![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4 board bench.pdf | 2017-03-13 09:08 | 678K | |
| Address Plaque.pdf | 2017-03-13 09:08 | 2.2M | |
| Adirondack Chair.pdf | 2017-03-13 09:08 | 562K | |
| Adirondack Chair 1.pdf | 2017-03-13 09:08 | 833K | |
| Adjustable Plant Shelves.pdf | 2017-03-13 09:08 | 645K | |
| Arbor Bench.pdf | 2017-03-13 09:07 | 880K | |
| Armchair.pdf | 2017-03-13 09:08 | 639K | |
| Artists Easel.pdf | 2017-03-13 09:07 | 3.2M | |
| Arts and Crafts Chair.pdf | 2017-03-13 09:08 | 1.9M | |
| B-B-Que Trolly.pdf | 2017-03-13 09:09 | 1.0M | |
| Baby Changing Table.pdf | 2017-03-13 09:08 | 1.0M | |
| Bandsaw Box.pdf | 2017-03-13 09:07 | 343K | |
| Barrister Bookcase.pdf | 2017-03-13 09:08 | 1.0M | |
| Basic Board Fence.pdf | 2017-03-13 09:08 | 788K | |
| Basic Table.pdf | 2017-03-13 09:09 | 1.0M | |
| Bathroom Mirror.pdf | 2017-03-13 09:09 | 555K | |
| Bathroom Shelf.pdf | 2017-03-13 09:08 | 552K | |
| Bathroom Towel Rack.pdf | 2017-03-13 09:08 | 352K | |
| Bedside Table.pdf | 2017-03-13 09:07 | 512K | |
| Bench Seat.pdf | 2017-03-13 09:08 | 719K | |
| Bendwood boxes.pdf | 2017-03-13 09:08 | 680K | |
| Bentwood Box.pdf | 2017-03-13 09:07 | 930K | |
| Bird Feeder.pdf | 2017-03-13 09:08 | 322K | |
| Bird House.pdf | 2017-03-13 09:05 | 24K | |
| Bird House 1.pdf | 2017-03-13 09:08 | 877K | |
| Bit Shelf.pdf | 2017-03-13 09:08 | 42K | |
| Blanket chest.pdf | 2017-03-13 09:08 | 469K | |
| Book Case (Mission Style).pdf | 2017-03-13 09:05 | 359K | |
| Book Case 1.pdf | 2017-03-13 09:08 | 1.1M | |
| Book Case 2.pdf | 2017-03-13 09:08 | 1.0M | |
| Bookcase 1.pdf | 2017-03-13 09:08 | 188K | |
| Bookcase 2.pdf | 2017-03-13 09:08 | 74K | |
| Bookcase End Table.pdf | 2017-03-13 09:07 | 122K | |
| Bow Saw.pdf | 2017-03-13 09:08 | 1.5M | |
| Bread Box.pdf | 2017-03-13 09:08 | 526K | |
| Brydcliffe Cabinet.pdf | 2017-03-13 09:08 | 530K | |
| Build a Toy Box.pdf | 2017-03-13 09:08 | 558K | |
| Build a Work Bench.pdf | 2017-03-13 09:07 | 192K | |
| Bungalow Mailbox.pdf | 2017-03-13 09:03 | 586K | |
| Bunk Beds.pdf | 2017-03-13 09:07 | 1.0M | |
| Cabinet Bathroom.pdf | 2017-03-13 09:07 | 797K | |
| Candle Stands.pdf | 2017-03-13 09:08 | 408K | |
| Candle box.pdf | 2017-03-13 09:08 | 897K | |
| Candlelabra.pdf | 2017-03-13 09:08 | 651K | |
| Cappucino Bar.pdf | 2017-03-13 09:08 | 490K | |
| Carved Fruit Bowl.pdf | 2017-03-13 09:08 | 1.3M | |
| Cassette Holder.pdf | 2017-03-13 09:04 | 348K | |
| Chairside Bookcase.pdf | 2017-03-13 09:08 | 639K | |
| Chattahoochee Chair.pdf | 2017-03-13 09:08 | 220K | |
| Cherry End Table.pdf | 2017-03-13 09:07 | 1.2M | |
| Chess Table.pdf | 2017-03-13 09:08 | 1.3M | |
| Chest of Drawers 2.pdf | 2017-03-13 09:07 | 118K | |
| Child's Bed.pdf | 2017-03-13 09:08 | 714K | |
| Child's Cradle.pdf | 2017-03-13 09:07 | 738K | |
| Child's Easel.pdf | 2017-03-13 09:08 | 454K | |
| Children's Bunkhouse Loft.pdf | 2017-03-13 09:08 | 1.6M | |
| Childrens Play Structure.pdf | 2017-03-13 09:08 | 1.2M | |
| Childs Armoire.pdf | 2017-03-13 09:08 | 1.3M | |
| China Hutch.pdf | 2017-03-13 09:07 | 1.3M | |
| Chip Box.pdf | 2017-03-13 09:08 | 929K | |
| Chippendale Mirror.pdf | 2017-03-13 09:08 | 932K | |
| Christmas Ornaments.pdf | 2017-03-13 09:07 | 504K | |
| Classic Rocker.pdf | 2017-03-13 09:08 | 2.2M | |
| Clock and Weather Station.pdf | 2017-03-13 09:08 | 1.3M | |
| Closet Organiser.pdf | 2017-03-13 09:07 | 289K | |
| Clothes Rack.pdf | 2017-03-13 09:07 | 587K | |
| Coffee Table -1.pdf | 2017-03-13 09:01 | 244K | |
| Coffee Table .pdf | 2017-03-13 09:07 | 1.2M | |
| Coffee Table 1.pdf | 2017-03-13 09:07 | 114K | |
| Coffee Table 2.pdf | 2017-03-13 09:08 | 477K | |
| Coffee Table 3.pdf | 2017-03-13 09:06 | 214K | |
| Cold Frame 1.pdf | 2017-03-13 09:08 | 63K | |
| Cold Frame 2.pdf | 2017-03-13 08:59 | 55K | |
| Computer Desk.pdf | 2017-03-13 09:08 | 1.5M | |
| Computer Workstation.pdf | 2017-03-13 09:08 | 1.3M | |
| Concord Table.pdf | 2017-03-13 09:08 | 717K | |
| Concorde Table.pdf | 2017-03-13 09:08 | 435K | |
| Console Table.pdf | 2017-03-13 09:08 | 1.5M | |
| Corner Cabinet.pdf | 2017-03-13 09:08 | 482K | |
| Corner Cabinet 1.pdf | 2017-03-13 09:06 | 1.3M | |
| Corner Cabinet 2.pdf | 2017-03-13 09:07 | 871K | |
| Corner Cupboard.pdf | 2017-03-13 09:08 | 2.3M | |
| Corner Display Cabinet.pdf | 2017-03-13 09:08 | 803K | |
| Corner Shelf.pdf | 2017-03-13 09:05 | 80K | |
| Country Dry Sink.pdf | 2017-03-13 09:05 | 81K | |
| Credenza.pdf | 2017-03-13 09:08 | 1.2M | |
| Cupboard.pdf | 2017-03-13 09:07 | 22K | |
| Curio Table.pdf | 2017-03-13 09:05 | 181K | |
| Cutting Board 1.pdf | 2017-03-13 09:07 | 348K | |
| Cutting Board 2.pdf | 2017-03-13 09:08 | 381K | |
| Deck.pdf | 2017-03-13 09:05 | 105K | |
| Deck 1 .pdf | 2017-03-13 09:08 | 1.1M | |
| Deck Bench.pdf | 2017-03-13 09:08 | 745K | |
| Decking..pdf | 2017-03-13 09:08 | 1.0M | |
| Desk Set.pdf | 2017-03-13 09:08 | 2.1M | |
| Dog House Project Plan.pdf | 2017-03-13 09:08 | 98K | |
| Drawer Building Basics.pdf | 2017-03-13 09:08 | 347K | |
| Drop leaf table.pdf | 2017-03-13 09:08 | 37K | |
| Farm Table.pdf | 2017-03-13 09:08 | 864K | |
| Feather Board.pdf | 2017-03-13 09:07 | 15K | |
| Feed Table.pdf | 2017-03-13 09:07 | 15K | |
| Fence.pdf | 2017-03-13 09:05 | 81K | |
| Finishing Easel.pdf | 2017-03-13 09:07 | 59K | |
| Fishing Rod Holder.pdf | 2017-03-13 09:04 | 33K | |
| Floor Lamp (Mission Style).pdf | 2017-03-13 09:07 | 197K | |
| Folding Bar Stool.pdf | 2017-03-13 09:08 | 1.3M | |
| Folding Garden Chair.pdf | 2017-03-13 09:09 | 2.2M | |
| Four Ways to Build a Tavern Table.pdf | 2017-03-13 09:04 | 46K | |
| Futon Sofa Bed.pdf | 2017-03-13 09:02 | 94K | |
| Garden Bench 1.pdf | 2017-03-13 09:08 | 473K | |
| Garden Bench 2.pdf | 2017-03-13 09:07 | 117K | |
| Garden Shed Project Plan.pdf | 2017-03-13 09:08 | 161K | |
| Gate Leg Table.pdf | 2017-03-13 09:08 | 1.3M | |
| Gazebo.pdf | 2017-03-13 09:06 | 137K | |
| Glass Top Table.pdf | 2017-03-13 09:08 | 316K | |
| Granfather Clock Curio.pdf | 2017-03-13 09:04 | 59K | |
| Headboard Fit for a King.pdf | 2017-03-13 09:04 | 78K | |
| High Chair.pdf | 2017-03-13 09:08 | 110K | |
| Horse Box Stalls.pdf | 2017-03-13 09:08 | 122K | |
| IceBox.pdf | 2017-03-13 09:04 | 166K | |
| Jewellary box.pdf | 2017-03-13 09:06 | 203K | |
| Just Sheds.pdf | 2017-03-13 09:07 | 1.5M | |
| Kennel Plans.pdf | 2017-03-13 09:08 | 121K | |
| Kitchen Cabinets.pdf | 2017-03-13 09:08 | 306K | |
| Kitchen Knife Block.pdf | 2017-03-13 09:04 | 51K | |
| Kitchen Workstation.pdf | 2017-03-13 09:07 | 503K | |
| Loft Bed.pdf | 2017-03-13 09:08 | 1.5M | |
| Lumber Storage Rack.pdf | 2017-03-13 09:07 | 595K | |
| Medicine Cabinet.pdf | 2017-03-13 09:08 | 221K | |
| Murphy Bed.pdf | 2017-03-13 09:08 | 349K | |
| Music Box.pdf | 2017-03-13 09:05 | 108K | |
| Nesting Tables.pdf | 2017-03-13 09:07 | 207K | |
| Oil Stone Box.pdf | 2017-03-13 09:07 | 23K | |
| Outside Stairs.pdf | 2017-03-13 09:07 | 250K | |
| Over Garage Door Lumber Rack.pdf | 2017-03-13 09:08 | 345K | |
| Panel Door.pdf | 2017-03-13 09:08 | 1.3M | |
| Paper Towel Holder.pdf | 2017-03-13 09:07 | 223K | |
| Parsons Table.pdf | 2017-03-13 09:05 | 330K | |
| Patio Coffee Table.pdf | 2017-03-13 09:05 | 109K | |
| Patio Side Table.pdf | 2017-03-13 09:06 | 101K | |
| Picket fence Planter.pdf | 2017-03-13 09:08 | 143K | |
| Picnic Table.pdf | 2017-03-13 09:04 | 61K | |
| Pine Bed.pdf | 2017-03-13 09:07 | 421K | |
| Plans For Drill Vise.pdf | 2017-03-13 09:07 | 58K | |
| Plans for Radial Drill Press.pdf | 2017-03-13 09:08 | 592K | |
| Plant Stand.pdf | 2017-03-13 09:04 | 101K | |
| Planter.pdf | 2017-03-13 09:08 | 603K | |
| Planter Bench 1.pdf | 2017-03-13 09:07 | 183K | |
| Planter Bench 2.pdf | 2017-03-13 09:04 | 170K | |
| Planters Work Bench.pdf | 2017-03-13 09:04 | 32K | |
| Playground Equipment.pdf | 2017-03-13 09:07 | 204K | |
| Plywood Window Box.pdf | 2017-03-13 09:07 | 78K | |
| Poker Chip Box.pdf | 2017-03-13 09:05 | 81K | |
| Pool Cue Ball Rack.pdf | 2017-03-13 09:09 | 425K | |
| Professional Router Table.pdf | 2017-03-13 09:08 | 470K | |
| Pump House.pdf | 2017-03-13 09:08 | 139K | |
| Quick and Easy Router Table.pdf | 2017-03-13 09:04 | 47K | |
| Redwood Deck over Concrete.pdf | 2017-03-13 09:08 | 266K | |
| Routed Address Sign.pdf | 2017-03-13 09:04 | 164K | |
| Router Table.pdf | 2017-03-13 09:04 | 32K | |
| Saw Blade Holder.pdf | 2017-03-13 09:08 | 99K | |
| Secretary Desk.pdf | 2017-03-13 09:08 | 281K | |
| Seedling Shelter.pdf | 2017-03-13 09:07 | 58K | |
| Shaker Bed.pdf | 2017-03-13 09:07 | 756K | |
| Shaker Bench.pdf | 2017-03-13 09:07 | 22K | |
| Shaker Nightstand.pdf | 2017-03-13 09:08 | 858K | |
| Shaker Single Drop leaf Table.pdf | 2017-03-13 09:08 | 461K | |
| Shed 6x8 plans.pdf | 2017-03-13 09:07 | 652K | |
| Shed 10x16 plans.pdf | 2017-03-13 09:08 | 946K | |
| Shed 12x8 plans.pdf | 2017-03-13 09:08 | 3.5M | |
| Shelving.pdf | 2017-03-13 09:05 | 26K | |
| Simple Bench.pdf | 2017-03-13 09:08 | 247K | |
| Simple Garden Workbench Or Table.pdf | 2017-03-13 09:02 | 150K | |
| Single Bed.pdf | 2017-03-13 09:02 | 87K | |
| Sink Shelf.pdf | 2017-03-13 09:08 | 307K | |
| Solar Greenhouse.pdf | 2017-03-13 09:07 | 19K | |
| Space Saver Workbench.pdf | 2017-03-13 09:08 | 245K | |
| Spice Cabinet.pdf | 2017-03-13 09:07 | 22K | |
| Staircase.pdf | 2017-03-13 09:07 | 147K | |
| Standing Router Table.pdf | 2017-03-13 09:07 | 387K | |
| Step Stool 1.pdf | 2017-03-13 09:08 | 518K | |
| Step Stool 2.pdf | 2017-03-13 09:07 | 1.0M | |
| Stickley Side Table 1.pdf | 2017-03-13 09:07 | 18K | |
| Stickley Side Table 2.pdf | 2017-03-13 09:08 | 40K | |
| Swing.pdf | 2017-03-13 09:04 | 128K | |
| TV Stand.pdf | 2017-03-13 09:08 | 37K | |
| TV VCR Cabinet.pdf | 2017-03-13 09:04 | 94K | |
| Table Saw Mitre Jig.pdf | 2017-03-13 09:08 | 72K | |
| Tank Heaven.pdf | 2017-03-13 09:02 | 110K | |
| Tansu.pdf | 2017-03-13 09:05 | 24K | |
| Tape Measure Case.pdf | 2017-03-13 09:06 | 463K | |
| Tapered Planter.pdf | 2017-03-13 09:05 | 28K | |
| Tavern Table.pdf | 2017-03-13 09:05 | 23K | |
| Teddy Bear Puzzle.pdf | 2017-03-13 09:08 | 1.1M | |
| The Colonial Dry Sink.pdf | 2017-03-13 09:08 | 111K | |
| Traditional Entertainment Centre.pdf | 2017-03-13 09:06 | 102K | |
| Traditional Workbench 1.pdf | 2017-03-13 09:08 | 557K | |
| Traditional Workbench 2.pdf | 2017-03-13 09:08 | 1.3M | |
| Trash Can Corral.pdf | 2017-03-13 09:04 | 88K | |
| Trestle Coffee Table.pdf | 2017-03-13 09:07 | 714K | |
| Utility Bench.pdf | 2017-03-13 09:08 | 74K | |
| Utility Shed.pdf | 2017-03-13 09:08 | 184K | |
| Versatile Planter.pdf | 2017-03-13 09:08 | 603K | |
| Wall Bench.pdf | 2017-03-13 09:08 | 72K | |
| Wheelbarrow Planter.pdf | 2017-03-13 09:08 | 732K | |
| Wine Rack.pdf | 2017-03-13 09:06 | 105K | |
| Wooden Box.pdf | 2017-03-13 09:05 | 323K | |
| Work Bench 1.pdf | 2017-03-13 09:04 | 79K | |
| Work Bench 2.pdf | 2017-03-13 09:08 | 433K | |
| Work Bench 3.pdf | 2017-03-13 09:05 | 108K | |
| Work Bench Tracks.pdf | 2017-03-13 09:08 | 399K | |