain (2019) 1080p WEBRip/ | 2020-10-01 19:01 | - | |
| Sound Of Metal (2019) 1080p/ | 2021-02-18 14:57 | - | |
| Soul Hunters (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Sorry We Missed You (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Someone Great (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| Soldier of War (2019) 720p HDRip/ | 2020-10-01 22:54 | - | |
| Snowcoming (2019) 720p/ | 2020-10-01 22:22 | - | |
| Small Town Hero (2019) WEBRip 1080p/ | 2020-10-01 22:58 | - | |
| Sleeping Dogs Lie (2019) 1080p/ | 2020-10-01 22:17 | - | |
| Slasher Party (2019) 1080p/ | 2020-10-01 19:40 | - | |
| Skin In The Game (2019) WEBRip 1080p/ | 2020-10-01 22:19 | - | |
| Sister of the Bride (2019) 720p HDTV/ | 2020-10-16 20:35 | - | |
| Sister Aimee (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Silhouette (2019) 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| Shooting The Mafia (2019) [1080p] [BluRay] [5.1] [YTS.MX]/ | 2020-04-05 18:28 | - | |
| Shes Missing (2019) 720p/ | 2020-10-01 19:03 | - | |
| Shed Of The Dead (2019) BluRay 1080p/ | 2020-10-01 22:27 | - | |
| She's Just A Shadow (2019) BluRay 1080p/ | 2020-10-01 16:51 | - | |
| Shazam! (2019) BluRay 1080p/ | 2020-10-01 22:29 | - | |
| Share (2019) HDRip/ | 2020-10-16 20:34 | - | |
| Shaft.2019.NF.1080p.WEB-DL.H264.DDP5.1-EVO/ | 2019-06-28 19:08 | - | |
| Shaft (2019) BluRay 1080p/ | 2020-10-25 11:11 | - | |
| Shadows In Mind (2019) WEBRip 1080p/ | 2020-10-01 19:13 | - | |
| Shadowplay (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| Shadow Wolves (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Sextuplets (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Serenity (2019) BluRay 1080p/ | 2020-10-01 19:04 | - | |
| Semper Fi (2019) BluRay 1080p/ | 2020-10-01 22:03 | - | |
| Semper.Fi.2019/ | 2019-12-03 13:10 | - | |
| Seeing Evil (2019) 720p/ | 2020-10-01 19:01 | - | |
| See You Soon (2019) WEBRip 1080p/ | 2020-10-02 21:48 | - | |
| Seduced By A Killer (2019)/ | 2020-10-02 21:59 | - | |
| Secrets In A Small Town (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Secret Obsession (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| School Of The Damned (2019) WEBRip 1080p/ | 2020-10-02 21:42 | - | |
| School.Of.The.Damned.2019/ | 2019-12-03 13:10 | - | |
| Scary Stories To Tell In The Dark (2019) BluRay 1080p/ | 2020-10-01 19:26 | - | |
| Scarecrow's Revenge (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Saving Zoë (2019) WEBRip 1080p/ | 2020-10-01 16:51 | - | |
| Satanic Panic (2019) BluRay 1080p/ | 2020-10-01 22:41 | - | |
| Santa Girl (2019) WEBRip 1080p/ | 2020-10-16 20:33 | - | |
| Santa Fake (2019) WEBRip 1080p/ | 2020-10-01 23:02 | - | |
| Saint Maud (2019) 720p Bluray/ | 2021-12-28 12:37 | - | |
| Sadistic Intentions (2019) 1080p/ | 2021-03-09 05:03 | - | |
| Sadistic Intentions (2019) 720p/ | 2021-03-10 09:43 | - | |
| Sacren (2019) WEBRip 1080p/ | 2020-10-02 22:04 | - | |
| SGT. Will Gardner (2019) BluRay 1080p/ | 2020-10-01 19:34 | - | |
| Ruth The Musical (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Ruta Madre (2019) WEBRip 1080p/ | 2020-10-01 22:45 | - | |
| Run the Race (2019) 720p HDCAM/ | 2020-10-01 16:50 | - | |
| Running With The Devil (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Room For Rent (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Room 37 The Mysterious Death Of Johnny Thunders (2019) BluRay 1080p/ | 2020-10-01 19:10 | - | |
| Romulus & Remus The First King (2019) BluRay 1080p/ | 2020-10-01 22:41 | - | |
| Rogue Warfare (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Rogue Cell (2019) WEBRip 1080p/ | 2020-10-01 22:22 | - | |
| Rogue.Warfare.The.Hunt.2019/ | 2019-12-24 17:41 | - | |
| Rocketman (2019) BluRay 1080p/ | 2020-10-01 22:11 | - | |
| Rock Steady Row (2019) 1080p WEB-DL/ | 2020-10-01 22:45 | - | |
| Rock, Paper, Scissors (2019) 1080p WEB-DL/ | 2020-10-01 22:26 | - | |
| Robocall (2019) WEBRip 1080p/ | 2020-10-01 19:09 | - | |
| Robert The Bruce (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Robert Reborn (2019) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| Robert.The.Bruce.2019/ | 2019-11-09 09:16 | - | |
| Roads (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Rise of the Footsoldier Marbella (2019) 1080p/ | 2020-10-01 22:16 | - | |
| Riot Girls (2019) WEBRip 1080p/ | 2020-10-01 22:07 | - | |
| Rink (2019) WEBRip 1080p/ | 2020-10-01 23:03 | - | |
| Ring Ring (2019) WEBRip 1080p/ | 2020-10-01 19:05 | - | |
| Richard Jewell (2019) DVDSCR/ | 2020-10-01 16:50 | - | |
| Return To Horror Hotel (2019) WEBRip 1080p/ | 2020-10-01 22:15 | - | |
| Return.To.Horror.Hotel.2019/ | 2019-12-24 17:48 | - | |
| Rent Live (2019) 1080p/ | 2020-10-01 22:27 | - | |
| Red Letter Day (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Red Handed (2019) WEBRip 1080p/ | 2020-10-01 22:19 | - | |
| Red Devil (2019) WEBRip 1080p/ | 2020-10-02 12:01 | - | |
| Red.Letter.Day.2019/ | 2019-11-09 09:16 | - | |
| Red.Handed.2019/ | 2019-12-24 17:48 | - | |
| Red.Devil.2019/ | 2019-12-24 17:55 | - | |
| Recovery (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Reality Queen! (2019) WEBRip 1080p/ | 2020-10-01 19:03 | - | |
| Real Cases Of Shadow People The Sarah McCormick Story (2019) 1080p/ | 2020-10-01 22:24 | - | |
| Ready Or Not (2019) BluRay/ | 2020-10-01 22:23 | - | |
| ReMastered The Two Killings Of Sam Cooke (2019) WEB/ | 2020-10-01 19:29 | - | |
| Ray And Liz (2019) 1080p WEB-DL/ | 2020-10-01 16:08 | - | |
| Ratu Ilmu Hitam (2019) 720p/ | 2020-10-01 19:02 | - | |
| Rattlesnake (2019) 1080p/ | 2020-10-01 22:50 | - | |
| Ramy Youssef Feelings (2019) 1080p WEBRip/ | 2020-10-01 19:38 | - | |
| Rambo Last Blood (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Radioflash (2019) WEBRip 1080p/ | 2020-10-01 23:05 | - | |
| Radioactive (2019) 1080p WEBRip/ | 2020-10-01 22:25 | - | |
| Rabid (2019) WEBRip 1080p/ | 2020-10-01 23:04 | - | |
| Queen & Slim (2019) 1080p WEBRip/ | 2020-10-01 16:50 | - | |
| Pull (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Psycho Therapy (2019) 1080p WEBRip/ | 2020-10-01 22:53 | - | |
| Project Ithaca (2019) BluRay 1080p/ | 2020-10-01 22:24 | - | |
| Primal (2019) BluRay 1080p/ | 2020-10-01 19:37 | - | |
| Prey (2019) WEBRip 1080p/ | 2020-10-01 22:26 | - | |
| Pretty Broken (2019) 1080p WEB/ | 2020-10-01 22:23 | - | |
| Pothole Wars (2019) 1080p/ | 2020-10-01 22:20 | - | |
| Possession Diaries (2019) WEBRip 1080p/ | 2020-10-01 22:19 | - | |
| Portrait of A Lady on Fire (2019) 1080p/ | 2020-10-01 22:21 | - | |
| Portal (2019) 720p WEBRip/ | 2020-10-01 22:18 | - | |
| Poms (2019) BluRay 1080p/ | 2020-10-01 22:25 | - | |
| Polaroid (2019) BluRay 1080p/ | 2020-10-01 22:25 | - | |
| Polar (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Pokémon Detective Pikachu (2019) BluRay 1080p/ | 2020-10-01 19:36 | - | |
| Point Blank (2019) WEBRip 1080p/ | 2020-10-01 19:37 | - | |
| Plus One (2019) BluRay 1080p/ | 2020-10-01 22:22 | - | |
| Pledge (2019)/ | 2020-10-01 22:42 | - | |
| Please Come With Me (2019) WEBRip 1080p/ | 2020-10-01 22:53 | - | |
| Playing With Fire - 2019 - 1080p WEBRip/ | 2020-10-01 22:25 | - | |
| Play Or Die (2019) WEBRip 1080p/ | 2020-10-01 19:21 | - | |
| Pink Wall (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Pig Hag (2019) WEBRip 1080p/ | 2020-10-01 19:38 | - | |
| Pickaxe (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Phoenix Oregon (2019) 1080p WEBRip/ | 2020-10-01 22:22 | - | |
| Philophobia Or The Fear Of Falling In Love (2019) WEBRip 1080p/ | 2020-10-02 22:07 | - | |
| Phil (2019) WEBRip 1080p/ | 2020-10-01 19:25 | - | |
| Pet Sematary (2019) BluRay 1080p/ | 2023-11-01 17:39 | - | |
| Pet Graveyard (2019) 1080p WEB-DL/ | 2020-10-01 19:36 | - | |
| Pentagram (2019) WEBRip 1080p/ | 2020-10-01 22:23 | - | |
| Penguins (2019) 1080p/ | 2020-10-01 22:15 | - | |
| Pending Love.2019.Primeflix.Originals.S01.1080p.WEB-DL.x264.AAC -DDR/ | 2019-11-22 18:46 | - | |
| Pegasus.2019/ | 2019-06-29 04:13 | - | |
| Peel (2019) WEBRip 1080p/ | 2020-10-01 22:39 | - | |
| Pavarotti (2019) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| Paul Chowdhry Live Innit (2019) 1080p/ | 2020-10-01 22:24 | - | |
| Patient 001 (2019) HDRip/ | 2020-10-01 19:07 | - | |
| Paradise Hills (2019) WEBRip 1080p/ | 2020-10-01 19:00 | - | |
| Paradise Beach (2019) WEBRip 1080p/ | 2020-10-01 19:16 | - | |
| Palm Beach (2019) WEBRip 1080p/ | 2020-10-01 19:33 | - | |
| Palau The Movie (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| Pain And Glory (2019) 1080p BluRay/ | 2020-10-01 19:25 | - | |
| Paddleton (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Paddleton (2019) 720p NF WEB/ | 2019-02-23 12:21 | - | |
| Overcomer (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Outpost Earth (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Outpost.Earth.2019/ | 2019-12-24 17:56 | - | |
| Outlaws Don't Get Funerals (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Out Of Liberty (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| Otherhood (2019) 1080p NF WEB-DL/ | 2020-10-01 18:33 | - | |
| Opus Zero (2019) 1080p/ | 2020-10-01 16:50 | - | |
| Only Mine (2019) 1080p WEB/ | 2020-10-01 23:05 | - | |
| One Winter Night (2019) HDRip/ | 2020-10-01 22:20 | - | |
| One Remains (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| One Last Night (2019) 1080p WEB-DL/ | 2020-10-01 22:42 | - | |
| Once Upon A Time In London (2019) WEBRip 1080p/ | 2020-10-01 22:59 | - | |
| Once Upon A Time In Deadwood (2019) 1080p/ | 2020-10-01 19:13 | - | |
| Once Upon A Time ... In Hollywood (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Oil In The Blood (2019) BluRay 1080p/ | 2020-10-01 22:21 | - | |
| Oh, Ramona! (2019) [WEBRip] [720p] [YTS.AM]/ | 2019-06-03 07:49 | - | |
| Official Secrets (2019) WEBRip 1080p/ | 2020-10-01 22:15 | - | |
| Obsession (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Norm Of The North King Sized Adventure (2019) WEBRip 1080p/ | 2020-10-01 19:07 | - | |
| Noelle (2019) 1080p HDRip/ | 2020-10-01 19:12 | - | |
| No Surrender (2019) HDRip/ | 2020-10-01 22:27 | - | |
| No Mans Land (2019) 720p/ | 2020-10-01 23:02 | - | |
| No Doubt (2019) WEBRip 1080p/ | 2020-10-02 22:06 | - | |
| Nighthawks (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Night Sweats (2019) WEBRip 1080p/ | 2020-10-01 22:50 | - | |
| Night Hunter (2018) WEBRip 1080p/ | 2019-08-16 10:18 | - | |
| Night (2019) 1080p/ | 2020-10-01 23:00 | - | |
| Next Level (2019) 720p/ | 2020-10-01 19:11 | - | |
| New Chilling Tales The Anthology (2019) 720p/ | 2020-10-01 22:15 | - | |
| Never Grow Old (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Nereus (2019) BluRay 1080p/ | 2020-10-01 19:20 | - | |
| Nearly Married (2019) 720p/ | 2020-10-01 19:40 | - | |
| Native Son (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Narco Soldiers (2019) 1080p BluRay/ | 2020-10-01 22:27 | - | |
| Nancy Drew And The Hidden Staircase (2019) BluRay 1080p/ | 2020-10-01 23:04 | - | |
| My Soul To Keep (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| My Name Is Sara (2019) 1080p WEBRip/ | 2020-10-01 18:38 | - | |
| My Killer Client (2019) HDTV/ | 2020-10-01 22:25 | - | |
| My Adventures With Santa (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Muse (2019) WEBRip 1080p/ | 2020-10-25 11:13 | - | |
| Murder Mystery (2019) 1080p NF WEB-DL/ | 2020-10-01 22:19 | - | |
| Murder In Law (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Mummy Reborn (2019) 1080p WEB-DL/ | 2020-10-01 22:18 | - | |
| Ms. Purple (2019) WEBRip 1080p/ | 2020-10-01 19:02 | - | |
| Motherless Brooklyn - 2019 - WEBRip 1080p/ | 2020-10-01 22:23 | - | |
| Motel Acacia (2019) 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| Mosul (2019) 1080p WEBRip/ | 2020-11-28 08:36 | - | |
| Monos (2019) 1080p BluRay/ | 2020-10-01 22:18 | - | |
| Mommys Little Princess (2019) 1080p/ | 2020-10-16 20:35 | - | |
| Mollywood (2019) WEBRip 1080p/ | 2020-10-01 22:07 | - | |
| Mob Town (2019) WEBRip 1080p/ | 2020-10-25 11:13 | - | |
| Mister America (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Missing Link (2019) 720p/ | 2021-03-13 14:23 | - | |
| Miss Virginia (2019) 1080p/ | 2020-10-01 16:50 | - | |
| Miss Bala (2019) BluRay 1080p/ | 2020-10-01 22:32 | - | |
| Miranda Sings Live... Your Welcome (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Mine 9 - 2019 - BluRay 1080p/ | 2020-10-01 16:50 | - | |
| Midway (2019) 1080p BluRay/ | 2020-10-01 22:02 | - | |
| Midsommar (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Mickey And The Bear (2019) 1080p WEBRip/ | 2020-10-01 22:15 | - | |
| Michael Vs Jason Evil - Emerges (2019) HDRip/ | 2020-10-01 16:08 | - | |
| Michael Jackson Chase the Truth (2019) 1080p/ | 2020-10-01 23:01 | - | |
| Mi Pan Sachin 2019 WebRip Marathi 720p x264 AAC 5 1 ESub - mkvCinemas Telly/ | 2019-03-17 10:50 | - | |
| Mermaid Down (2019) WEBRip 1080p/ | 2020-10-25 11:20 | - | |
| Men In Black International (2019) BluRay 1080p/ | 2020-10-01 22:20 | - | |
| Memory The Origins Of Alien (2019) WEBRip 1080p/ | 2020-10-02 22:14 | - | |
| Measure For Measure (2019) 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| Mayday (2019) 720p WEBRip/ | 2020-10-01 22:50 | - | |
| Maternal Instinct (2019)/ | 2020-10-01 19:10 | - | |
| Mask Of Thorn (2019) WEBRip 1080p/ | 2020-10-01 22:11 | - | |
| Mary (2019) WEBRip 1080p/ | 2020-10-01 19:10 | - | |
| Mary (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Marriage Story (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Marriage Killer (2019) [WEBRip] [1080p] [YTS.LT]/ | 2019-06-20 18:28 | - | |
| Marked for Trade (2019) 720p WEBRip/ | 2020-10-01 22:25 | - | |
| Manifest Destiny Down Spacetime (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Maleficent Mistress of Evil 2019 1080p Bluay DD 5.1 HEVC H265-VOSTOK.mkv | 2023-03-09 04:53 | 2.7G | |
| Maleficent Mistress Of Evil - 2019 - BluRay 1080p/ | 2020-10-01 22:23 | - | |
| Making Noise Quietly (2019) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Madness In The Method (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Made In Malta (2019) WEBRip 1080p/ | 2020-10-02 12:02 | - | |
| Ma (2019) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| Lying And Stealing (2019) BluRay 1080p/ | 2020-10-01 22:43 | - | |
| Lucy In The Sky (2019) 1080p/ | 2020-10-01 22:51 | - | |
| Lucky Day (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| Low Low (2019) WEBRip 1080p/ | 2020-10-01 22:15 | - | |
| Love on the Menu (2019) 720p HDTV Hallmark/ | 2020-10-01 16:08 | - | |
| Love You to Death (2019)/ | 2020-10-01 22:49 | - | |
| Love Under the Rainbow (2019) Hallmark 720p HDTV/ | 2020-10-01 22:17 | - | |
| Love Struck Sick (2019) 720p/ | 2020-10-01 22:29 | - | |
| Love Shot (2019) 720p HDRip/ | 2020-10-01 22:51 | - | |
| Love Is Blind (2019) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| Love,Romance & Chocolate (2019) 720p Hallmark/ | 2020-10-01 22:57 | - | |
| Lourdes - 2019 - BluRay 1080p/ | 2020-10-01 22:52 | - | |
| Loophole (2019) 1080p/ | 2020-10-01 16:50 | - | |
| Long Shot (2019) WEBRip 1080p/ | 2020-10-01 22:22 | - | |
| Little Women (2019) 1080p WEBRip/ | 2020-10-01 19:31 | - | |
| Little White Lies 2 (2019) 1080p BluRay/ | 2020-10-01 23:07 | - | |
| Little Monsters (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Little Joe(2019) 1080p/ | 2020-10-01 16:08 | - | |
| Little (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Lion Killer (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Lion.Killer.2019/ | 2019-12-24 18:02 | - | |
| Line Of Duty - 2019 - BluRay 1080p/ | 2020-10-01 22:16 | - | |
| Linda Ronstadt The Sound Of My Voice (2019) 1080p BluRay/ | 2020-10-01 22:18 | - | |
| Limbo (2019) WEBRip 1080p/ | 2020-10-02 12:02 | - | |
| Light of My Life (2019) 1080p WEB-DL/ | 2019-08-09 11:25 | - | |
| Light Of My Life (2019) BluRay 1080p/ | 2020-10-01 19:10 | - | |
| Life Like (2019) 1080p/ | 2020-10-02 22:04 | - | |
| Lie Low (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Let It Snow (2019) WEBRip 1080p/ | 2020-10-01 19:38 | - | |
| Lemonade (2019)/ | 2020-10-01 22:19 | - | |
| Lazarat (2019) 720p WEB-DL/ | 2020-10-01 16:08 | - | |
| Late Night (2019) BluRay 1080p/ | 2020-10-01 22:15 | - | |
| Last Glimpse (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Last Ferry (2019) 1080p/ | 2020-10-01 22:44 | - | |
| Last Christmas (2019) 1080p BluRay/ | 2020-12-11 13:16 | - | |
| Lancaster Skies (2019) [BluRay] [720p] [YTS.AM]/ | 2019-06-03 08:08 | - | |
| Lady And The Tramp (2019) WEBRip 1080p/ | 2020-10-01 22:10 | - | |
| Kon-Tiki.2012/ | 2019-06-29 04:12 | - | |
| Koko A Red Dog Story (2019) 1080p/ | 2020-10-01 19:34 | - | |
| Knives Out (2019) 720p BluRay x264 ESub - MkvHub.mp4 | 2025-11-24 09:19 | 1.7G | |
| Kiss Kiss (2019) 1080p/ | 2020-10-01 22:39 | - | |
| Kim Possible (2019) Disney 720p Web/ | 2020-10-25 11:22 | - | |
| Killers Anonymous (2019) BluRay 1080p/ | 2020-10-16 20:33 | - | |
| Killerman (2019) BluRay 1080p/ | 2020-10-01 22:42 | - | |
| Killer Sofa (2019) 1080p/ | 2020-10-01 22:17 | - | |
| Kill Chain - 2019 - BluRay 1080p/ | 2020-10-01 19:17 | - | |
| Kidnapping Stella (2019) 1080p NF/ | 2020-10-01 22:22 | - | |
| Kevin Harts Guide To Black History (2019) 1080p WEB/ | 2020-10-01 19:11 | - | |
| Karma (2019) HDRip/ | 2020-10-02 21:48 | - | |
| Kardec (2019) WEBRip 1080p/ | 2020-10-01 22:45 | - | |
| K-12 (2019) 1080p/ | 2020-10-01 19:07 | - | |
| Just Mercy (2019) 720p/ | 2020-10-01 19:17 | - | |
| Just Add Romance (2019)/ | 2019-03-03 07:49 | - | |
| Jumanji The Next Level (2019) 1080p BluRay/ | 2020-10-01 22:57 | - | |
| Judy (2019) BluRay 1080p/ | 2020-10-01 22:22 | - | |
| Juanita (2019) WEBRip 1080p/ | 2020-10-01 19:14 | - | |
| Joker.2019/ | 2019-12-24 18:05 | - | |
| Joker (2019) BluRay 1080p/ | 2020-10-01 22:15 | - | |
| Jojo Rabbit (2019) 1080p WEBRip/ | 2020-10-02 22:04 | - | |
| John Wick Chapter 3 - Parabellum (2019) BluRay 1080p/ | 2020-10-01 22:25 | - | |
| Jexi (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Jellyfish (2019) HDRip/ | 2020-10-01 22:17 | - | |
| Jacob's Ladder (2019) 1080p BluRay/ | 2020-10-01 22:58 | - | |
| Itsy Bitsy (2019) BluRay 1080p/ | 2020-10-01 19:34 | - | |
| It Chapter Two (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| Isn't It Romantic (2019) WEBRip 1080p/ | 2020-10-01 22:26 | - | |
| Iron Sky The Coming Race (2019) BluRay 1080p/ | 2020-10-01 22:04 | - | |
| Iron Fists And Kung Fu Kicks (2019) WEBRip 1080p/ | 2020-10-01 22:50 | - | |
| Iron.Fists.And.Kung.Fu.Kicks.2019/ | 2019-12-24 18:08 | - | |
| Ip Man 4 The Finale (2019) 1080p BluRay/ | 2021-04-18 15:34 | - | |
| Investigation 13 (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Invasion Planet Earth (2019) WEBRip 1080p/ | 2020-10-01 19:35 | - | |
| Intuitions (2019) WEBRip 1080p/ | 2020-10-01 22:16 | - | |
| Into The Grand Canyon (2019) 720p WEBRip/ | 2020-10-01 16:08 | - | |
| Into The Ashes (2019) BluRay 1080p/ | 2020-10-01 19:35 | - | |
| In the Shadow of the Moon (2019) 1080p NF WEB-DL/ | 2020-10-01 22:26 | - | |
| Inside Man Most Wanted (2019) BluRay 1080p/ | 2020-10-01 22:24 | - | |
| Inmate Zero (2019) WEBRip 1080p/ | 2020-10-01 22:03 | - | |
| Inherit The Viper - 2019 - WEBRip 1080p/ | 2020-10-01 22:22 | - | |
| In The Tall Grass (2019) WEBRip 1080p/ | 2020-10-01 22:04 | - | |
| In Full Bloom (2019) BluRay 1080p/ | 2020-10-01 22:29 | - | |
| In Bed With A Killer (2019) HDTV/ | 2020-10-01 22:06 | - | |
| Im Just F cking With You (2019) 720p WEB-DL/ | 2020-10-01 22:26 | - | |
| Ice on Fire (2019) 720p/ | 2020-10-01 16:08 | - | |
| I Trapped The Devil (2019) BluRay 1080p/ | 2020-10-02 12:00 | - | |
| I Spit On Your Grave Deja Vu (2019) 720p/ | 2020-10-01 16:50 | - | |
| I See You (2019) 1080p/ | 2019-02-26 10:43 | - | |
| IO (2019) 1080p/ | 2020-10-01 22:34 | - | |
| I Hate Kids (2019) 1080p/ | 2020-10-01 22:26 | - | |
| I Got The Hook Up 2 (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| I Am Mother (2019) BluRay 1080p/ | 2020-10-01 22:53 | - | |
| I Am Durán (2019) BluRay 1080p/ | 2020-10-02 12:02 | - | |
| I.Am.Durán.2019/ | 2019-12-24 18:09 | - | |
| Hustlers (2019) BluRay 1080p/ | 2020-10-02 22:13 | - | |
| How To Train Your Dragon The Hidden World (2019)/ | 2019-04-18 19:21 | - | |
| How High 2 (2019) 720p/ | 2020-10-01 19:13 | - | |
| Horrible Histories The Movie - Rotten Romans (2019) BluRay 1080p/ | 2020-10-01 22:49 | - | |
| Hope Gap (2019) 1080p BluRay/ | 2020-10-01 19:21 | - | |
| Honeyland (2019) 1080p BluRay/ | 2020-10-01 22:26 | - | |
| Honey Boy (2019) 1080p BluRay/ | 2020-12-30 12:11 | - | |
| Hollywould (2019) 1080p WEBRip/ | 2020-10-01 22:27 | - | |
| Hollow Point (2019) WEBRip 1080p/ | 2020-10-01 22:33 | - | |
| Holiday In The Wild (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Holiday Hell (2019) WEBRip 1080p/ | 2020-10-02 22:12 | - | |
| Hoax (2019) WEBRip 1080p/ | 2020-10-01 19:12 | - | |
| Hitsville The Making Of Motown (2019) BluRay 1080p/ | 2020-10-16 20:33 | - | |
| Hitlers Secret Tunnels (2019) 1080p/ | 2020-10-01 22:19 | - | |
| Hit-and-Run Squad (2019) 1080p BluRay/ | 2020-10-01 19:02 | - | |
| His Father's Voice (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| High Resolution (2019) 1080p/ | 2020-10-01 22:43 | - | |
| High On The Hog (2019) 1080p WEB-DL/ | 2020-10-01 22:05 | - | |
| High Note (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| High Flying Bird (2019) 1080p/ | 2019-02-08 10:24 | - | |
| Hesperia (2019) WEBRip 1080p/ | 2020-10-01 23:06 | - | |
| Heritage - 2019 - WEBRip 1080p/ | 2020-10-01 22:51 | - | |
| Here Comes Hell (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| Hellboy.2019/ | 2019-11-09 09:13 | - | |
| Hellboy (2019) English/ | 2019-04-18 05:35 | - | |
| Hellboy (2019) BluRay 1080p/ | 2020-10-01 19:06 | - | |
| Hell Of A Night (2019) 720p WEB-DL/ | 2020-10-01 22:27 | - | |
| Hell Girl (2019) BluRay 1080p/ | 2020-10-16 20:33 | - | |
| Hell.Girl.2019/ | 2019-12-24 18:09 | - | |
| Heavy (2019) 1080p WEBRip/ | 2021-09-21 08:47 | - | |
| Heaven (2019) WEB/ | 2020-10-16 20:34 | - | |
| Havana Darkness (2019) HDRip/ | 2020-10-01 22:32 | - | |
| Haunt (2019) WEBRip 1080p/ | 2020-10-01 22:10 | - | |
| Hatchback (2019) WEBRip 1080p/ | 2020-10-01 19:07 | - | |
| Harriet - 2019 - DVDScr/ | 2020-10-16 20:34 | - | |
| Harpoon (2019) WEBRip 1080p/ | 2020-10-01 19:31 | - | |
| Hard Night Falling (2019) WEBRip 1080p/ | 2020-10-01 22:46 | - | |
| Hard.Night.Falling.2019/ | 2019-12-24 18:12 | - | |
| Handy Dandy (2019) WEBRip 1080p/ | 2020-10-01 22:06 | - | |
| Halston (2019) 1080p/ | 2020-10-01 22:18 | - | |
| Halloween At Aunt Ethel's (2019) BluRay 1080p/ | 2020-10-01 19:32 | - | |
| Hail Satan (2019) 1080p WEB-DL/ | 2020-10-01 22:18 | - | |
| Gwen (2019) 1080p WEB-DL/ | 2020-10-01 22:17 | - | |
| Gutterbug (2019) 1080p/ | 2020-10-01 22:52 | - | |
| Guns Akimbo (2019) 1080p WEB-DL/ | 2020-10-16 20:33 | - | |
| Guava Island (2019) 720p WEB-DL/ | 2020-10-01 19:07 | - | |
| Greyhound Attack (2019) BluRay 1080p/ | 2020-10-01 22:26 | - | |
| Greener Grass (2019) 1080p/ | 2020-10-01 22:27 | - | |
| Grand Isle (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Grand Daddy Day Care (2019)/ | 2020-10-01 22:20 | - | |
| Good Witch Curse From a Rose (2019) 720p/ | 2020-10-01 16:50 | - | |
| Good Sam (2019) 720p WEBRip/ | 2020-10-01 19:07 | - | |
| Good Posture (2019) 1080p WEBRip/ | 2020-10-01 22:27 | - | |
| Good Boys (2019) 1080p/ | 2020-10-01 22:25 | - | |
| Gone By Dawn 2 Dead By Dusk (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| Godzilla King Of The Monsters (2019) BluRay 1080p/ | 2020-10-01 22:28 | - | |
| Goalie.2019.1080p.WEB-DL.DD5.1.H.264-NTb[EtHD]/ | 2019-06-17 17:15 | - | |
| Glass (2019) BluRay 1080p/ | 2020-10-01 19:09 | - | |
| Girls Guns and Blood (2019) 720p/ | 2020-10-01 16:08 | - | |
| Girl On The Third Floor (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Girl Girl Scene (2019) 720p WEBRip/ | 2020-10-01 22:28 | - | |
| Ghost In The Graveyard (2019) WEBRip 1080p/ | 2020-10-01 22:30 | - | |
| Get Gone (2019) 1080p WEBRip/ | 2020-10-01 19:26 | - | |
| Georgetown (2019) 1080p WEB-DL/ | 2020-10-01 22:55 | - | |
| General Commander (2019) BluRay 1080p/ | 2020-10-01 22:21 | - | |
| Gemini Man - 2019 - BluRay 1080p/ | 2020-10-01 22:17 | - | |
| Gemini.Man.2019.1080p.WEB-DL.DD5.1.H264-CMRG/ | 2019-11-22 17:25 | - | |
| Geetha.Govindam.2018/ | 2019-12-24 18:14 | - | |
| Gates Of Paradise (2019) 1080p/ | 2020-10-01 22:56 | - | |
| Fyre Fraud (2019) 1080p/ | 2020-10-16 20:34 | - | |
| Fyre (2019) 1080p/ | 2020-10-01 23:02 | - | |
| Furie (2019) 1080p NF WEB-DL/ | 2020-10-01 22:22 | - | |
| Full Count (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| Fuck You Immortality (2019) 1080p WEBRip/ | 2020-10-01 19:29 | - | |
| From The Dead (2019) WEBRip 1080p/ | 2020-10-01 23:06 | - | |
| Framing John DeLorean (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Fractured (2019) 1080p WEBRip/ | 2020-10-02 12:02 | - | |
| Foxtrot Six (2019) 1080p WEBRip/ | 2020-10-02 12:01 | - | |
| Foreseen (2019) WEBRip 1080p/ | 2020-10-01 19:32 | - | |
| Ford V Ferrari - 2019 - 1080p WEBRip/ | 2020-10-01 19:31 | - | |
| For Love Or Money (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Flip That Romance (2019)/ | 2019-03-17 10:47 | - | |
| Flashout (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Five Feet Apart (2019) BluRay 1080p/ | 2020-10-01 22:40 | - | |
| Fisherman's Friends (2019) BluRay 1080p/ | 2020-10-01 19:07 | - | |
| Finding Steve McQueen (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Fighting with My Family (2019)/ | 2019-03-10 10:15 | - | |
| Fighting With My Family (2019) BluRay 1080p/ | 2020-10-25 11:14 | - | |
| Feedback (2019) BluRay 1080p/ | 2020-10-01 22:43 | - | |
| Feast Of The Seven Fishes (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| Fast & Furious Presents Hobbs & Shaw (2019) BluRay 1080p/ | 2020-10-01 22:28 | - | |
| Farmtastic Fun (2019) 1080p/ | 2020-10-01 22:25 | - | |
| Fanatic (2019) 1080p NF/ | 2020-10-01 22:25 | - | |
| Family Obligations (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| False Witness (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Falling Inn Love (2019) WEBRip 1080p/ | 2020-10-01 19:08 | - | |
| Extremely Wicked, Shockingly Evil And Vile (2019) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| Extracurricular Activities (2019) 1080p/ | 2020-10-01 22:13 | - | |
| Expo (2019) 1080p NF WEBRip/ | 2020-10-01 22:32 | - | |
| Eternal Code (2019) 1080p/ | 2020-10-01 22:22 | - | |
| Escape Room (2019) BluRay 1080p/ | 2020-10-02 21:54 | - | |
| Escape Plan The Extractors (2019) BluRay 720p/ | 2020-10-16 20:34 | - | |
| Escape And Evasion (2019) WEBRip 1080p/ | 2020-10-01 22:46 | - | |
| Escape.Room.2019.1080p.BluRay/ | 2019-04-19 08:17 | - | |
| Escape.Plan.The.Extractors.2019/ | 2019-06-29 04:11 | - | |
| Escape.And.Evasion.2019/ | 2019-12-24 18:28 | - | |
| Erasing His Past (2019) 1080p WEBRip/ | 2020-10-25 11:21 | - | |
| Entangled (2019) WEBRip 1080p/ | 2020-10-16 20:35 | - | |
| Enemy Within (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Endings, Beginnings (2019) 1080p WEBRip/ | 2020-10-01 22:09 | - | |
| End Of The Century (2019) 1080p BluRay/ | 2020-10-01 22:16 | - | |
| Eminence Hill (2019) WEBRip 1080p/ | 2020-10-01 23:03 | - | |
| Eminence.Hill.2019/ | 2019-11-09 09:13 | - | |
| Ellipse (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Elisa Y Marcela (2019) WEBRip 1080p/ | 2020-10-01 23:05 | - | |
| Eli (2019) 1080p/ | 2020-10-01 19:21 | - | |
| El Camino A Breaking Bad Movie (2019) 1080p NF WEBRip/ | 2020-10-01 19:29 | - | |
| Egg (2019) HDRip/ | 2020-10-01 22:27 | - | |
| Eerie (2019) 1080p NF/ | 2020-10-02 21:57 | - | |
| Eat Brains Love (2019) 1080p WEB-DL/ | 2021-09-06 22:20 | - | |
| Earthquake Bird (2019) WEBRip 1080p/ | 2020-10-01 19:04 | - | |
| Dumbo.2019/ | 2019-06-29 04:10 | - | |
| Dumbo (2019) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| Drunk Parents (2019) BluRay 1080p/ | 2020-10-01 22:59 | - | |
| Drowning (2019) 1080p WEBRip/ | 2020-10-25 11:22 | - | |
| Driveways (2019) 720p/ | 2020-12-03 13:17 | - | |
| Drag Me Down the Aisle (2019)/ | 2020-10-01 22:24 | - | |
| Downton.Abbey.2019/ | 2019-12-03 13:07 | - | |
| Doubting Thomas (2019) 1080p/ | 2020-10-01 22:33 | - | |
| Double Echo (2019) 1080p/ | 2020-10-02 12:01 | - | |
| Dormant (2019) HDRip/ | 2020-10-01 19:12 | - | |
| Dora and the Lost City of Gold (2019) HDCAM/ | 2019-08-14 10:48 | - | |
| Dora And The Lost City Of Gold 2019/ | 2019-11-09 09:12 | - | |
| Dora And The Lost City Of Gold (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Door In The Woods (2019) 720p/ | 2020-10-01 16:08 | - | |
| Doom Room (2019) 1080p/ | 2020-10-01 19:03 | - | |
| Doom Annihilation (2019) BluRay 1080p/ | 2020-10-01 22:56 | - | |
| Dont Look (2019) HDRip/ | 2020-10-01 22:28 | - | |
| Dont Let The Night End (2019) 1080p/ | 2020-10-01 16:50 | - | |
| Donovan Reid (2019) WEBRip 1080p/ | 2020-10-01 22:11 | - | |
| Don't Let Go (2019) BluRay 1080p/ | 2020-10-02 12:01 | - | |
| Domino.2019.7/ | 2019-06-04 10:30 | - | |
| Domino (2019) WEBRip 1080p/ | 2020-10-16 20:35 | - | |
| Dolphin Kick (2019) BluRay 1080p/ | 2020-10-02 12:02 | - | |
| Dolls (2019) WEBRip 1080p/ | 2019-07-03 13:14 | - | |
| Doll Cemetery (2019) WEBRip 1080p/ | 2020-10-16 20:34 | - | |
| Dolemite Is My Name (2019) 720p/ | 2020-10-01 22:27 | - | |
| Doctor Sleep - 2019 - 1080p BluRay/ | 2020-10-01 19:06 | - | |
| Doctor.Sleep.2019/ | 2019-12-24 18:29 | - | |
| Discarnate (2019) 720p BluRay/ | 2020-10-01 22:16 | - | |
| Disappearance (2019) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| Dirty God (2019) WEBRip 1080p/ | 2020-10-01 23:04 | - | |
| Dino King 3D Journey To Fire Mountain (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Devil's Revenge (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Destroyer (2019) DVDSCR/ | 2020-10-01 19:34 | - | |
| Descendants 3 (2019) WEBRip 1080p/ | 2020-10-01 19:27 | - | |
| Depraved (2019) WEBRip 1080p/ | 2020-10-01 22:02 | - | |
| Demon Eye (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Dementer (2019) 1080p WEBRip/ | 2022-02-09 16:17 | - | |
| Death of a Cheerleader (2019)/ | 2019-02-04 04:36 | - | |
| Deadwood The Movie (2019)/ | 2019-06-03 07:47 | - | |
| Deadly Switch (2019) WEBRip 1080p/ | 2020-10-01 22:06 | - | |
| Deadcon (2019) 1080p/ | 2020-10-01 16:50 | - | |
| Dead Water (2019) 720p WEBRip/ | 2020-10-16 20:33 | - | |
| Dave Chappelle Sticks and Stones (2019) 1080p NF/ | 2020-10-01 22:31 | - | |
| Dauntless The Battle Of Midway (2019) BluRay 1080p/ | 2020-10-01 23:03 | - | |
| Daughter Of The Wolf (2019) 1080p WEB-DL/ | 2020-10-01 22:44 | - | |
| Darlin (2019) 1080p/ | 2020-10-01 22:29 | - | |
| Darkness Visible (2019) [WEBRip] [1080p] [YTS.LT]/ | 2019-06-20 18:28 | - | |
| Dark Waters (2019) 1080p BluRay/ | 2020-10-01 22:17 | - | |
| Dark Phoenix (2019) BluRay 1080p/ | 2020-10-01 19:08 | - | |
| Dark Phoenix (2019) 720p HDCAM/ | 2019-08-31 18:23 | - | |
| Dark Encounter (2019) 1080p/ | 2020-10-01 19:31 | - | |
| Dark, Almost Night (2019) BluRay 1080p/ | 2020-10-01 22:55 | - | |
| Daniel Isn't Real (2019) WEBRip 1080p/ | 2020-10-16 20:34 | - | |
| Danger.Close.(2019)/ | 2019-11-16 14:52 | - | |
| Daffodils (2019) WEBRip 1080p/ | 2020-10-01 22:16 | - | |
| D-Day Assassins (2019) 720p WEB-DL/ | 2020-10-01 22:35 | - | |
| D-Day (2019) BluRay 1080p/ | 2020-10-01 22:16 | - | |
| Curiosa (2019) 720p BluRay/ | 2020-10-01 22:05 | - | |
| Cuck (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Cubby (2019) WEBRip 1080p/ | 2020-10-01 22:57 | - | |
| Crystals Shadow (2019) 720p WEBRip/ | 2020-10-01 23:07 | - | |
| Crypto (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Crypsis.2019/ | 2019-12-24 18:32 | - | |
| Cruel Peter (2019) 1080p WEBRip/ | 2020-10-01 22:51 | - | |
| Crucible Of The Vampire (2019)/ | 2019-02-18 09:39 | - | |
| Crown Vic - 2019 - BluRay 1080p/ | 2020-10-01 22:35 | - | |
| Crossbreed (2019) 1080p/ | 2020-10-01 19:13 | - | |
| Cross 3 (2019) WEBRip 1080p/ | 2020-10-01 19:01 | - | |
| Critters Attack (2019) 1080p BluRay/ | 2020-10-01 16:08 | - | |
| Crawl (2019) BluRay 1080p/ | 2020-10-01 19:34 | - | |
| Countdown (2019) BluRay 1080p/ | 2021-04-21 13:54 | - | |
| Cosmos.(2019)/ | 2019-11-16 14:51 | - | |
| Corporate Animals (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Conspiracy Chronicles 911 Aliens and the Illuminati (2019) 720p/ | 2020-10-01 16:08 | - | |
| Connect (2019) WEBRip 1080p/ | 2020-10-01 22:25 | - | |
| Colourblind (2019) WEBRip 1080p/ | 2020-10-25 11:19 | - | |
| Color Out Of Space (2019) 1080p BluRay/ | 2020-10-01 22:26 | - | |
| Colewell.2019/ | 2019-12-24 18:32 | - | |
| Cold Pursuit (2019) BluRay 1080p/ | 2020-10-01 22:18 | - | |
| Cold Blood Legacy (2019) 1080p BluRay/ | 2020-10-01 19:34 | - | |
| Coda (2019) 1080p WEBRip/ | 2020-10-01 22:49 | - | |
| Clownado (2019) WEBRip 1080p/ | 2020-10-01 19:15 | - | |
| Clown Motel Spirits Arise (2019) WEBRip 1080p/ | 2020-10-01 22:33 | - | |
| Close (2019) BluRay 1080p/ | 2020-10-16 20:34 | - | |
| Clinton Road (2019) [WEBRip] [1080p] [YTS.LT]/ | 2019-06-21 10:45 | - | |
| Clemency (2019) 1080p WEBRip/ | 2020-10-01 22:25 | - | |
| Cleavers Killer Clowns (2019) WEBRip 1080p/ | 2020-10-01 22:47 | - | |
| Clara (2019) 1080p WEB/ | 2020-10-01 22:39 | - | |
| City of Lies (2019) 720p/ | 2020-10-01 22:52 | - | |
| Cinderela Pop (2019) WEBRip 1080p/ | 2020-10-01 22:29 | - | |
| Chronicle Mysteries - Vines that Bind (2019)/ | 2019-03-05 05:23 | - | |
| Child's Play (2019) BluRay 1080p/ | 2020-10-01 19:40 | - | |
| Chasing Molly (2019) 720p WEB-DL/ | 2020-10-01 22:51 | - | |
| Chase (2019) WEBRip 1080p/ | 2020-10-01 19:08 | - | |
| Charlie's.Angels.2019/ | 2020-04-02 15:30 | - | |
| Char Man (2019) 1080p/ | 2020-10-01 22:28 | - | |
| Changeland (2019) WEBRip 1080p/ | 2020-10-01 22:27 | - | |
| Chain Of Death - 2019 - BluRay 1080p/ | 2020-10-01 22:29 | - | |
| Cecil (2019) WEBRip 1080p/ | 2020-10-01 22:19 | - | |
| Cats (2019) 1080p WEB-DL/ | 2020-10-01 22:25 | - | |
| Catching Faith 2 (2019) 1080p WEBRip/ | 2020-10-01 22:46 | - | |
| Captive State (2019) BluRay 1080p/ | 2020-10-02 21:59 | - | |
| Captive State (2019)/ | 2019-06-04 10:21 | - | |
| Captain Marvel (2019) BluRay 1080p/ | 2026-08-17 14:59 | - | |
| Captain Hagens Bed And Breakfast (2019) 720p/ | 2020-10-01 23:01 | - | |
| Capsized Blood In The Water (2019) 1080p BluRay/ | 2020-10-01 19:39 | - | |
| Capital In The Twenty-First Century (2019) 1080p/ | 2020-10-01 16:08 | - | |
| Candy Corn (2019) WEBRip 1080p/ | 2020-10-01 22:32 | - | |
| Can You Keep A Secret (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Camp Wedding (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Butterfly House (2019) 1080p/ | 2020-10-01 19:08 | - | |
| Busby (2019) BluRay 1080p/ | 2020-10-01 22:16 | - | |
| Burying Yasmeen (2019) WEBRip 1080p/ | 2020-10-16 20:35 | - | |
| Burning Men (2019) WEBRip 1080p/ | 2020-10-01 19:12 | - | |
| Burn (2019) WEBRip 1080p/ | 2020-10-01 22:34 | - | |
| Bundy And The Green River Killer (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Bullitt County (2019) 1080p WEB/ | 2020-10-01 16:50 | - | |
| Brown Boys (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Brittany Runs A Marathon (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| Britains Favourite Sweets (2019)/ | 2020-10-16 20:33 | - | |
| Brightburn (2019) BluRay 1080p/ | 2020-10-01 19:08 | - | |
| Brexit (2019) 1080p/ | 2019-01-10 11:22 | - | |
| Breakthrough (2019) BluRay 1080p/ | 2020-10-01 22:15 | - | |
| Breakneck (2019) 720p WEBRip/ | 2020-10-01 22:15 | - | |
| Breaking Barbi (2019) WEBRip 1080p/ | 2020-10-01 22:14 | - | |
| Breaker (2019) WEBRip 1080p/ | 2020-10-01 22:08 | - | |
| Break Free Two People. Two Years. One Dream (2019) BluRay 1080p/ | 2020-10-01 22:39 | - | |
| Break - 2019 - 1080p WEBRip/ | 2020-10-01 16:08 | - | |
| Boy Genius (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Boudica Rise Of The Warrior Queen (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Bottled with Love (2019) 720p/ | 2020-10-01 22:27 | - | |
| Booksmart (2019) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| Bombshell (2019) 1080p WEBRip/ | 2020-10-01 22:16 | - | |
| Bolden (2019) 720p WEBRip/ | 2020-10-01 19:18 | - | |
| Body At Brighton Rock (2019) BluRay 1080p/ | 2020-10-16 20:33 | - | |
| Blood and Oil (2019) HDRip/ | 2020-10-01 16:50 | - | |
| Blood Vessel (2019) 1080p WEBRip/ | 2020-10-01 22:16 | - | |
| Blood Quantum (2019) 1080p WEBRip/ | 2020-10-01 22:17 | - | |
| Blood Myth (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| Blood Craft (2019) 720p WEB-DL/ | 2020-10-25 11:15 | - | |
| Blood Bound (2019) 1080p/ | 2020-10-02 22:06 | - | |
| Blood.Myth.2019/ | 2019-11-09 09:10 | - | |
| Bliss (2019) WEBRip 1080p/ | 2020-10-16 20:35 | - | |
| Blinded by the Light (2019) NF 1080p/ | 2020-10-01 22:28 | - | |
| Blinded By The Light (2019) BluRay 1080p/ | 2020-10-02 21:43 | - | |
| Blackbear (2019) WEBRip 1080p/ | 2020-10-02 12:01 | - | |
| Black And Blue - 2019 - 1080p/ | 2020-10-01 16:08 | - | |
| Bixler High Private Eye (2019) 720p/ | 2020-10-01 23:01 | - | |
| Bittersweet Symphony (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| Bill Tilghman And The Outlaws (2019) WEBRip 1080p/ | 2020-10-01 22:16 | - | |
| Big.Top.Evil.2019/ | 2019-12-24 18:36 | - | |
| Beyond The Line (2019) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| Beyond.The.Line.2019.1080p.WEB-DL.H264.AC3-EVO/ | 2019-06-28 19:08 | - | |
| Beyond.The.Law.2019/ | 2019-12-24 18:37 | - | |
| Between Two Ferns The Movie (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| Better Than Love (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| Best Friends Betrayal (2019)/ | 2020-10-01 19:09 | - | |
| Berserk (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| Berlin, I Love You (2019) 1080p/ | 2019-02-11 09:54 | - | |
| Bennett's War (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Beneath Us (2019) WEBRip 1080p/ | 2020-10-01 22:47 | - | |
| Beneath The Leaves (2019) WEBRip 1080p/ | 2020-10-01 19:28 | - | |
| Behind The Bullet (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Beach House (2019) 1080p WEB/ | 2020-10-01 19:26 | - | |
| Batman Vs. Teenage Mutant Ninja Turtles (2019) BluRay 1080p/ | 2020-12-09 11:13 | - | |
| Batman Hush (2019) WEBRip 1080p/ | 2026-07-02 12:00 | - | |
| Bare Knuckle Brawler (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Balboa Blvd (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Balance,.Not.Symmetry.2019/ | 2019-12-03 13:06 | - | |
| Bait - 2019 - 1080p BluRay/ | 2020-10-01 19:25 | - | |
| Badland (2019) BluRay 1080p/ | 2020-10-01 19:01 | - | |
| Bad Education (2019) 1080p WEBRip/ | 2020-10-01 22:17 | - | |
| Backdraft II (2019) BluRay 1080p/ | 2020-10-01 22:24 | - | |
| Back Fork (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| BOO! (2019) 1080p/ | 2020-10-01 19:25 | - | |
| BBC How to See a Black Hole (2019) 1080p/ | 2020-10-01 23:02 | - | |
| Aziz Ansari Right Now (2019) 720p NF WEB-DL/ | 2020-10-02 21:55 | - | |
| Awoken (2019) 1080p WEBRip/ | 2020-10-01 22:19 | - | |
| Awake (2019) BluRay 1080p/ | 2020-10-01 22:24 | - | |
| Avengers Endgame (2019) BluRay 1080p/ | 2020-10-01 22:05 | - | |
| Avengement (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Avalanche (2019) WEBRip 1080p/ | 2020-10-01 22:51 | - | |
| Automation.2019/ | 2019-12-24 18:39 | - | |
| Auggie (2019) WEBRip 1080p/ | 2020-10-02 22:11 | - | |
| Atone (2019) 1080p/ | 2019-02-27 10:30 | - | |
| Astronaut (2019) WEBRip 1080p/ | 2020-10-01 16:08 | - | |
| Assimilate (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Artik (2019) WEBRip 1080p/ | 2020-10-01 22:09 | - | |
| Art Of The Dead (2019) WEBRip 1080p/ | 2020-10-01 22:07 | - | |
| Art Of Deception (2019) BluRay 1080p/ | 2020-10-01 19:33 | - | |
| Art.Of.Deception.2019/ | 2019-12-03 13:05 | - | |
| Armstrong (2019) BluRay 1080p/ | 2020-10-01 19:00 | - | |
| Apollo The Forgotten Films (2019) 1080p WEBRip/ | 2020-10-16 20:35 | - | |
| Apollo 11 (2019) BluRay 1080p/ | 2020-10-01 16:50 | - | |
| Any One Of Us (2019) WEBRip 1080p/ | 2020-10-01 22:20 | - | |
| Antiquities (2019) 1080p/ | 2020-10-16 20:34 | - | |
| Annabelle Comes Home (2019) BluRay 1080p/ | 2020-12-26 09:41 | - | |
| Anna (2019) BluRay 1080p/ | 2020-10-02 21:42 | - | |
| Animals.2019/ | 2019-12-24 18:39 | - | |
| Animal Among Us (2019) 1080p BluRay/ | 2020-10-01 22:35 | - | |
| Angrily Ever After (2019) 1080p/ | 2020-10-04 14:49 | - | |
| Angelfish.2019/ | 2019-12-03 13:03 | - | |
| Angelfish (2019) WEBRip 1080p/ | 2020-10-01 22:31 | - | |
| Angel Of Mine (2019) BluRay 1080p/ | 2020-10-01 16:08 | - | |
| Angel Has Fallen (2019) BluRay 1080p/ | 2024-07-30 11:42 | - | |
| Angel.Has.Fallen.2019.1080p.WEB-DL.H264.AC3-EVO/ | 2019-11-12 16:29 | - | |
| An.Affair.to.Die.For.2019/ | 2019-06-04 10:29 | - | |
| Amy Schumer Growing (2019) 720p/ | 2020-10-01 19:04 | - | |
| Amundsen.2019/ | 2019-12-24 18:40 | - | |
| Among Thieves (2019) WEBRip 1080p/ | 2020-10-01 22:47 | - | |
| Among The Shadows (2019) 1080p/ | 2019-03-07 12:21 | - | |
| Among.The.Shadows.2019/ | 2019-11-09 09:09 | - | |
| Amityville Mt Misery Road (2019) HDRip/ | 2020-10-01 23:00 | - | |
| American Son (2019) WEBRip 1080p/ | 2020-10-01 22:26 | - | |
| American Hangman (2019) 720p/ | 2020-10-01 23:01 | - | |
| American Factory (2019) 1080p NF/ | 2020-10-01 22:27 | - | |
| American Exit (2019) BluRay 1080p/ | 2020-10-01 23:03 | - | |
| American Bistro (2019) BluRay 1080p/ | 2020-10-01 22:54 | - | |
| Ambition (2019) WEBRip 1080p/ | 2020-10-25 11:21 | - | |
| Amanda Seales I Be Knowin (2019)/ | 2020-10-01 22:27 | - | |
| Always Be My Maybe (2019) WEBRip 1080p/ | 2020-10-01 23:00 | - | |
| Already Gone (2019) WEBRip 1080p/ | 2020-10-01 19:05 | - | |
| Along Came The Devil 2 (2019) WEBRip 1080p/ | 2020-10-01 22:18 | - | |
| All is True (2019) 1080p WEBRip/ | 2020-10-01 22:34 | - | |
| All You Ever Wished For (2019) WEBRip 1080p/ | 2020-10-01 22:16 | - | |
| All Good Things (2019) WEBRip 1080p/ | 2020-10-01 22:26 | - | |
| Alita Battle Angel (2019) BluRay 1080p/ | 2020-10-01 19:33 | - | |
| Alien Messiah (2019) DVDRip/ | 2020-10-01 19:39 | - | |
| Aladdin (2019) BluRay 1080p/ | 2020-10-01 22:34 | - | |
| Airplane Mode (2019) 1080p WEB-DL/ | 2020-10-01 19:26 | - | |
| Against the Clock A K A Headlock (2019) 720p/ | 2020-10-01 22:17 | - | |
| After The Wedding (2019) BluRay 1080p/ | 2020-10-01 19:09 | - | |
| After She Wakes (2019) WEBRip 1080p/ | 2020-10-01 19:00 | - | |
| After Party (2019) 720p/ | 2020-10-01 22:54 | - | |
| After Class (2019) 1080p BluRay/ | 2020-10-01 16:50 | - | |
| After.She.Wakes.2019/ | 2019-12-24 18:41 | - | |
| After (2019) BluRay 1080p/ | 2020-10-01 19:13 | - | |
| Adventures Of Aladdin (2019) BluRay 1080p/ | 2020-10-01 22:25 | - | |
| Adopt.A.Highway.2019/ | 2019-11-09 09:05 | - | |
| Adonis Complex (2019) 1080p WEBRip/ | 2020-10-01 19:01 | - | |
| Adam (2019) WEBRip 1080p/ | 2020-10-01 22:37 | - | |
| Ad Astra 2019/ | 2019-12-24 18:44 | - | |
| Acceptable Damage (2019) WEBRip 1080p/ | 2020-10-01 22:17 | - | |
| Acceleration.(2019)/ | 2019-11-16 14:51 | - | |
| Above The Shadows (2019) WEBRip 1080p/ | 2020-10-01 22:28 | - | |
| Above The Best (2019) WEBRip 1080p/ | 2020-10-02 22:09 | - | |
| Abigail.2019/ | 2020-01-03 16:55 | - | |
| Abduction 101 (2019) WEBRip 1080p/ | 2020-10-01 19:06 | - | |
| A Winter Princess (2019) Hallmark 720p/ | 2020-10-01 22:17 | - | |
| A War Story (2019) HDTV/ | 2020-10-01 23:02 | - | |
| A Walk With Grace (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| A Violent Separation (2019) WEBRip 1080p/ | 2020-10-01 16:07 | - | |
| A Very Corgi Christmas (2019) WEBRip 1080p/ | 2020-10-01 16:50 | - | |
| A Thousand Miles Behind (2019) 1080p WEBRip/ | 2020-10-01 19:26 | - | |
| A Shaun The Sheep Movie Farmageddon (2019) 1080p/ | 2020-10-01 16:07 | - | |
| A Second Chance Rivals! (2019) 1080p WEBRip/ | 2020-10-01 22:20 | - | |
| A Score To Settle (2019) BluRay 1080p/ | 2020-10-01 22:25 | - | |
| A Rainy Day In New York (2019) BluRay 1080p/ | 2020-10-01 22:20 | - | |
| A Prayer For Compassion (2019) 1080p WEBRip/ | 2020-10-02 22:01 | - | |
| ANYA.2019/ | 2019-12-03 13:04 | - | |
| A Model Kidnapping (2019) WEBRip 1080p/ | 2020-10-01 16:07 | - | |
| A Merry Holiday (2019) 1080p BluRay/ | 2020-10-01 19:15 | - | |
| A Man for Every Month (2019) (PixL) 720p Web/ | 2020-10-01 23:06 | - | |
| A Madea Family Funeral (2019) BluRay 1080p/ | 2020-10-01 22:24 | - | |
| A Kiss On Candy Cane Lane (2019) WEBRip 1080p/ | 2020-10-01 19:30 | - | |
| A Hidden Life (2019) DVDSCR/ | 2020-10-02 21:54 | - | |
| A Hidden Life (2019) 1080p BluRay/ | 2020-10-01 22:23 | - | |
| A Haunting At Silver Falls The Return (2019) WEBRip 1080p/ | 2020-10-01 22:48 | - | |
| A Guide To Second Date Sex (2019) WEBRip 1080p/ | 2020-10-01 16:07 | - | |
| A Good Woman Is Hard To Find (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| A Fiend's Love (2019) WEBRip 1080p/ | 2020-10-02 12:01 | - | |
| A Dog's Way Home (2019) BluRay 1080p/ | 2020-10-01 16:07 | - | |
| A Dog's Journey (2019) WEBRip 1080p/ | 2020-10-01 22:03 | - | |
| A Champion Heart (2019) BDRip/ | 2020-10-01 22:10 | - | |
| A Brothers Honor (2019) 720p/ | 2020-10-01 22:11 | - | |
| A Beautiful Day In The Neighborhood (2019) 1080p BluRay/ | 2021-09-05 07:55 | - | |
| A.Violent.Separation.2019/ | 2019-12-24 16:58 | - | |
| A.M.I. (2019) WEBRip 1080p/ | 2020-10-01 19:03 | - | |
| 7500 (2019) 1080p BluRay/ | 2020-10-01 16:07 | - | |
| 3022.2019/ | 2019-12-03 13:02 | - | |
| 2177 The San Francisco Love Hacker Crimes (2019) 1080p WEBrip/ | 2020-10-01 22:19 | - | |
| 2040 (2019) 1080p BluRay/ | 2020-10-01 22:49 | - | |
| 1917 (2019) 1080p BluRay/ | 2020-10-01 22:26 | - | |
| 100 Yards (2019) WEBRip 1080p/ | 2020-10-01 22:45 | - | |
| 100 Acres Of Hell (2019) 1080p/ | 2020-10-01 16:50 | - | |
| 47 Meters Down Uncaged (2019) WEBRip 1080p/ | 2019-10-28 14:27 | - | |
| 47 Hours To Live (2019) 1080p WEBRip/ | 2020-10-01 22:59 | - | |
| 30 Nights of Sex (2019) HDRip/ | 2020-10-01 16:07 | - | |
| 30 Miles to Nowhere (2019) 1080p WEB-DL/ | 2020-10-01 22:02 | - | |
| 21 Bridges (2019) 1080p BluRay/ | 2022-09-23 07:04 | - | |
| 21.Years.Quentin.Tarantino.2019/ | 2019-12-24 16:57 | - | |
| 15 Minutes Of War (2019) [1080p]/ | 2019-06-21 10:45 | - | |
| 13 Moments That Killed Whitney Houston (2019) 720p HDTV/ | 2020-10-01 19:36 | - | |
| 13 Graves (2019) WEBRip 1080p/ | 2020-10-01 19:40 | - | |
| 10 Minutes Gone (2019) WEBRip 1080p/ | 2019-11-09 10:07 | - | |
| 10E (2019) 1080p WEBRip/ | 2020-10-01 16:50 | - | |
| 7 Days To Vegas (2019) WEBRip 1080p/ | 2020-10-02 12:01 | - | |
| 6 Underground (2019) WEBRip 1080p/ | 2020-10-01 22:21 | - | |
| 5th Of July (2019) WEBRip 1080p/ | 2020-10-16 20:33 | - | |
| 4 Latas (2019) WEBRip 1080p/ | 2020-10-01 22:24 | - | |
| 3 Lives (2019) 1080p WEB-DL/ | 2020-10-01 22:18 | - | |
| 3 From Hell (2019) BluRay 1080p/ | 2020-10-01 22:06 | - | |
| 3 Days With Dad (2019) WEBRip 1080p/ | 2020-10-02 22:09 | - | |
| 3 Bears Christmas (2019) WEBRip 1080p/ | 2020-10-16 20:34 | - | |
| 1st Summoning (2019) 1080p WEB/ | 2020-10-25 11:13 | - | |
| 1BR (2019) 1080p WEBRip/ | 2020-10-01 19:39 | - | |
| 1 2 New Year (2019) WEBRip 1080p/ | 2020-10-01 18:33 | - | |
| #Followme (2019) WEBRip 1080p/ | 2020-10-01 22:50 | - | |
|
|---|